(1R,3aS,3bR,5aS,7S,9aS,9bS,11aR,E)-3,10-dihydroxy-5,13,14-trimethyl-17-((R)-6-methylheptan-2-yl)-dodecahydro-2H-cyclopenta[a]phenanthren-15(9H,14H,16H)-one oxime

ID: ALA255059

Max Phase: Preclinical

Molecular Formula: C28H49NO3

Molecular Weight: 447.70

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CC(C)CCC[C@@H](C)[C@H]1C/C(=N\O)[C@@]2(C)[C@@H]3CC[C@@]4(C)C[C@@H](O)CC[C@]4(O)[C@H]3CC[C@]12C

Standard InChI:  InChI=1S/C28H49NO3/c1-18(2)8-7-9-19(3)23-16-24(29-32)27(6)21-11-13-25(4)17-20(30)10-15-28(25,31)22(21)12-14-26(23,27)5/h18-23,30-32H,7-17H2,1-6H3/b29-24+/t19-,20+,21-,22+,23-,25+,26-,27-,28+/m1/s1

Standard InChI Key:  XAGCPTKPIHMOLA-HDQSSBGESA-N

Molfile:  

     RDKit          2D

 35 38  0  0  1  0  0  0  0  0999 V2000
   -1.4417  -22.4750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4417  -23.3000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7296  -23.7083    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7296  -22.0583    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0176  -22.4750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0211  -23.3000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.6876  -23.7132    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.6946  -22.0632    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4041  -22.4836    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4210  -20.8374    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7000  -21.2409    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1304  -21.2577    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1214  -22.0792    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.9000  -22.3416    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.3902  -21.6822    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.9145  -21.0124    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1250  -20.4292    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.1779  -20.2306    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9867  -20.0678    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6326  -19.6115    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.5320  -20.6869    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.3408  -20.5241    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.8862  -21.1432    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.6950  -20.9804    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.6227  -21.9250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0292  -24.1208    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0250  -21.6500    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1555  -23.7135    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.1167  -22.9042    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.3998  -23.3125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.6875  -22.8875    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    1.3958  -21.6583    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    3.7083  -21.2208    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    3.1464  -23.1290    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.9514  -23.3093    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
 15 16  1  0
 16 12  1  0
  7 30  1  0
 12 17  1  1
 30  9  1  0
 16 18  1  0
  8  9  1  0
 18 19  1  0
  2  3  1  0
 18 20  1  6
  3  6  1  0
 19 21  1  0
  5  4  1  0
 21 22  1  0
  5  6  1  0
 22 23  1  0
  8 11  1  0
 23 24  1  0
  9 13  1  0
 23 25  1  0
 12 10  1  0
  6 26  1  6
 10 11  1  0
  5 27  1  1
 12 13  1  0
  2 28  1  1
 13 29  1  6
  1  2  1  0
  1  4  1  0
  8 31  1  6
  5  8  1  0
  9 32  1  1
  6  7  1  0
 16 33  1  6
 13 14  1  0
 14 34  2  0
 14 15  1  0
 34 35  1  0
M  END

Alternative Forms

  1. Parent:

    ALA255059

    ---

Associated Targets(non-human)

Cyp51a1 Cytochrome P450 51 (17 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 447.70Molecular Weight (Monoisotopic): 447.3712AlogP: 6.41#Rotatable Bonds: 5
Polar Surface Area: 73.05Molecular Species: NEUTRALHBA: 4HBD: 3
#RO5 Violations: 1HBA (Lipinski): 4HBD (Lipinski): 3#RO5 Violations (Lipinski): 1
CX Acidic pKa: 11.22CX Basic pKa: 1.70CX LogP: 6.08CX LogD: 6.08
Aromatic Rings: Heavy Atoms: 32QED Weighted: 0.34Np Likeness Score: 2.24

References

1. Jain KS, Kathiravan MK, Somani RS, Shishoo CJ..  (2007)  The biology and chemistry of hyperlipidemia.,  15  (14): [PMID:17521912] [10.1016/j.bmc.2007.04.031]

Source