4-(6,7-Dimethoxy-quinazolin-4-yl)-piperazine-1-carbothioic acid 4-isopropyl-benzylamide

ID: ALA264641

PubChem CID: 11113370

Max Phase: Preclinical

Molecular Formula: C25H31N5O2S

Molecular Weight: 465.62

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  COc1cc2ncnc(N3CCN(/C(S)=N\Cc4ccc(C(C)C)cc4)CC3)c2cc1OC

Standard InChI:  InChI=1S/C25H31N5O2S/c1-17(2)19-7-5-18(6-8-19)15-26-25(33)30-11-9-29(10-12-30)24-20-13-22(31-3)23(32-4)14-21(20)27-16-28-24/h5-8,13-14,16-17H,9-12,15H2,1-4H3,(H,26,33)

Standard InChI Key:  FSHVBPKPBHXJBC-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 33 36  0  0  0  0  0  0  0  0999 V2000
    1.7042   -4.5542    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4167   -4.1417    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4125   -0.8417    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4125   -3.3167    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.4125   -1.6667    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.7042   -5.3792    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.9917   -4.1417    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.1292   -4.5500    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.9917   -5.8000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.2792   -4.5625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.2792   -5.3875    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.1250   -0.4292    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.4250   -5.7917    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.6917   -0.4292    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    3.1375   -5.3792    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7000   -2.9125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.1292   -2.9042    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.1292   -2.0792    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7000   -2.0875    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.9792    0.3958    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.2542    0.8083    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.9792   -0.4292    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8417   -0.8417    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.5542   -0.4292    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.6917    0.8083    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.4333   -4.1500    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.4375   -5.8000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.5417    0.3958    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.2667   -0.8417    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.4042    0.4000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.6875    1.6333    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.1500   -5.3875    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.1875   -4.5292    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  3  5  1  0
  4  2  1  0
  5 18  1  0
  6  1  1  0
  7  1  2  0
  8  2  2  0
  9  6  2  0
 10  7  1  0
 11 10  2  0
 12  3  2  0
 13  6  1  0
 14  3  1  0
 15 13  2  0
 16  4  1  0
 17  4  1  0
 18 17  1  0
 19 16  1  0
 20 22  2  0
 21 28  2  0
 22 29  1  0
 23 12  1  0
 24 23  1  0
 25 20  1  0
 26 10  1  0
 27 11  1  0
 28 24  1  0
 29 24  2  0
 30 25  1  0
 31 25  1  0
 32 27  1  0
 33 26  1  0
 11  9  1  0
 15  8  1  0
  5 19  1  0
 21 20  1  0
M  END

Associated Targets(Human)

PDGFRB Tclin Platelet-derived growth factor receptor (507 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 465.62Molecular Weight (Monoisotopic): 465.2198AlogP: 4.38#Rotatable Bonds: 6
Polar Surface Area: 63.08Molecular Species: ZWITTERIONHBA: 6HBD: 1
#RO5 Violations: HBA (Lipinski): 7HBD (Lipinski): #RO5 Violations (Lipinski):
CX Acidic pKa: 1.12CX Basic pKa: 13.61CX LogP: 5.87CX LogD: 5.87
Aromatic Rings: 3Heavy Atoms: 33QED Weighted: 0.33Np Likeness Score: -0.90

References

1. Matsuno K, Nakajima T, Ichimura M, Giese NA, Yu JC, Lokker NA, Ushiki J, Ide S, Oda S, Nomoto Y..  (2002)  Potent and selective inhibitors of PDGF receptor phosphorylation. 2. Synthesis, structure activity relationship, improvement of aqueous solubility, and biological effects of 4-[4-(N-substituted (thio)carbamoyl)-1-piperazinyl]-6,7-dimethoxyquinazoline derivatives.,  45  (20): [PMID:12238930] [10.1021/jm0201114]

Source