The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2-(4-Ethylsulfanyl-3-methyl-pyridin-2-ylmethanesulfinyl)-benzoimidazole-1-carboxylic acid 4-nitro-benzyl ester ID: ALA275283
PubChem CID: 14877913
Max Phase: Preclinical
Molecular Formula: C24H22N4O5S2
Molecular Weight: 510.60
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CCSc1ccnc(C[S+]([O-])c2nc3ccccc3n2C(=O)OCc2ccc([N+](=O)[O-])cc2)c1C
Standard InChI: InChI=1S/C24H22N4O5S2/c1-3-34-22-12-13-25-20(16(22)2)15-35(32)23-26-19-6-4-5-7-21(19)27(23)24(29)33-14-17-8-10-18(11-9-17)28(30)31/h4-13H,3,14-15H2,1-2H3
Standard InChI Key: XHVRBDKLEAIHJP-UHFFFAOYSA-N
Molfile:
RDKit 2D
35 38 0 0 0 0 0 0 0 0999 V2000
5.1385 -3.3974 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.2221 -4.2259 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.8941 -3.0602 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.4169 -2.9874 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
4.6105 -4.7846 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.8556 -9.3927 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.0351 -4.3986 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4523 -3.6812 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.6948 -3.4014 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.9754 -2.9877 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.9837 -2.1585 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.6868 -8.5785 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.2605 -3.4059 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.6511 -9.6471 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.7778 -5.5932 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.2425 -9.9458 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.4123 -2.1556 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.2643 -1.7449 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8171 -4.5266 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.8954 -8.3168 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.3041 -8.0181 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.2690 -0.9136 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
1.5431 -2.9886 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.1662 -6.1519 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.5437 -2.1646 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.3408 -6.9646 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.7261 -7.5120 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1274 -7.2091 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4605 -5.1175 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.7017 -1.7518 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.2805 -3.6745 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.5495 -0.4999 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.2887 -5.1109 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.5506 0.3334 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.6986 -4.3893 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 0
3 1 2 0
4 1 1 0
5 2 1 0
6 12 1 0
7 2 1 0
8 3 1 0
9 4 1 0
10 9 1 0
11 10 1 0
12 21 2 0
13 10 2 0
14 6 1 0
15 5 1 0
16 6 2 0
17 4 1 0
18 11 2 0
19 5 2 0
20 27 2 0
21 28 1 0
22 18 1 0
23 13 1 0
24 15 1 0
25 23 2 0
26 24 1 0
27 26 1 0
28 26 2 0
29 7 2 0
30 11 1 0
31 8 2 0
32 22 1 0
33 29 1 0
34 32 1 0
35 31 1 0
7 8 1 0
33 35 2 0
18 25 1 0
12 20 1 0
M CHG 4 4 1 6 1 14 -1 17 -1
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 510.60Molecular Weight (Monoisotopic): 510.1032AlogP: 5.25#Rotatable Bonds: 8Polar Surface Area: 123.21Molecular Species: NEUTRALHBA: 9HBD: ┄#RO5 Violations: 2HBA (Lipinski): 9HBD (Lipinski): ┄#RO5 Violations (Lipinski): 2CX Acidic pKa: 11.37CX Basic pKa: 2.86CX LogP: 4.72CX LogD: 4.72Aromatic Rings: 4Heavy Atoms: 35QED Weighted: 0.14Np Likeness Score: -1.05
References 1. Sih JC, Im WB, Robert A, Graber DR, Blakeman DP.. (1991) Studies on (H(+)-K+)-ATPase inhibitors of gastric acid secretion. Prodrugs of 2-[(2-pyridinylmethyl)sulfinyl]benzimidazole proton-pump inhibitors., 34 (3): [PMID:1848293 ] [10.1021/jm00107a026 ]