mannitol bis-phosphate

ID: ALA258208

PubChem CID: 4369446

Max Phase: Preclinical

Molecular Formula: C6H16O12P2

Molecular Weight: 342.13

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Synonyms: Mannitol Bis-Phosphate | 1,6-DI-O-PHOSPHONO-D-MANNITOL|D-MANNITOL-1,6-DIPHOSPHATE|CHEMBL258208|M2P|mannitol bis-phosphate|SCHEMBL16416132|BDBM50380322|DB04733|PD006441|NS00070798|Q27095471

Canonical SMILES:  O=P(O)(O)OC[C@@H](O)[C@@H](O)[C@H](O)[C@H](O)COP(=O)(O)O

Standard InChI:  InChI=1S/C6H16O12P2/c7-3(1-17-19(11,12)13)5(9)6(10)4(8)2-18-20(14,15)16/h3-10H,1-2H2,(H2,11,12,13)(H2,14,15,16)/t3-,4-,5-,6-/m1/s1

Standard InChI Key:  WOYYTQHMNDWRCW-KVTDHHQDSA-N

Molfile:  

     RDKit          2D

 20 19  0  0  0  0  0  0  0  0999 V2000
    1.7865    0.2083    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0714    0.2083    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7859   -0.2042    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3569   -0.2042    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3576    0.2083    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0720   -0.2042    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9299    0.6208    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.2154    0.2083    0.0000 P   0  0  0  0  0  0  0  0  0  0  0  0
    2.8029    0.9227    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.6279   -0.5062    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.5010   -0.2042    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.0720   -1.0292    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.3576    1.0333    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3569   -1.0292    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0714    1.0333    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5003    0.2083    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2148   -0.2042    0.0000 P   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9293   -0.6167    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.6273    0.5102    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8023   -0.9187    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  1  6  1  0
  1 11  1  0
  2  3  1  0
  4  2  1  0
  2 15  1  1
  3 16  1  0
  5  4  1  0
  4 14  1  6
  6  5  1  0
  5 13  1  6
  6 12  1  1
  7  8  2  0
  9  8  1  0
 10  8  1  0
 11  8  1  0
 16 17  1  0
 18 17  1  0
 19 17  1  0
 20 17  2  0
M  END

Alternative Forms

  1. Parent:

Associated Targets(non-human)

ALD Fructose-bisphosphate aldoloase, glycosomal (41 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
ALDOA Fructose-bisphosphate aldolase A (247 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 342.13Molecular Weight (Monoisotopic): 342.0117AlogP: -3.35#Rotatable Bonds: 9
Polar Surface Area: 214.44Molecular Species: ACIDHBA: 8HBD: 8
#RO5 Violations: 1HBA (Lipinski): 12HBD (Lipinski): 8#RO5 Violations (Lipinski): 2
CX Acidic pKa: 1.19CX Basic pKa: CX LogP: -3.98CX LogD: -10.57
Aromatic Rings: Heavy Atoms: 20QED Weighted: 0.19Np Likeness Score: 0.99

References

1. Mabiala-Bassiloua CG, Zwolinska M, Therisod H, Sygusch J, Therisod M..  (2008)  Separate synthesis and evaluation of glucitol bis-phosphate and mannitol bis-phosphate, as competitive inhibitors of fructose bis-phosphate aldolases.,  18  (5): [PMID:18261903] [10.1016/j.bmcl.2008.01.076]
2. Mabiala-Bassiloua CG, Arthus-Cartier G, Hannaert V, Thérisod H, Sygusch J, Thérisod M..  (2011)  Mannitol Bis-phosphate Based Inhibitors of Fructose 1,6-Bisphosphate Aldolases.,  (11): [PMID:24900268] [10.1021/ml200129s]

Source