The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2-{2-[2-(2-Acetylamino-5-guanidino-pentanoylamino)-3-hydroxy-propionylamino]-3-methyl-butyrylamino}-pentanedioic acid diamide ID: ALA264393
PubChem CID: 14999601
Max Phase: Preclinical
Molecular Formula: C21H39N9O7
Molecular Weight: 529.60
Molecule Type: Protein
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CC(=O)N[C@@H](CCCN=C(N)N)C(=O)N[C@@H](CO)C(=O)N[C@H](C(=O)N[C@@H](CCC(N)=O)C(N)=O)C(C)C
Standard InChI: InChI=1S/C21H39N9O7/c1-10(2)16(20(37)28-12(17(23)34)6-7-15(22)33)30-19(36)14(9-31)29-18(35)13(27-11(3)32)5-4-8-26-21(24)25/h10,12-14,16,31H,4-9H2,1-3H3,(H2,22,33)(H2,23,34)(H,27,32)(H,28,37)(H,29,35)(H,30,36)(H4,24,25,26)/t12-,13-,14-,16-/m0/s1
Standard InChI Key: FVFQLPZSQIZAFV-YXWQFLTLSA-N
Molfile:
RDKit 2D
37 36 0 0 1 0 0 0 0 0999 V2000
10.8125 -5.8917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.4042 -5.8917 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.7000 -6.3000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.5875 -5.8917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.2917 -6.3000 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.9917 -5.8917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.1042 -6.3000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.5167 -6.3000 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.2917 -9.5542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.9292 -6.3000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1750 -5.8917 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
12.2250 -5.8917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.4667 -6.3000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.8792 -6.3000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.9292 -3.8542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.9917 -9.9625 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
10.8125 -5.0750 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.7000 -7.1125 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.5875 -5.0750 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
12.9292 -7.1125 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.4667 -7.1125 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
13.6292 -3.4500 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
12.2250 -5.0750 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.2917 -8.7375 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.5875 -9.9625 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
13.6292 -5.8917 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
10.1042 -7.1125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.9292 -4.6667 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.2250 -3.4500 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.9917 -5.0750 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.7000 -4.6667 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.7667 -5.8917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.8792 -7.1125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.5875 -8.3292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.4042 -7.5167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.8125 -7.5167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.5875 -7.5167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 7 1 0
3 2 1 0
4 5 1 0
5 6 1 0
6 3 1 0
7 1 1 0
8 1 1 0
9 24 2 0
10 12 1 0
11 14 1 0
12 8 1 0
13 11 1 0
14 4 1 0
15 28 1 0
16 9 1 0
17 1 2 0
18 3 2 0
19 4 2 0
20 10 2 0
21 13 2 0
22 15 2 0
12 23 1 1
24 34 1 0
25 9 1 0
26 10 1 0
7 27 1 6
28 23 1 0
29 15 1 0
6 30 1 1
31 30 1 0
32 13 1 0
14 33 1 6
34 37 1 0
35 27 1 0
36 27 1 0
37 33 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: ProteinTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 529.60Molecular Weight (Monoisotopic): 529.2972AlogP: -4.60#Rotatable Bonds: 17Polar Surface Area: 287.21Molecular Species: BASEHBA: 8HBD: 9#RO5 Violations: 2HBA (Lipinski): 16HBD (Lipinski): 13#RO5 Violations (Lipinski): 3CX Acidic pKa: 11.72CX Basic pKa: 15.83CX LogP: -5.75CX LogD: -7.84Aromatic Rings: ┄Heavy Atoms: 37QED Weighted: 0.05Np Likeness Score: 0.42
References 1. Deshpande MS, Burton J.. (1992) Mapping the binding site of tissue kallikrein: preparation and testing of all possible substrate analog inhibitors homologous with the sequence of kininogen between Ser386 and Gln392., 35 (17): [PMID:1507198 ] [10.1021/jm00095a002 ]