The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(5R,6S)-3-((S)-2-Amino-2-carboxy-ethylsulfanyl)-6-((R)-1-hydroxy-ethyl)-7-oxo-4-thia-1-aza-bicyclo[3.2.0]hept-2-ene-2-carboxylic acid ID: ALA264383
Cas Number: 92008-67-8
PubChem CID: 13326245
Max Phase: Preclinical
Molecular Formula: C11H14N2O6S2
Molecular Weight: 334.38
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: C[C@@H](O)[C@H]1C(=O)N2C(C(=O)O)=C(SC[C@@H](N)C(=O)O)S[C@H]12
Standard InChI: InChI=1S/C11H14N2O6S2/c1-3(14)5-7(15)13-6(10(18)19)11(21-8(5)13)20-2-4(12)9(16)17/h3-5,8,14H,2,12H2,1H3,(H,16,17)(H,18,19)/t3-,4-,5+,8-/m1/s1
Standard InChI Key: KQZRFRIKMGMUCB-XWJKOJJASA-N
Molfile:
RDKit 2D
24 25 0 0 1 0 0 0 0 0999 V2000
4.5917 -5.1792 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.6000 -4.3542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.3750 -5.4417 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.7667 -5.1792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.8667 -4.7750 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.3792 -4.1042 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
3.7667 -4.3542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.6292 -6.2250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.6917 -4.7792 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
8.3292 -6.2167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.9250 -5.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.1875 -5.7667 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.1000 -5.4917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.1875 -3.7750 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4292 -6.4042 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.9167 -6.9292 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.3417 -4.7875 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.0667 -6.8375 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.1542 -6.2167 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.4000 -2.9750 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.3792 -3.9875 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.4318 -4.6301 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
2.8428 -4.7369 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
4.4454 -3.3662 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 0
3 1 1 0
4 1 1 0
5 3 2 0
2 6 1 0
7 4 1 0
8 3 1 0
9 5 1 0
10 11 1 0
11 13 1 0
12 4 2 0
13 9 1 0
7 14 1 0
15 8 2 0
16 10 2 0
11 17 1 0
18 8 1 0
19 10 1 0
14 20 1 1
21 14 1 0
11 22 1 6
7 2 1 0
6 5 1 0
7 23 1 1
2 24 1 6
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 334.38Molecular Weight (Monoisotopic): 334.0293AlogP: -0.70#Rotatable Bonds: 6Polar Surface Area: 141.16Molecular Species: ZWITTERIONHBA: 7HBD: 4#RO5 Violations: ┄HBA (Lipinski): 8HBD (Lipinski): 5#RO5 Violations (Lipinski): ┄CX Acidic pKa: 1.45CX Basic pKa: 9.06CX LogP: -3.40CX LogD: -6.59Aromatic Rings: ┄Heavy Atoms: 21QED Weighted: 0.46Np Likeness Score: 0.52
References 1. Afonso A, Hon F, Weinstein J, Gentles M, Shapiro E, Ganguly A, Naples L, Hare R, Miller G. (1993) Penems containing amino acid derived substituents at C-2, 3 (11): [10.1016/S0960-894X(01)80921-5 ]