1-(3',3'-diphenylpropyl)-4-[2'-(2'',4''-dichlorophenyl)ethyl]-7-[N-(aminocarbonylmethyl)-N-[(tetrahydrofuran-2'-yl)methyl]-aminocarbonyl]perhydro-1,4-diazepine-2,5-dione

ID: ALA252123

PubChem CID: 24777790

Max Phase: Preclinical

Molecular Formula: C36H40Cl2N4O5

Molecular Weight: 679.64

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  NC(=O)CN(CC1CCCO1)C(=O)C1CC(=O)N(CCc2ccc(Cl)cc2Cl)CC(=O)N1CCC(c1ccccc1)c1ccccc1

Standard InChI:  InChI=1S/C36H40Cl2N4O5/c37-28-14-13-27(31(38)20-28)15-17-40-24-35(45)42(18-16-30(25-8-3-1-4-9-25)26-10-5-2-6-11-26)32(21-34(40)44)36(46)41(23-33(39)43)22-29-12-7-19-47-29/h1-6,8-11,13-14,20,29-30,32H,7,12,15-19,21-24H2,(H2,39,43)

Standard InChI Key:  LDTMVMCGYNZNOI-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 47 51  0  0  0  0  0  0  0  0999 V2000
   -0.0350  -20.0443    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7096  -19.6979    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4510  -20.0641    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.2278  -20.8484    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.6293  -20.8682    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.2811  -21.4995    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.1071  -21.5054    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.6737  -19.5221    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0339  -21.0237    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.5888  -20.4131    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.3950  -20.5884    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.9473  -19.9752    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.7528  -20.1500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.0048  -20.9365    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.4451  -21.5484    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.6417  -21.3705    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4574  -22.2523    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.4318  -21.0597    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6672  -21.8503    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.4697  -22.0418    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.7052  -22.8325    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.0368  -21.4425    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.1369  -23.4275    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.3718  -24.2176    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.1751  -24.4096    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.7431  -23.8055    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.5052  -23.0177    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.8390  -21.6360    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.4057  -21.0375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.1704  -20.2459    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.3632  -20.0560    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.7999  -20.6559    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1001  -19.5549    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8656  -19.8625    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.9837  -18.7381    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.6328  -18.2290    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2182  -18.4306    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.0844  -21.9788    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
   -4.8107  -21.1128    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
    3.3984  -18.5365    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.0475  -18.0274    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.5147  -19.3533    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.1018  -17.6138    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.6917  -17.0399    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.3286  -16.2991    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.5118  -16.4155    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3702  -17.2283    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
 21 23  2  0
  4  6  1  0
 23 24  1  0
 11 12  2  0
 24 25  2  0
  1  2  1  0
 25 26  1  0
 12 13  1  0
 26 27  2  0
 27 21  1  0
  5  7  1  0
 22 28  2  0
 13 14  2  0
 28 29  1  0
  6  7  1  0
 29 30  2  0
 14 15  1  0
 30 31  1  0
  1  4  1  0
 31 32  2  0
 32 22  1  0
 15 16  2  0
  3 33  1  0
 16 11  1  0
 33 34  2  0
  1  8  2  0
 33 35  1  0
  7 17  2  0
 35 36  1  0
 35 37  1  0
  5 18  1  0
 16 38  1  0
  4  9  1  0
 14 39  1  0
 18 19  1  0
 36 40  1  0
  3  5  1  0
 40 41  1  0
 19 20  1  0
 40 42  2  0
  9 10  1  0
 43 37  1  0
 43 44  1  0
 20 21  1  0
  2  3  1  0
 20 22  1  0
 10 11  1  0
 44 45  1  0
 45 46  1  0
 46 47  1  0
 47 43  1  0
M  END

Associated Targets(Human)

SAOS-2 (672 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 679.64Molecular Weight (Monoisotopic): 678.2376AlogP: 4.68#Rotatable Bonds: 13
Polar Surface Area: 113.25Molecular Species: NEUTRALHBA: 5HBD: 1
#RO5 Violations: 1HBA (Lipinski): 9HBD (Lipinski): 2#RO5 Violations (Lipinski): 1
CX Acidic pKa: CX Basic pKa: CX LogP: 3.99CX LogD: 3.99
Aromatic Rings: 3Heavy Atoms: 47QED Weighted: 0.28Np Likeness Score: -0.85

References

1. Mondragón L, Orzáez M, Sanclimens G, Moure A, Armiñán A, Sepúlveda P, Messeguer A, Vicent MJ, Pérez-Payá E..  (2008)  Modulation of cellular apoptosis with apoptotic protease-activating factor 1 (Apaf-1) inhibitors.,  51  (3): [PMID:18197610] [10.1021/jm701195j]

Source