amphidinolide B6

ID: ALA252928

PubChem CID: 23656974

Max Phase: Preclinical

Molecular Formula: C32H54O8

Molecular Weight: 566.78

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Synonyms: Amphidinolide B6 | amphidinolide B6|CHEMBL252928|(1S,6S,7S,10S,12R,13S,14R,17S,19S,20E,24R,26S)-6,13,14,17-tetrahydroxy-7,10,12,19,20,24-hexamethyl-22-methylidene-9,27-dioxabicyclo[24.1.0]heptacos-20-ene-8,15-dione

Canonical SMILES:  C=C1/C=C(\C)[C@@H](C)C[C@H](O)CC(=O)[C@H](O)[C@@H](O)[C@H](C)C[C@H](C)OC(=O)[C@@H](C)[C@@H](O)CCCC[C@@H]2O[C@H]2C[C@H](C)C1

Standard InChI:  InChI=1S/C32H54O8/c1-18-12-19(2)14-29-28(40-29)11-9-8-10-26(34)24(7)32(38)39-23(6)15-22(5)30(36)31(37)27(35)17-25(33)16-21(4)20(3)13-18/h13,19,21-26,28-31,33-34,36-37H,1,8-12,14-17H2,2-7H3/b20-13+/t19-,21+,22-,23+,24+,25+,26+,28+,29+,30+,31+/m1/s1

Standard InChI Key:  OHRZEZYMEPODIY-CJGMVNDYSA-N

Molfile:  

     RDKit          2D

 42 43  0  0  1  0  0  0  0  0999 V2000
    4.3500   -2.2458    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.0645   -1.8333    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.0645   -1.0083    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.7790   -2.2458    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.4934   -1.8333    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.2079   -2.2458    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.4934   -1.0083    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.2079   -3.0708    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.9224   -1.8333    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.4934   -3.4833    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.9224   -3.4833    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.9224   -4.3083    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.6369   -3.0708    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.6369   -4.7208    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.6369   -5.5458    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    9.3513   -4.3083    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.9224   -5.9583    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.9224   -6.7833    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.2079   -5.5458    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.2079   -4.7208    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.4934   -5.9583    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.7790   -5.5458    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.0645   -5.9583    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.3500   -5.5458    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6356   -5.9583    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4921   -5.5458    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4921   -4.7208    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7777   -4.3083    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.2066   -4.3083    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.2066   -3.4833    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.9211   -3.0708    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4921   -3.0708    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.9211   -2.2458    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6356   -1.8333    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.2066   -1.8333    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6356   -1.0083    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.9211   -5.5414    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.2066   -5.9583    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.9249   -6.3686    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.4934   -6.7833    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.9167   -4.7083    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    1.4875   -6.3708    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
  8 10  1  6
 19 21  1  0
  4  5  1  0
 21 22  1  0
  8 11  1  0
 22 23  1  0
 23 24  1  0
 11 12  1  0
 24 25  1  0
 25 37  1  0
  5  6  1  0
 38 26  1  0
 11 13  1  6
 26 27  1  0
  2  3  1  6
 27 28  1  6
 12 14  1  0
 27 29  1  0
  5  7  2  0
 29 30  1  0
 14 15  1  0
 30 31  1  0
  1  2  1  0
 30 32  2  0
 14 16  1  6
 31 33  2  0
  6  8  1  0
 33 34  1  0
 15 17  1  0
 33 35  1  0
  2  4  1  0
 34 36  1  1
 38 37  1  0
 38 39  1  0
 37 39  1  0
 17 18  2  0
  6  9  1  6
 17 19  1  0
  1 34  1  0
 21 40  1  1
 37 41  1  1
 19 20  1  6
 38 42  1  6
M  END

Alternative Forms

  1. Parent:

Associated Targets(Human)

DG-75 (165 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Biocomponents

Calculated Properties

Molecular Weight: 566.78Molecular Weight (Monoisotopic): 566.3819AlogP: 4.27#Rotatable Bonds:
Polar Surface Area: 136.82Molecular Species: NEUTRALHBA: 8HBD: 4
#RO5 Violations: 1HBA (Lipinski): 8HBD (Lipinski): 4#RO5 Violations (Lipinski): 1
CX Acidic pKa: 12.41CX Basic pKa: CX LogP: 4.32CX LogD: 4.32
Aromatic Rings: Heavy Atoms: 40QED Weighted: 0.25Np Likeness Score: 2.36

References

1. Oguchi K, Tsuda M, Iwamoto R, Okamoto Y, Endo T, Kobayashi J, Ozawa T, Masuda A..  (2007)  Amphidinolides B6 and B7, cytotoxic macrolides from a symbiotic dinoflagellate Amphidinium species.,  70  (10): [PMID:17922551] [10.1021/np0703085]

Source