Your company account is blocked and you cannot place orders. If you have questions, please contact your company administrator.

4-nitro-2-[(3-trifluoromethylphenyl)amino]benzoic acid

ID: ALA259241

Cas Number: 767576-60-3

PubChem CID: 12399671

Max Phase: Preclinical

Molecular Formula: C14H9F3N2O4

Molecular Weight: 326.23

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  O=C(O)c1ccc([N+](=O)[O-])cc1Nc1cccc(C(F)(F)F)c1

Standard InChI:  InChI=1S/C14H9F3N2O4/c15-14(16,17)8-2-1-3-9(6-8)18-12-7-10(19(22)23)4-5-11(12)13(20)21/h1-7,18H,(H,20,21)

Standard InChI Key:  QYQJQYVAZJNLRH-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 23 24  0  0  0  0  0  0  0  0999 V2000
   -4.8389   -9.3041    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.8401  -10.1315    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.1253  -10.5444    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.4088  -10.1310    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.4117   -9.3005    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.1271   -8.8914    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.6988   -8.8853    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.9828   -9.2951    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.9830  -10.1178    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2678  -10.5275    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.5539  -10.1122    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.5597   -9.2830    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2755   -8.8770    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.1517   -8.8653    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.8625   -8.4458    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    0.5702   -9.5763    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   -0.2670   -8.1545    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   -4.1300   -8.0626    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.4168   -7.6480    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -4.8457   -7.6522    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -4.1234  -11.3740    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -3.4091  -11.7866    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -4.8380  -11.7863    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  5  6  2  0
 11 12  1  0
  6  1  1  0
 12 13  2  0
 13  8  1  0
  1  2  2  0
 12 14  1  0
  5  7  1  0
 14 15  1  0
  3  4  2  0
 14 16  1  0
  7  8  1  0
 14 17  1  0
  8  9  2  0
  4  5  1  0
 18 19  1  0
 18 20  2  0
  6 18  1  0
  9 10  1  0
  2  3  1  0
 10 11  2  0
 21 22  2  0
 21 23  1  0
  3 21  1  0
M  CHG  2  21   1  23  -1
M  END

Associated Targets(Human)

MPO Tchem Myeloperoxidase (1002 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Calculated Properties

Molecular Weight: 326.23Molecular Weight (Monoisotopic): 326.0514AlogP: 4.06#Rotatable Bonds: 4
Polar Surface Area: 92.47Molecular Species: ACIDHBA: 4HBD: 2
#RO5 Violations: HBA (Lipinski): 6HBD (Lipinski): 2#RO5 Violations (Lipinski):
CX Acidic pKa: 3.07CX Basic pKa: CX LogP: 5.19CX LogD: 1.72
Aromatic Rings: 2Heavy Atoms: 23QED Weighted: 0.65Np Likeness Score: -1.53

References

1. Van Antwerpen P, Prévost M, Zouaoui-Boudjeltia K, Babar S, Legssyer I, Moreau P, Moguilevsky N, Vanhaeverbeek M, Ducobu J, Nève J, Dufrasne F..  (2008)  Conception of myeloperoxidase inhibitors derived from flufenamic acid by computational docking and structure modification.,  16  (4): [PMID:18063373] [10.1016/j.bmc.2007.11.025]
2. Tidén, Anna-Karin AK and 16 more authors.  2011-10-28  2-thioxanthines are mechanism-based inactivators of myeloperoxidase that block oxidative stress during inflammation.  [PMID:21880720]
3. Roth, Aaron and 9 more authors.  2014-11-15  Inhibition of myeloperoxidase: evaluation of 2H-indazoles and 1H-indazolones.  [PMID:25438766]

Source