(S)-2-[(2S,3S)-2-((S)-2-{(S)-2-[4-(4-dimethylamino-phenylazo)-benzoylamino]-5-guanidino-pentanoylamino}-5-guanidino-pentanoylamino)-3-methyl-pentanoylamino]-succinamic acid

ID: ALA271633

PubChem CID: 44454435

Max Phase: Preclinical

Molecular Formula: C37H56N14O7

Molecular Weight: 808.95

Molecule Type: Small molecule

Names and Identifiers

Canonical SMILES:  CC[C@H](C)[C@H](NC(=O)[C@H](CCCNC(=N)N)NC(=O)[C@H](CCCNC(=N)N)NC(=O)c1ccc(/N=N/c2ccc(N(C)C)cc2)cc1)C(=O)N[C@@H](CC(N)=O)C(=O)O

Standard InChI:  InChI=1S/C37H56N14O7/c1-5-21(2)30(34(56)47-28(35(57)58)20-29(38)52)48-33(55)27(9-7-19-44-37(41)42)46-32(54)26(8-6-18-43-36(39)40)45-31(53)22-10-12-23(13-11-22)49-50-24-14-16-25(17-15-24)51(3)4/h10-17,21,26-28,30H,5-9,18-20H2,1-4H3,(H2,38,52)(H,45,53)(H,46,54)(H,47,56)(H,48,55)(H,57,58)(H4,39,40,43)(H4,41,42,44)/b50-49+/t21-,26-,27-,28-,30-/m0/s1

Standard InChI Key:  XLCLPCZPVKJNCV-GUSYJLDUSA-N

Molfile:  

     RDKit          2D

 58 59  0  0  1  0  0  0  0  0999 V2000
    7.6221   -2.2928    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    7.6221   -1.4666    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.9102   -1.0566    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    8.3401   -1.0566    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.4826   -5.1750    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.1942   -4.7651    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.9102   -6.0012    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.9102   -5.1750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.1942   -3.9388    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.9102   -3.5289    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.9102   -2.7027    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.7637   -7.6473    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    9.7637   -8.4734    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.0478   -8.8834    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   10.4763   -8.8834    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    7.6221   -4.7651    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    8.3401   -5.1750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.0478   -3.9388    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    9.0478   -4.7651    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.3401   -6.0012    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.0478   -6.4112    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.0478   -7.2373    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.7637   -5.1750    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   10.4763   -4.7651    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.1898   -6.0012    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   11.1898   -5.1750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.4763   -3.9388    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.1898   -3.5289    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.7637   -3.5289    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.7637   -2.7027    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.9032   -4.7651    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   12.6192   -5.1750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.3326   -3.9388    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   13.3326   -4.7651    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.6192   -6.0012    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.3326   -6.4112    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.3326   -7.2373    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   14.0462   -6.0012    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   14.0462   -5.1750    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.4826   -6.0012    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.7728   -6.4112    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.7728   -7.2373    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.0567   -7.6473    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.3410   -7.2373    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.3410   -6.4112    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.0567   -6.0012    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.1942   -6.4112    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.6290   -7.6473    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.6290   -8.4734    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.9131   -8.8834    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.9131   -9.7096    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2033  -10.1197    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.4874   -9.7096    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.4874   -8.8834    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2033   -8.4734    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.2243  -10.1197    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -0.2243  -10.9457    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.9363   -9.7096    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  8 16  1  0
 19 23  1  0
 26 31  1  0
 34 39  1  0
  1  2  1  0
  2  3  1  0
  2  4  2  0
  5  6  1  0
  6  8  1  0
  8  7  2  0
  6  9  1  1
  9 10  1  0
 10 11  1  0
 11  1  1  0
 12 13  1  0
 13 14  1  0
 13 15  2  0
 16 17  1  0
 17 19  1  0
 19 18  2  0
 17 20  1  6
 20 21  1  0
 21 22  1  0
 22 12  1  0
 24 23  1  1
 24 26  1  0
 26 25  2  0
 24 27  1  0
 27 28  1  6
 27 29  1  0
 29 30  1  0
 31 32  1  0
 32 34  1  0
 34 33  2  0
 32 35  1  6
 35 36  1  0
 36 37  2  0
 36 38  1  0
 40 41  1  0
 41 42  1  0
 42 43  2  0
 43 44  1  0
 44 45  2  0
 45 46  1  0
 41 46  2  0
 40 47  2  0
 40  5  1  0
 48 49  2  0
 50 51  1  0
 51 52  2  0
 52 53  1  0
 53 54  2  0
 54 55  1  0
 50 55  2  0
 56 57  1  0
 56 58  1  0
 53 56  1  0
 49 50  1  0
 44 48  1  0
M  END

Alternative Forms

1. Parent:

   

   ALA271633

   (2S)-4-amino-2-[[(2S,3S)-2-[[(2S)-5-(diaminomethylideneamino)-2-[[(2S)-5-(diaminomethylideneamino)-2-[[4-[[4-(dimethylamino)phenyl]diazenyl]benzoyl]amino]pentanoyl]amino]pentanoyl]amino]-3-methylpentanoyl]amino]-4-oxobutanoic acid

Molecule Features

Natural Product: No

Oral: No

Chemical Probe: No

Parenteral: No

Molecule Type: Small molecule

Topical: No

First In Class: No

Black Box: No

Chirality: No

Availability: No

Prodrug: No

Calculated Properties

Molecular Weight: 808.95

Molecular Weight (Monoisotopic): 808.4456

AlogP: 0.25

#Rotatable Bonds: 24

Polar Surface Area: 348.55

Molecular Species: ZWITTERION

HBA: 11

HBD: 12

#RO5 Violations: 3

HBA (Lipinski): 21

HBD (Lipinski): 15

#RO5 Violations (Lipinski): 3

CX Acidic pKa: 3.80

CX Basic pKa: 11.85

CX LogP: -2.09

CX LogD: -3.99

Aromatic Rings: 2

Heavy Atoms: 58

QED Weighted: 0.03

Np Likeness Score: -0.18

References

1. Agarkov A, Chauhan S, Lory PJ, Gilbertson SR, Motin VL..  (2008)  Substrate specificity and screening of the integral membrane protease Pla.,  18  (1): [PMID:17981463] [10.1016/j.bmcl.2007.09.104]

Source

Source(1):

• Scientific Literature