8-hydroxymanzamine A

ID: ALA255685

PubChem CID: 5270765

Max Phase: Preclinical

Molecular Formula: C36H44N4O2

Molecular Weight: 564.77

Molecule Type: Small molecule

Names and Identifiers

Canonical SMILES:  Oc1cccc2c1[nH]c1c(C3=C[C@@]4(O)CC/C=C\CCCCN5CC[C@@H]3[C@]3(C[C@@H]6/C=C\CCCCN6[C@H]34)C5)nccc12

Standard InChI:  InChI=1S/C36H44N4O2/c41-30-14-11-13-26-27-15-18-37-32(33(27)38-31(26)30)28-23-36(42)17-8-4-1-2-5-9-19-39-21-16-29(28)35(24-39)22-25-12-7-3-6-10-20-40(25)34(35)36/h1,4,7,11-15,18,23,25,29,34,38,41-42H,2-3,5-6,8-10,16-17,19-22,24H2/b4-1-,12-7-/t25-,29-,34+,35-,36-/m0/s1

Standard InChI Key:  AMSNINGPDSUBHZ-WAUQNXBMSA-N

Molfile:  

     RDKit          2D

 45 52  0  0  0  0  0  0  0  0999 V2000
    2.5157   -1.2218    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.7661   -3.1479    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2327    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9411   -1.2345    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9454    1.2388    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5933   -3.1479    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.7429    0.9884    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.5072   -0.4073    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9454   -0.4115    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2327    0.8273    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.0957   -1.9345    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9454    2.0661    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.2266    1.6545    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.7429    2.3248    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.8072   -1.6461    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0988   -1.2303    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.5200    1.2388    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.8030    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1848   -3.7333    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.7661   -5.1333    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0903   -0.4073    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.4320   -2.2230    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6091   -2.2230    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.1702   -3.7333    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1848   -4.5606    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.6538   -1.6502    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5200    2.0661    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2327    2.4775    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.0697    3.0884    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0538    1.7436    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3818   -1.6461    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.1702   -4.5606    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5933   -5.1333    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.1448   -2.6345    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.9048   -2.6430    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.8926    3.1733    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7848   -2.3461    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.3806    2.4988    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4975   -1.9345    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5072    0.4157    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    4.6666   -0.8103    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.5520    1.0673    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.9261   -3.1479    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    3.2200   -1.6461    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2200   -0.8211    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
  4 44  1  0
  5 10  2  0
 44  6  1  0
 44  1  1  0
  7  5  1  0
  8  1  1  0
  9  3  2  0
 10  3  1  0
  1 11  1  6
 12  5  1  0
 13  7  1  0
 14 12  1  0
 15  1  1  0
 16 15  1  0
 17 10  1  0
 18  8  1  0
  2 19  1  0
 20 25  1  0
 21 16  1  0
 22 34  1  0
 23 22  2  0
 24  6  1  0
 25 19  2  0
 26  4  1  0
 27 17  2  0
 28 27  1  0
 29 14  1  0
 30 13  1  0
 31 16  1  0
 32 24  1  0
 33 32  1  0
 34 26  1  0
 35 39  1  0
 36 29  2  0
 37 31  1  0
 38 30  2  0
 39 37  1  0
  8 40  1  6
  6  2  1  0
 18 21  1  0
  4  9  1  0
 20 33  1  0
 35 23  1  0
 12 28  2  0
 14 13  2  0
 38 36  1  0
  4 41  1  6
  2 11  1  0
 30 42  1  0
  3  8  1  0
  2 43  1  6
 44 45  1  1
M  END

Alternative Forms

1. Parent:

   

   ALA255685

   8-Hydroxymanzamine A

Molecule Features

Natural Product: No

Oral: No

Chemical Probe: No

Parenteral: No

Molecule Type: Small molecule

Topical: No

First In Class: No

Black Box: No

Chirality: No

Availability: No

Prodrug: No

Calculated Properties

Molecular Weight: 564.77

Molecular Weight (Monoisotopic): 564.3464

AlogP: 6.56

#Rotatable Bonds: 1

Polar Surface Area: 75.62

Molecular Species: BASE

HBA: 5

HBD: 3

#RO5 Violations: 2

HBA (Lipinski): 6

HBD (Lipinski): 3

#RO5 Violations (Lipinski): 2

CX Acidic pKa: 9.48

CX Basic pKa: 11.00

CX LogP: 4.17

CX LogD: 1.48

Aromatic Rings: 3

Heavy Atoms: 42

QED Weighted: 0.29

Np Likeness Score: 2.19

References

1. Karan D, Dubey S, Pirisi L, Nagel A, Pina I, Choo YM, Hamann MT..  (2020)  The Marine Natural Product Manzamine A Inhibits Cervical Cancer by Targeting the SIX1 Protein.,  83  (2): [PMID:32022559] [10.1021/acs.jnatprod.9b00577]

2. van Stuijvenberg J, Proksch P, Fritz G..  (2020)  Targeting the DNA damage response (DDR) by natural compounds.,  28  (4): [PMID:31980363] [10.1016/j.bmc.2019.115279]

3. Kamboj A, Sihag B, Brar DS, Kaur A, Salunke DB..  (2021)  Structure activity relationship in β-carboline derived anti-malarial agents.,  221  [PMID:34058709] [10.1016/j.ejmech.2021.113536]

4. Luo B, Song X..  (2021)  A comprehensive overview of β-carbolines and its derivatives as anticancer agents.,  224  [PMID:34332400] [10.1016/j.ejmech.2021.113688]

5. Dai J, Dan W, Schneider U, Wang J..  (2018)  β-Carboline alkaloid monomers and dimers: Occurrence, structural diversity, and biological activities.,  157  [PMID:30125723] [10.1016/j.ejmech.2018.08.027]

Source

Source(1):

• Scientific Literature