3-(4-(quinolin-5-ylamino)pyrimidin-2-ylamino)benzamide

ID: ALA250543

PubChem CID: 25138041

Max Phase: Preclinical

Molecular Formula: C20H16N6O

Molecular Weight: 356.39

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  NC(=O)c1cccc(Nc2nccc(Nc3cccc4ncccc34)n2)c1

Standard InChI:  InChI=1S/C20H16N6O/c21-19(27)13-4-1-5-14(12-13)24-20-23-11-9-18(26-20)25-17-8-2-7-16-15(17)6-3-10-22-16/h1-12H,(H2,21,27)(H2,23,24,25,26)

Standard InChI Key:  MODRKXWTPQZUGE-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 27 30  0  0  0  0  0  0  0  0999 V2000
   12.7231   -9.3443    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.7219  -10.1720    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.4370  -10.5850    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.1536  -10.1715    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.1507   -9.3407    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.4352   -8.9315    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.8639   -8.9254    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   15.5801   -9.3353    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.5798  -10.1582    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   16.2952  -10.5681    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.0093  -10.1526    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.0035   -9.3232    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.2876   -8.9171    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   16.2979  -11.3933    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   17.0139  -11.8035    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.0132  -12.6298    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.7283  -13.0400    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.4368  -11.4102    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.7220  -11.8226    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   14.1513  -11.8229    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   18.4386  -12.6205    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.7215  -11.3890    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.4352  -11.7951    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.1416  -11.3804    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   19.1357  -10.5596    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.4174  -10.1552    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.7139  -10.5724    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
 13  8  1  0
  1  2  2  0
 10 14  1  0
  5  7  1  0
 14 15  1  0
  3  4  2  0
 15 16  2  0
  7  8  1  0
 16 17  1  0
 17 21  2  0
 22 15  1  0
  3 18  1  0
  8  9  2  0
 18 19  2  0
  4  5  1  0
 18 20  1  0
  9 10  1  0
 23 21  1  0
  2  3  1  0
 10 11  2  0
 22 23  1  0
  5  6  2  0
 23 24  2  0
 11 12  1  0
 24 25  1  0
  6  1  1  0
 25 26  2  0
 12 13  2  0
 26 27  1  0
 27 22  2  0
M  END

Associated Targets(non-human)

Lck Tyrosine-protein kinase LCK (196 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 356.39Molecular Weight (Monoisotopic): 356.1386AlogP: 3.61#Rotatable Bonds: 5
Polar Surface Area: 105.82Molecular Species: NEUTRALHBA: 6HBD: 3
#RO5 Violations: HBA (Lipinski): 7HBD (Lipinski): 4#RO5 Violations (Lipinski):
CX Acidic pKa: 12.84CX Basic pKa: 4.71CX LogP: 3.21CX LogD: 3.21
Aromatic Rings: 4Heavy Atoms: 27QED Weighted: 0.50Np Likeness Score: -1.50

References

1. Bamborough P, Angell RM, Bhamra I, Brown D, Bull J, Christopher JA, Cooper AW, Fazal LH, Giordano I, Hind L, Patel VK, Ranshaw LE, Sims MJ, Skone PA, Smith KJ, Vickerstaff E, Washington M..  (2007)  N-4-Pyrimidinyl-1H-indazol-4-amine inhibitors of Lck: indazoles as phenol isosteres with improved pharmacokinetics.,  17  (15): [PMID:17600705] [10.1016/j.bmcl.2007.04.029]

Source