The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
pyrrolidin-3-yl 4-(hydroxycarbamoyl)-4-((4-o-tolylpiperidin-1-ylsulfonyl)methyl)piperidine-1-carboxylate ID: ALA252612
PubChem CID: 11547967
Max Phase: Preclinical
Molecular Formula: C24H36N4O6S
Molecular Weight: 508.64
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: Cc1ccccc1C1CCN(S(=O)(=O)CC2(C(=O)NO)CCN(C(=O)OC3CCNC3)CC2)CC1
Standard InChI: InChI=1S/C24H36N4O6S/c1-18-4-2-3-5-21(18)19-7-12-28(13-8-19)35(32,33)17-24(22(29)26-31)9-14-27(15-10-24)23(30)34-20-6-11-25-16-20/h2-5,19-20,25,31H,6-17H2,1H3,(H,26,29)
Standard InChI Key: PWJXCFJUGNPSAZ-UHFFFAOYSA-N
Molfile:
RDKit 2D
35 38 0 0 0 0 0 0 0 0999 V2000
6.0951 -2.2876 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.5180 -2.9960 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.3384 -2.9841 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
6.4926 -1.5672 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2276 -3.0552 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.6250 -2.3322 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.1973 -1.6265 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.4498 -2.3148 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.8749 -3.0257 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.6962 -3.0103 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.6711 -1.5815 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.8436 -1.5954 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.1609 -2.9679 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.3525 -3.8091 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.3221 -2.1592 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.3175 -1.5512 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.0664 -0.8609 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.4650 -0.1384 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.5849 -3.6739 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.4038 -3.6597 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.8048 -2.9410 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.3808 -2.2351 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.5556 -2.2477 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.6279 -2.9288 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.0511 -3.6383 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.8753 -3.6255 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.2772 -2.9039 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.8489 -2.1938 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.0261 -2.2101 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.6003 -1.5034 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4027 -3.0727 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.9049 -2.4126 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.1258 -2.6840 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.1433 -3.5090 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.9331 -3.7472 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
17 18 1 0
13 19 1 0
5 6 1 0
1 4 1 0
8 12 1 0
9 10 1 0
10 1 1 0
13 23 1 0
19 20 1 0
20 21 1 0
21 22 1 0
22 23 1 0
1 11 1 0
11 12 1 0
24 25 2 0
6 7 2 0
25 26 1 0
3 13 1 0
26 27 2 0
2 3 1 0
27 28 1 0
3 14 2 0
28 29 2 0
29 24 1 0
21 24 1 0
6 8 1 0
29 30 1 0
3 15 2 0
31 5 1 0
31 32 1 0
8 9 1 0
4 16 2 0
4 17 1 0
32 33 1 0
33 34 1 0
34 35 1 0
35 31 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 508.64Molecular Weight (Monoisotopic): 508.2356AlogP: 1.59#Rotatable Bonds: 6Polar Surface Area: 128.28Molecular Species: BASEHBA: 7HBD: 3#RO5 Violations: 1HBA (Lipinski): 10HBD (Lipinski): 3#RO5 Violations (Lipinski): 1CX Acidic pKa: 8.80CX Basic pKa: 10.12CX LogP: -0.67CX LogD: -1.80Aromatic Rings: 1Heavy Atoms: 35QED Weighted: 0.39Np Likeness Score: -0.64
References 1. Burns DM, He C, Li Y, Scherle P, Liu X, Marando CA, Covington MB, Yang G, Pan M, Turner S, Fridman JS, Hollis G, Vaddi K, Yeleswaram S, Newton R, Friedman S, Metcalf B, Yao W.. (2008) Conversion of an MMP-potent scaffold to an MMP-selective HER-2 sheddase inhibitor via scaffold hybridization and subtle P1' permutations., 18 (2): [PMID:18068976 ] [10.1016/j.bmcl.2007.11.086 ]