The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2-{4-[(2-Methoxy-4-oxo-3,4-dihydro-quinazolin-6-ylmethyl)-prop-2-ynyl-amino]-benzoylamino}-pentanedioic acid ID: ALA265098
PubChem CID: 135722140
Max Phase: Preclinical
Molecular Formula: C25H24N4O7
Molecular Weight: 492.49
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: C#CCN(Cc1ccc2nc(OC)[nH]c(=O)c2c1)c1ccc(C(=O)N[C@@H](CCC(=O)O)C(=O)O)cc1
Standard InChI: InChI=1S/C25H24N4O7/c1-3-12-29(14-15-4-9-19-18(13-15)23(33)28-25(27-19)36-2)17-7-5-16(6-8-17)22(32)26-20(24(34)35)10-11-21(30)31/h1,4-9,13,20H,10-12,14H2,2H3,(H,26,32)(H,30,31)(H,34,35)(H,27,28,33)/t20-/m0/s1
Standard InChI Key: AJJBCKYMURNWIQ-FQEVSTJZSA-N
Molfile:
RDKit 2D
36 38 0 0 0 0 0 0 0 0999 V2000
-3.9792 -8.5417 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-3.9792 -9.3667 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.2671 -9.7750 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-3.2671 -8.1250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.2671 -7.3000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.5551 -8.5417 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5567 -9.3648 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.8458 -9.7760 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.1327 -9.3652 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.1351 -8.5389 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.8467 -8.1314 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.4220 -8.1241 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.2938 -8.5343 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.0070 -8.1195 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7241 -8.5321 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4368 -8.1180 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4346 -7.2922 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7138 -6.8821 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0041 -7.2986 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.1472 -6.8764 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.1435 -6.0514 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.8599 -7.2831 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.5723 -6.8670 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.2889 -7.2759 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.5682 -6.0420 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.2803 -5.6255 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.8514 -5.6327 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.0012 -6.8598 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.7178 -7.2687 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.7229 -8.0950 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.4311 -6.8539 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.2965 -9.3593 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0122 -9.7695 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7208 -10.1792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.6919 -9.7817 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-4.6907 -10.6067 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3 7 1 0
17 18 1 0
8 9 2 0
18 19 2 0
19 14 1 0
6 4 1 0
17 20 1 0
9 10 1 0
20 21 2 0
20 22 1 0
10 11 2 0
22 23 1 0
11 6 1 0
23 24 1 6
4 5 2 0
23 25 1 0
10 12 1 0
1 2 1 0
25 26 1 0
25 27 2 0
12 13 1 0
24 28 1 0
1 4 1 0
28 29 1 0
13 14 1 0
6 7 2 0
29 30 1 0
29 31 2 0
14 15 2 0
13 32 1 0
2 3 2 0
32 33 1 0
15 16 1 0
33 34 3 0
7 8 1 0
16 17 2 0
35 36 1 0
2 35 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 492.49Molecular Weight (Monoisotopic): 492.1645AlogP: 1.62#Rotatable Bonds: 11Polar Surface Area: 161.92Molecular Species: ACIDHBA: 7HBD: 4#RO5 Violations: ┄HBA (Lipinski): 11HBD (Lipinski): 4#RO5 Violations (Lipinski): 1CX Acidic pKa: 3.20CX Basic pKa: 4.45CX LogP: 1.17CX LogD: -3.97Aromatic Rings: 3Heavy Atoms: 36QED Weighted: 0.29Np Likeness Score: -0.73
References 1. Jackman AL, Marsham PR, Thornton TJ, Bishop JA, O'Connor BM, Hughes LR, Calvert AH, Jones TR.. (1990) Quinazoline antifolate thymidylate synthase inhibitors: 2'-fluoro-N10-propargyl-5,8-dideazafolic acid and derivatives with modifications in the C2 position., 33 (11): [PMID:2231607 ] [10.1021/jm00173a025 ] 2. Srivastava V, Gupta SP, Siddiqi MI, Mishra BN.. (2010) 3D-QSAR studies on quinazoline antifolate thymidylate synthase inhibitors by CoMFA and CoMSIA models., 45 (4): [PMID:20153089 ] [10.1016/j.ejmech.2009.12.065 ]