(S)-2-{(S)-2-[4-(4-dimethylamino-phenylazo)-benzoylamino]-5-guanidino-pentanoylamino}-5-guanidino-pentanoic acid

ID: ALA257535

PubChem CID: 44454277

Max Phase: Preclinical

Molecular Formula: C27H39N11O4

Molecular Weight: 581.68

Molecule Type: Small molecule

Names and Identifiers

Canonical SMILES:  CN(C)c1ccc(/N=N/c2ccc(C(=O)N[C@@H](CCCNC(=N)N)C(=O)N[C@@H](CCCNC(=N)N)C(=O)O)cc2)cc1

Standard InChI:  InChI=1S/C27H39N11O4/c1-38(2)20-13-11-19(12-14-20)37-36-18-9-7-17(8-10-18)23(39)34-21(5-3-15-32-26(28)29)24(40)35-22(25(41)42)6-4-16-33-27(30)31/h7-14,21-22H,3-6,15-16H2,1-2H3,(H,34,39)(H,35,40)(H,41,42)(H4,28,29,32)(H4,30,31,33)/b37-36+/t21-,22-/m0/s1

Standard InChI Key:  DWIUJXCVDOCDCJ-KDULOAHQSA-N

Molfile:  

     RDKit          2D

 42 43  0  0  1  0  0  0  0  0999 V2000
    5.8753    1.5925    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.8753    2.4190    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.1602    2.8302    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.5945    2.8302    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.7299   -1.2939    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.4450   -0.8827    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.1602   -2.1204    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.1602   -1.2939    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.4450   -0.0562    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.1602    0.3550    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.1602    1.1813    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.0165   -3.7691    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    8.0165   -4.5956    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.3014   -5.0068    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    8.7322   -5.0068    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.8753   -0.8827    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.5945   -1.2939    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.3014   -0.0562    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.3014   -0.8827    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.5945   -2.1204    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.3014   -2.5315    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.3014   -3.3579    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.0165   -1.2939    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.7299   -2.1204    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.0189   -2.5315    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.0189   -3.3579    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.3038   -3.7691    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.5886   -3.3579    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.5886   -2.5315    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.3038   -2.1204    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.4450   -2.5315    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.8735   -3.7691    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.8735   -4.5956    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.1584   -5.0068    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.1584   -5.8332    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.5526   -6.2444    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2678   -5.8332    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2678   -5.0068    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.5526   -4.5956    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.9829   -6.2444    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.9829   -7.0708    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.6980   -5.8332    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  8 16  1  0
 19 23  1  0
  1  2  1  0
  2  3  1  0
  2  4  2  0
  5  6  1  0
  6  8  1  0
  8  7  2  0
  6  9  1  1
  9 10  1  0
 10 11  1  0
 11  1  1  0
 12 13  1  0
 13 14  1  0
 13 15  2  0
 16 17  1  0
 17 19  1  0
 19 18  2  0
 17 20  1  6
 20 21  1  0
 21 22  1  0
 22 12  1  0
 24 25  1  0
 25 26  1  0
 26 27  2  0
 27 28  1  0
 28 29  2  0
 29 30  1  0
 25 30  2  0
 24 31  2  0
 24  5  1  0
 32 33  2  0
 34 35  1  0
 35 36  2  0
 36 37  1  0
 37 38  2  0
 38 39  1  0
 34 39  2  0
 40 41  1  0
 40 42  1  0
 37 40  1  0
 33 34  1  0
 28 32  1  0
M  END

Alternative Forms

1. Parent:

   

   ALA257535

   (2S)-5-(diaminomethylideneamino)-2-[[(2S)-5-(diaminomethylideneamino)-2-[[4-[[4-(dimethylamino)phenyl]diazenyl]benzoyl]amino]pentanoyl]amino]pentanoic acid

Molecule Features

Natural Product: No

Oral: No

Chemical Probe: No

Parenteral: No

Molecule Type: Small molecule

Topical: No

First In Class: No

Black Box: No

Chirality: No

Availability: No

Prodrug: No

Calculated Properties

Molecular Weight: 581.68

Molecular Weight (Monoisotopic): 581.3186

AlogP: 1.36

#Rotatable Bonds: 16

Polar Surface Area: 247.26

Molecular Species: ZWITTERION

HBA: 8

HBD: 9

#RO5 Violations: 2

HBA (Lipinski): 15

HBD (Lipinski): 11

#RO5 Violations (Lipinski): 3

CX Acidic pKa: 3.71

CX Basic pKa: 12.04

CX LogP: -0.71

CX LogD: -2.80

Aromatic Rings: 2

Heavy Atoms: 42

QED Weighted: 0.06

Np Likeness Score: -0.33

References

1. Agarkov A, Chauhan S, Lory PJ, Gilbertson SR, Motin VL..  (2008)  Substrate specificity and screening of the integral membrane protease Pla.,  18  (1): [PMID:17981463] [10.1016/j.bmcl.2007.09.104]

Source

Source(1):

• Scientific Literature