The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
dankasterone A ID: ALA250639
PubChem CID: 24179112
Max Phase: Preclinical
Molecular Formula: C28H40O3
Molecular Weight: 424.63
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CC(C)[C@@H](C)/C=C/[C@@H](C)[C@H]1CCC(=O)[C@]23CC(=O)C4=CC(=O)CC[C@]4(C)[C@H]2CC[C@]13C
Standard InChI: InChI=1S/C28H40O3/c1-17(2)18(3)7-8-19(4)21-9-10-25(31)28-16-23(30)22-15-20(29)11-13-26(22,5)24(28)12-14-27(21,28)6/h7-8,15,17-19,21,24H,9-14,16H2,1-6H3/b8-7+/t18-,19+,21+,24+,26-,27+,28-/m0/s1
Standard InChI Key: MHVQURVXZWOWCF-VODCKUOWSA-N
Molfile:
RDKit 2D
33 36 0 0 1 0 0 0 0 0999 V2000
-0.8479 -1.1000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.1375 -1.5125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.5710 -1.1057 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.5753 -0.2849 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.1351 0.1276 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.8499 -0.2807 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.7125 -1.1046 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.7125 -1.9341 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.9980 -2.3466 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.9980 -0.6875 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.2790 -1.1046 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.2779 -1.9341 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.5629 -2.3457 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.8444 -1.9324 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.5651 -0.6866 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.1322 0.9526 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.5837 1.3626 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.8452 1.3676 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2967 0.9476 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.0125 1.3576 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.7256 0.9427 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.4415 1.3527 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.7227 0.1177 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.0154 2.1826 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.5729 0.5454 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
-1.9846 0.0321 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2696 0.4354 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.8571 0.5454 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.5721 -1.5079 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
-2.2871 -0.2796 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.5630 -3.1707 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-4.4269 -2.3466 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.1396 -2.3375 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 6
5 16 1 0
1 6 1 0
16 17 1 0
2 3 1 0
16 18 1 6
7 10 1 0
17 19 2 0
8 9 1 0
19 20 1 0
9 12 2 0
20 21 1 0
11 10 1 0
21 22 1 0
11 12 1 0
21 23 1 0
3 4 1 0
20 24 1 6
4 5 1 0
5 25 1 6
5 6 1 0
15 26 1 0
7 8 1 0
6 27 1 0
27 26 1 0
6 28 1 1
11 15 1 0
15 29 1 6
12 13 1 0
11 30 1 1
13 14 1 0
13 31 2 0
14 1 1 0
8 32 2 0
1 15 1 0
2 33 2 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 424.63Molecular Weight (Monoisotopic): 424.2977AlogP: 6.12#Rotatable Bonds: 4Polar Surface Area: 51.21Molecular Species: NEUTRALHBA: 3HBD: ┄#RO5 Violations: 1HBA (Lipinski): 3HBD (Lipinski): ┄#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: ┄CX LogP: 6.28CX LogD: 6.28Aromatic Rings: ┄Heavy Atoms: 31QED Weighted: 0.51Np Likeness Score: 2.89
References 1. Amagata T, Tanaka M, Yamada T, Doi M, Minoura K, Ohishi H, Yamori T, Numata A.. (2007) Variation in cytostatic constituents of a sponge-derived Gymnascella dankaliensis by manipulating the carbon source., 70 (11): [PMID:17988094 ] [10.1021/np070165m ]