2-methyl-2-phenylsulfonylpropyl 21-oxa-13-azapentacyclo[10.9.0.01,20.05,20.014,19]henicosa-8,14(19),15,17-tetraen-6,10-diyne-13-carboxylate

ID: ALA277573

PubChem CID: 44270630

Max Phase: Preclinical

Molecular Formula: C30H27NO5S

Molecular Weight: 513.62

Molecule Type: Small molecule

Names and Identifiers

Canonical SMILES:  CC(C)(COC(=O)N1c2ccccc2[C@@]23O[C@]24CCC[C@@H]3C#C/C=C\C#C[C@H]14)S(=O)(=O)c1ccccc1

Standard InChI:  InChI=1S/C30H27NO5S/c1-28(2,37(33,34)23-15-7-5-8-16-23)21-35-27(32)31-25-18-11-10-17-24(25)30-22-13-6-3-4-9-19-26(31)29(30,36-30)20-12-14-22/h3-5,7-8,10-11,15-18,22,26H,12,14,20-21H2,1-2H3/b4-3-/t22-,26-,29-,30+/m0/s1

Standard InChI Key:  IWNJYFSBKWWQGV-DTQKIXHVSA-N

Molfile:  

     RDKit          2D

 39 44  0  0  1  0  0  0  0  0999 V2000
    5.5167   -2.6417    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.4917   -3.4667    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.8042   -3.0500    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.0917   -2.6000    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.8167   -2.2042    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.7750   -3.8542    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.6417   -2.0000    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    4.0667   -3.4250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.3750   -2.1875    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.3542   -2.4167    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.8417   -1.3792    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.1917   -3.9042    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.8167   -2.3292    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.8375   -0.5542    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.8250   -1.5042    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6542   -2.5917    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.6417   -1.1750    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0750   -2.4042    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.2250   -1.4167    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.0667   -2.0042    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.3750   -1.3625    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.4167    0.0333    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.8292   -0.6792    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.2500   -2.2500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.7542   -4.6792    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.3417   -3.8167    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7667   -3.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.3417   -3.2417    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.9542   -2.6917    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.9250   -3.5167    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.0167   -1.6375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0125   -0.6250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.0250   -5.0750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.3167   -4.6417    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.5917   -0.0417    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6042   -1.0542    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.3917   -0.2542    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.0292   -1.9667    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    6.1625   -4.7292    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  1  3  1  6
  4  5  1  0
  5  1  1  0
  6  2  1  0
  7 10  1  0
  8  4  1  0
  9  4  1  0
 10 20  1  0
  5 11  1  0
 12  2  1  0
 13 12  1  0
 14 11  3  0
 15 13  3  0
 16  9  1  0
 17  7  2  0
 18  7  2  0
 19  7  1  0
 20 16  1  0
 21  9  2  0
 22 14  1  0
 23 22  2  0
 24  1  1  0
 25  6  1  0
 26  8  1  0
 27 10  1  0
 10 28  1  0
 29 24  1  0
 30 29  1  0
 31 19  2  0
 32 19  1  0
 33 25  2  0
 34 26  2  0
 35 32  2  0
 36 31  1  0
 37 35  1  0
  5 38  1  6
 12 39  1  6
  2  3  1  6
 30 12  1  0
  6  8  2  0
 15 23  1  0
 33 34  1  0
 37 36  2  0
M  END

Alternative Forms

1. Parent:

   

   ALA277573

   [2-(benzenesulfonyl)-2-methylpropyl] (1S,5R,8Z,12S,20R)-21-oxa-13-azapentacyclo[10.9.0.01,20.05,20.014,19]henicosa-8,14,16,18-tetraen-6,10-diyne-13-carboxylate

Molecule Features

Natural Product: No

Oral: No

Chemical Probe: No

Parenteral: No

Molecule Type: Small molecule

Topical: No

First In Class: No

Black Box: No

Chirality: No

Availability: No

Prodrug: No

Calculated Properties

Molecular Weight: 513.62

Molecular Weight (Monoisotopic): 513.1610

AlogP: 4.61

#Rotatable Bonds: 4

Polar Surface Area: 76.21

Molecular Species: NEUTRAL

HBA: 5

HBD: ┄

#RO5 Violations: 1

HBA (Lipinski): 6

HBD (Lipinski): ┄

#RO5 Violations (Lipinski): 1

CX Acidic pKa: 13.68

CX Basic pKa: ┄

CX LogP: 5.42

CX LogD: 5.42

Aromatic Rings: 2

Heavy Atoms: 37

QED Weighted: 0.44

Np Likeness Score: 0.80

References

1. Nicolaou K, Dai W, Tsay S, Wrasidlo W.  (1992)  On the mechanism of activation of designed enediynes with selective cytotoxicity,  2  (9): [10.1016/S0960-894X(00)80638-1]

Source

Source(1):

• Scientific Literature