dimethyl 4-(6-(2,5-dimethoxy-4-nitrophenyl)imidazo[2,1-b]thiazol-5-yl)-2,6-dimethyl-1,4-dihydropyridine-3,5-dicarboxylate

ID: ALA271993

PubChem CID: 24823077

Max Phase: Preclinical

Molecular Formula: C24H24N4O8S

Molecular Weight: 528.54

Molecule Type: Small molecule

Names and Identifiers

Canonical SMILES:  COC(=O)C1=C(C)NC(C)=C(C(=O)OC)C1c1c(-c2cc(OC)c([N+](=O)[O-])cc2OC)nc2sccn12

Standard InChI:  InChI=1S/C24H24N4O8S/c1-11-17(22(29)35-5)19(18(12(2)25-11)23(30)36-6)21-20(26-24-27(21)7-8-37-24)13-9-16(34-4)14(28(31)32)10-15(13)33-3/h7-10,19,25H,1-6H3

Standard InChI Key:  SMZFRGYJZKEHFJ-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 37 40  0  0  0  0  0  0  0  0999 V2000
    5.0592   -2.2962    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.3142   -1.5116    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.6468   -1.0266    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9230    2.4107    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9230    1.5811    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.6374    1.1686    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.3564    1.5811    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.3564    2.4107    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.6374    2.8276    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.0712    2.8224    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2075    2.8214    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0703    1.1677    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0690    0.3427    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.7852    1.5791    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.2085    1.1686    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4941    1.5811    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.2085    0.3437    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.7798    1.1686    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2343   -2.2962    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9749   -1.5098    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.1469   -1.5135    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8945   -2.3022    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5667   -2.7857    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    6.0978   -1.2564    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.7107   -1.8101    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.4946   -1.5558    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.6669   -0.7482    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.0488   -0.1952    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.2674   -0.4525    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.5384   -2.6169    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.1508   -3.1695    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.2176    0.6122    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.0012    0.8699    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.7863    2.4041    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.4530   -0.4924    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    8.6234    0.3147    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    9.0667   -1.0437    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
 16 18  1  0
  6  3  1  0
 19 20  1  0
  7  8  2  0
  8  9  1  0
 19  1  2  0
  8 10  1  0
 20 21  1  0
 21 22  2  0
 22 23  1  0
 23 19  1  0
  4 11  1  0
  1  2  1  0
 24 25  2  0
  7 12  1  0
 25 26  1  0
  2  3  2  0
 26 27  2  0
 12 13  2  0
 27 28  1  0
  3 20  1  0
 28 29  2  0
 29 24  1  0
  2 24  1  0
 12 14  1  0
 25 30  1  0
  4  5  2  0
 30 31  1  0
  5 15  1  0
 28 32  1  0
  4  9  1  0
 32 33  1  0
 15 16  1  0
 14 34  1  0
  5  6  1  0
 15 17  2  0
  6  7  1  0
 35 36  2  0
 35 37  1  0
 27 35  1  0
M  CHG  2  35   1  37  -1
M  END

Alternative Forms

1. Parent:

   

   ALA271993

   Dimethyl 4-[6-(2,5-dimethoxy-4-nitrophenyl)imidazo[2,1-b][1,3]thiazol-5-yl]-2,6-dimethyl-1,4-dihydropyridine-3,5-dicarboxylate

Molecule Features

Natural Product: No

Oral: No

Chemical Probe: No

Parenteral: No

Molecule Type: Small molecule

Topical: No

First In Class: No

Black Box: No

Chirality: No

Availability: No

Prodrug: No

Calculated Properties

Molecular Weight: 528.54

Molecular Weight (Monoisotopic): 528.1315

AlogP: 3.57

#Rotatable Bonds: 7

Polar Surface Area: 143.53

Molecular Species: NEUTRAL

HBA: 12

HBD: 1

#RO5 Violations: 2

HBA (Lipinski): 12

HBD (Lipinski): 1

#RO5 Violations (Lipinski): 2

CX Acidic pKa: ┄

CX Basic pKa: 3.12

CX LogP: 2.20

CX LogD: 2.20

Aromatic Rings: 3

Heavy Atoms: 37

QED Weighted: 0.27

Np Likeness Score: -1.06

References

1. Budriesi R, Ioan P, Locatelli A, Cosconati S, Leoni A, Ugenti MP, Andreani A, Di Toro R, Bedini A, Spampinato S, Marinelli L, Novellino E, Chiarini A..  (2008)  Imidazo[2,1-b]thiazole system: a scaffold endowing dihydropyridines with selective cardiodepressant activity.,  51  (6): [PMID:18303827] [10.1021/jm070681+]

2. Leoni A, Frosini M, Locatelli A, Micucci M, Carotenuto C, Durante M, Cosconati S, Budriesi R..  (2019)  4-Imidazo[2,1-b]thiazole-1,4-DHPs and neuroprotection: preliminary study in hits searching.,  169  [PMID:30861492] [10.1016/j.ejmech.2019.02.075]

Source

Source(1):

• Scientific Literature