1-(2-{4-[3-(4-Fluoro-phenyl)-7-methoxy-2H-chromen-4-yl]-phenoxy}-ethyl)-piperidine

ID: ALA26867

PubChem CID: 14521103

Max Phase: Preclinical

Molecular Formula: C29H30FNO3

Molecular Weight: 459.56

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  COc1ccc2c(c1)OCC(c1ccc(F)cc1)=C2c1ccc(OCCN2CCCCC2)cc1

Standard InChI:  InChI=1S/C29H30FNO3/c1-32-25-13-14-26-28(19-25)34-20-27(21-5-9-23(30)10-6-21)29(26)22-7-11-24(12-8-22)33-18-17-31-15-3-2-4-16-31/h5-14,19H,2-4,15-18,20H2,1H3

Standard InChI Key:  NWQQABYDLWMYKC-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 34 38  0  0  0  0  0  0  0  0999 V2000
    1.9792   -0.4500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5000   -0.1417    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4542   -0.1417    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4542    0.4583    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.9750    0.7625    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.4917    0.4708    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.9792   -1.0542    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.9292    0.7583    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.0250   -0.4417    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.9292   -0.4542    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.9417   -4.0667    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.5000   -1.3500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4542   -1.3542    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.0292   -1.0500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5417   -0.1375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.4042    0.4583    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.4042   -0.1500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.0750   -1.0417    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.9875   -2.2542    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.0667   -0.4375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5542   -1.3417    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5042   -1.9500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4625   -1.9542    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.6000   -1.3417    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    1.9875   -2.8625    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.4667   -3.7667    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4667   -3.1667    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.1208    0.7583    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.4250   -3.7750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.9542   -4.6792    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.1208    1.3625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.4292   -4.9792    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0958   -4.0792    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0958   -4.6792    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0
  3  1  1  0
  4  3  2  0
  5  4  1  0
  6  2  1  0
  7  1  1  0
  8  4  1  0
  9  2  1  0
 10  3  1  0
 11 26  1  0
 12  7  1  0
 13  7  2  0
 14  9  2  0
 15  9  1  0
 16 17  1  0
 17 10  2  0
 18 20  1  0
 19 23  2  0
 20 15  2  0
 21 14  1  0
 22 12  2  0
 23 13  1  0
 24 18  1  0
 25 19  1  0
 26 27  1  0
 27 25  1  0
 28 16  1  0
 29 11  1  0
 30 11  1  0
 31 28  1  0
 32 30  1  0
 33 29  1  0
 34 32  1  0
  6  5  1  0
 22 19  1  0
 16  8  2  0
 21 18  2  0
 34 33  1  0
M  END

Associated Targets(Human)

EBP Tchem Anti-estrogen binding site (AEBS) (124 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
ESR2 Tclin Estrogen receptor (3070 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 459.56Molecular Weight (Monoisotopic): 459.2210AlogP: 6.05#Rotatable Bonds: 7
Polar Surface Area: 30.93Molecular Species: BASEHBA: 4HBD:
#RO5 Violations: 1HBA (Lipinski): 4HBD (Lipinski): #RO5 Violations (Lipinski): 1
CX Acidic pKa: CX Basic pKa: 8.82CX LogP: 5.82CX LogD: 4.39
Aromatic Rings: 3Heavy Atoms: 34QED Weighted: 0.43Np Likeness Score: -0.47

References

1. Teo CC, Kon OL, Sim KY, Ng SC..  (1992)  Synthesis of 2-(p-chlorobenzyl)-3-aryl-6-methoxybenzofurans as selective ligands for antiestrogen-binding sites. Effects on cell proliferation and cholesterol synthesis.,  35  (8): [PMID:1573630] [10.1021/jm00086a002]

Source