2-(2-{2-[5-Amino-2-(3-methoxy-phenyl)-6-oxo-6H-pyrimidin-1-yl]-acetylamino}-3-phenyl-propionyl)-benzooxazole-5-carboxylic acid methyl ester

ID: ALA26285

PubChem CID: 9938207

Max Phase: Preclinical

Molecular Formula: C31H27N5O7

Molecular Weight: 581.59

Molecule Type: Small molecule

Names and Identifiers

Canonical SMILES:  COC(=O)c1ccc2oc(C(=O)C(Cc3ccccc3)NC(=O)Cn3c(-c4cccc(OC)c4)ncc(N)c3=O)nc2c1

Standard InChI:  InChI=1S/C31H27N5O7/c1-41-21-10-6-9-19(14-21)28-33-16-22(32)30(39)36(28)17-26(37)34-24(13-18-7-4-3-5-8-18)27(38)29-35-23-15-20(31(40)42-2)11-12-25(23)43-29/h3-12,14-16,24H,13,17,32H2,1-2H3,(H,34,37)

Standard InChI Key:  JBVRJKUPBUZDDJ-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 43 47  0  0  0  0  0  0  0  0999 V2000
    3.7167   -1.2667    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.5042   -3.9042    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.7417   -0.6667    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.1917   -1.5417    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.1042   -3.9667    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.2292   -0.3417    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.1917   -3.3917    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6792   -1.2292    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.2667   -4.4542    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.2417   -4.5417    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.6667   -3.1042    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.7042   -0.6292    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2667   -0.3792    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.7167   -4.8542    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2167   -1.5917    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.1917   -2.1792    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.6917   -2.5042    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    7.3417   -5.5917    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.7667   -5.4417    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.7542   -4.8417    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.1917   -2.1417    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.7167   -3.0792    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.1542   -3.4042    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.7792   -0.7042    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6792   -2.4917    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.7667   -5.1667    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.7292   -5.4542    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1667   -1.5292    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.2542   -5.7417    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.3042   -0.4167    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.5042   -6.1667    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.1542   -4.0042    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2917    0.2208    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.8917   -0.5792    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.8167    0.4958    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.3292    0.1833    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.0792   -6.3292    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6417   -4.3042    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.7292   -4.3417    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0417   -1.1542    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6542   -4.9042    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.6917   -4.8875    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.1667   -5.1917    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  7  1  0
  3  1  1  0
  4  1  1  0
  5  2  2  0
  6  3  2  0
  7 11  1  0
  8  4  1  0
  9  2  1  0
 10  5  1  0
 11 17  1  0
 12  8  2  0
 13  3  1  0
 14  9  1  0
 15  1  1  0
 16 15  1  0
 17 16  1  0
 18 19  1  0
 19 20  2  0
 20 10  1  0
 21  4  2  0
 22  7  2  0
 23 11  1  0
 24 13  2  0
 25 16  2  0
 26 18  2  0
 27 14  1  0
 28  8  1  0
 29 27  2  0
 30 24  1  0
 31 18  1  0
 32 23  1  0
 33 13  1  0
 34 30  1  0
 35 33  2  0
 36 35  1  0
 37 31  1  0
 38 32  2  0
 39 32  1  0
 40 34  1  0
 41 38  1  0
 42 39  2  0
 43 42  1  0
 12  6  1  0
 36 30  2  0
 14 10  2  0
 43 41  2  0
 19 29  1  0
M  END

Alternative Forms

1. Parent:

   

   ALA26285

   2-(2-{2-[5-Amino-2-(3-methoxy-phenyl)-6-oxo-6H-pyrimidin-1-yl]-acetylamino}-3-phenyl-propionyl)-benzooxazole-5-carboxylic acid methyl ester

Molecule Features

Natural Product: No

Oral: No

Chemical Probe: No

Parenteral: No

Molecule Type: Small molecule

Topical: No

First In Class: No

Black Box: No

Chirality: No

Availability: No

Prodrug: No

Calculated Properties

Molecular Weight: 581.59

Molecular Weight (Monoisotopic): 581.1910

AlogP: 3.04

#Rotatable Bonds: 10

Polar Surface Area: 168.64

Molecular Species: NEUTRAL

HBA: 11

HBD: 2

#RO5 Violations: 2

HBA (Lipinski): 12

HBD (Lipinski): 3

#RO5 Violations (Lipinski): 2

CX Acidic pKa: 11.88

CX Basic pKa: 0.99

CX LogP: 2.61

CX LogD: 2.61

Aromatic Rings: 5

Heavy Atoms: 43

QED Weighted: 0.18

Np Likeness Score: -0.86

References

1. Akahoshi F, Ashimori A, Sakashita H, Yoshimura T, Imada T, Nakajima M, Mitsutomi N, Kuwahara S, Ohtsuka T, Fukaya C, Miyazaki M, Nakamura N..  (2001)  Synthesis, structure-activity relationships, and pharmacokinetic profiles of nonpeptidic alpha-keto heterocycles as novel inhibitors of human chymase.,  44  (8): [PMID:11312927] [10.1021/jm000496v]

Source

Source(1):

• Scientific Literature