5-[2-(5-chloro-2-methoxybenzamido)ethyl]-2,4-dimethoxy-benzenesulfonyl-3-methlurea

ID: ALA273299

PubChem CID: 10576883

Max Phase: Preclinical

Molecular Formula: C20H24ClN3O7S

Molecular Weight: 485.95

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CNC(=O)NS(=O)(=O)c1cc(CCNC(=O)c2cc(Cl)ccc2OC)c(OC)cc1OC

Standard InChI:  InChI=1S/C20H24ClN3O7S/c1-22-20(26)24-32(27,28)18-9-12(16(30-3)11-17(18)31-4)7-8-23-19(25)14-10-13(21)5-6-15(14)29-2/h5-6,9-11H,7-8H2,1-4H3,(H,23,25)(H2,22,24,26)

Standard InChI Key:  UZKHHDXNANOVEG-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 32 33  0  0  0  0  0  0  0  0999 V2000
    0.3667   -1.5292    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   -0.1500   -1.2292    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.8792   -1.2292    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -3.7708   -1.5542    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.1583   -0.6292    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.3917   -1.5292    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.6708   -1.5375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2583   -1.2500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.6833   -0.3375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.8792   -1.8292    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.1583   -1.8292    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.1958   -0.6417    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.1958   -1.2417    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.2958   -1.2542    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.7708   -2.1542    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4000   -2.1292    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2583   -0.6500    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.7458   -1.5500    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.9167   -1.2250    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -4.8083   -1.5542    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.2958   -2.4542    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3542   -0.3292    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7208   -0.3500    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -4.8083   -2.1542    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.2958   -3.0625    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
   -4.2958   -0.6542    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.2208   -1.2417    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7083   -1.5417    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.9042   -0.6250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3542    0.2708    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.2333   -0.6542    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.8125   -0.3625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  3  1  1  0
  4  8  1  0
  5  2  2  0
  6  3  1  0
  7  2  1  0
  8 18  1  0
  9  5  1  0
 10  1  2  0
 11  1  2  0
 12 13  1  0
 13  7  2  0
 14  4  2  0
 15  4  1  0
 16  6  2  0
 17  8  2  0
 18 27  1  0
 19  6  1  0
 20 14  1  0
 21 15  2  0
 22  5  1  0
 23 12  1  0
 24 21  1  0
 25 21  1  0
 26 14  1  0
 27 28  1  0
 28 13  1  0
 29 19  1  0
 30 22  1  0
 31 23  1  0
 32 26  1  0
 12  9  2  0
 24 20  2  0
M  END

Associated Targets(Human)

KCNJ11 Tclin Sulfonylurea receptor 1, Kir6.2 (325 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
KCNJ11 Tclin Sulfonylurea receptors; K-ATP channels (596 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 485.95Molecular Weight (Monoisotopic): 485.1023AlogP: 1.96#Rotatable Bonds: 9
Polar Surface Area: 132.06Molecular Species: ACIDHBA: 7HBD: 3
#RO5 Violations: HBA (Lipinski): 10HBD (Lipinski): 3#RO5 Violations (Lipinski):
CX Acidic pKa: 4.27CX Basic pKa: CX LogP: 1.68CX LogD: 0.74
Aromatic Rings: 2Heavy Atoms: 32QED Weighted: 0.49Np Likeness Score: -1.15

References

1. Englert HC, Gerlach U, Goegelein H, Hartung J, Heitsch H, Mania D, Scheidler S..  (2001)  Cardioselective K(ATP) channel blockers derived from a new series of m-anisamidoethylbenzenesulfonylthioureas.,  44  (7): [PMID:11297455] [10.1021/jm000985v]

Source