Your company account is blocked and you cannot place orders. If you have questions, please contact your company administrator.

SID50104770

ID: ALA268601

PubChem CID: 6610299

Max Phase: Preclinical

Molecular Formula: C29H32O13

Molecular Weight: 588.56

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  COc1cc([C@@H]2c3cc4c(cc3C(OC3OC5COC(C)OC5C(O)C3O)C3COC(=O)[C@@H]32)OCO4)cc(OC)c1O

Standard InChI:  InChI=1S/C29H32O13/c1-11-36-9-20-27(40-11)24(31)25(32)29(41-20)42-26-14-7-17-16(38-10-39-17)6-13(14)21(22-15(26)8-37-28(22)33)12-4-18(34-2)23(30)19(5-12)35-3/h4-7,11,15,20-22,24-27,29-32H,8-10H2,1-3H3/t11?,15?,20?,21-,22+,24?,25?,26?,27?,29?/m1/s1

Standard InChI Key:  VJJPUSNTGOMMGY-BQZFVAJISA-N

Molfile:  

     RDKit          2D

 43 49  0  0  1  0  0  0  0  0999 V2000
   12.2042   -1.5792    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.5375   -1.1792    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.8417   -1.5792    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.8417   -2.3500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.2042   -2.3500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.5375   -2.7417    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.9875   -0.3292    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.5042    0.4708    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.2000    0.0333    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.1667   -0.3292    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.3542    0.5083    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   11.5375    0.2000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   11.5375   -3.5292    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.3125    0.0875    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.9500   -2.6042    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.5292    0.1125    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   10.1792   -1.1792    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.1792   -2.7417    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.5375   -5.0917    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.3917   -1.9875    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   12.9500   -1.3417    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.2042   -4.7250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.8417   -4.7250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.5167   -1.5792    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.5167   -2.3500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.2042   -3.9250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.8417   -3.9250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.7042    0.5333    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.9167    0.9125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.7750   -1.3417    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.7750   -2.6042    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.6542    0.9125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.3250   -1.9875    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.2250   -3.3500    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    9.8417   -0.6875    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.5792   -0.2167    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   11.5375   -5.8917    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   12.9000   -5.1292    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   10.1542   -5.1292    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.4167    0.5583    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.5875   -4.7250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.4625   -4.7250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.3054   -3.3449    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  3  2  1  0
  4  6  1  0
  5  1  1  0
  6  5  1  0
  7 12  1  0
  8 14  1  0
  9  7  1  0
 10  9  1  0
 11  7  1  0
 12  2  1  0
  6 13  1  6
 14 11  1  0
  5 15  1  0
 16  8  1  0
 17  3  1  0
 18  4  1  0
 19 23  1  0
 20 21  1  0
 21  1  1  0
 22 26  1  0
 23 27  2  0
 24 17  2  0
 25 18  2  0
 26 13  2  0
 27 13  1  0
 28 32  1  0
 29 28  1  0
 30 24  1  0
 31 25  1  0
 32 14  1  0
 33 30  1  0
 34 15  2  0
 35  9  1  0
 36 10  1  0
 37 19  1  0
 38 22  1  0
 39 23  1  0
 40 29  1  0
 41 38  1  0
 42 39  1  0
 20 15  1  0
  4  3  2  0
 22 19  2  0
 25 24  1  0
 10  8  1  0
 33 31  1  0
 29 16  1  0
  5 43  1  1
M  END

Associated Targets(Human)

MEN1 Tchem Menin/Histone-lysine N-methyltransferase MLL (48157 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
TDP1 Tchem Tyrosyl-DNA phosphodiesterase 1 (345557 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Associated Targets(non-human)

Rorc Nuclear receptor ROR-gamma (89407 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: YesOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 588.56Molecular Weight (Monoisotopic): 588.1843AlogP: 1.34#Rotatable Bonds: 5
Polar Surface Area: 160.83Molecular Species: NEUTRALHBA: 13HBD: 3
#RO5 Violations: 2HBA (Lipinski): 13HBD (Lipinski): 3#RO5 Violations (Lipinski): 2
CX Acidic pKa: 9.33CX Basic pKa: CX LogP: 1.16CX LogD: 1.16
Aromatic Rings: 2Heavy Atoms: 42QED Weighted: 0.43Np Likeness Score: 1.89

References

1. PubChem BioAssay data set, 
2. PubChem BioAssay data set, 
3. Zhou, Haibin H and 7 more authors.  2013-02-14  Structure-based design of high-affinity macrocyclic peptidomimetics to block the menin-mixed lineage leukemia 1 (MLL1) protein-protein interaction.  [PMID:23244744]
4. He, Shihan S and 10 more authors.  2014-02-27  High-affinity small-molecule inhibitors of the menin-mixed lineage leukemia (MLL) interaction closely mimic a natural protein-protein interaction.  [PMID:24472025]
5. Pollock, Jonathan and 6 more authors.  2015-09-24  Rational Design of Orthogonal Multipolar Interactions with Fluorine in Protein-Ligand Complexes.  [PMID:26288158]
6. Borkin, Dmitry D and 12 more authors.  2016-02-11  Property Focused Structure-Based Optimization of Small Molecule Inhibitors of the Protein-Protein Interaction between Menin and Mixed Lineage Leukemia (MLL).  [PMID:26744767]
7. Borkin, Dmitry D and 12 more authors.  2018-06-14  Complexity of Blocking Bivalent Protein-Protein Interactions: Development of a Highly Potent Inhibitor of the Menin-Mixed-Lineage Leukemia Interaction.  [PMID:29738674]
8. Chen, Qi-Bin QB, Gao, Jie J, Zou, Guo-An GA, Xin, Xue-Lei XL and Aisa, Haji Akber HA.  2018-06-22  Piperidine Alkaloids with Diverse Skeletons from Anacyclus pyrethrum.  [PMID:29775308]
9. Aguilar, Angelo A and 15 more authors.  2019-07-11  Structure-Based Discovery of M-89 as a Highly Potent Inhibitor of the Menin-Mixed Lineage Leukemia (Menin-MLL) Protein-Protein Interaction.  [PMID:31244110]
10. Xu, Shilin and 12 more authors.  2020-05-14  Discovery of M-808 as a Highly Potent, Covalent, Small-Molecule Inhibitor of the Menin-MLL Interaction with Strong In Vivo Antitumor Activity.  [PMID:32338903]

Source

Source(1):