The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2-(2-{2-[5-Amino-2-(4-fluoro-phenyl)-6-oxo-6H-pyrimidin-1-yl]-acetylamino}-3-phenyl-propionyl)-benzooxazole-5-carboxylic acid methyl ester ID: ALA281124
PubChem CID: 9829503
Max Phase: Preclinical
Molecular Formula: C30H24FN5O6
Molecular Weight: 569.55
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: COC(=O)c1ccc2oc(C(=O)C(Cc3ccccc3)NC(=O)Cn3c(-c4ccc(F)cc4)ncc(N)c3=O)nc2c1
Standard InChI: InChI=1S/C30H24FN5O6/c1-41-30(40)19-9-12-24-22(14-19)35-28(42-24)26(38)23(13-17-5-3-2-4-6-17)34-25(37)16-36-27(33-15-21(32)29(36)39)18-7-10-20(31)11-8-18/h2-12,14-15,23H,13,16,32H2,1H3,(H,34,37)
Standard InChI Key: YGRSMPVCBHOYMS-UHFFFAOYSA-N
Molfile:
RDKit 2D
42 46 0 0 0 0 0 0 0 0999 V2000
3.5667 -1.2167 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.3542 -3.8542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5917 -0.6125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.0375 -1.4917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.9542 -3.9125 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.0792 -0.2917 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.0417 -3.3417 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5292 -1.1750 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1167 -4.4042 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.0875 -4.4917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.5167 -3.0542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5542 -0.5750 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.5667 -4.8042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.0667 -1.5375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.0417 -2.1292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.5417 -2.4542 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.1417 -5.6750 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.6167 -5.3875 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.6042 -4.7875 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.1167 -0.3292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.0417 -2.0917 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.5625 -3.0292 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.0042 -3.3542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5250 -2.4375 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.1500 -6.2750 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.5792 -5.4042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.0042 -1.4750 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.1042 -5.6917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.1375 0.2708 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.6292 -0.6500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1792 0.2333 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.6542 -5.3667 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.0042 -3.9542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1542 -0.3667 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.6667 0.5458 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.6917 0.5458 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
8.2375 -5.5250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.5750 -4.2917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.4917 -4.2542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.5375 -4.8292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5000 -4.8542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.0167 -5.1417 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 7 1 0
3 1 1 0
4 1 1 0
5 2 2 0
6 3 2 0
7 11 1 0
8 4 1 0
9 2 1 0
10 5 1 0
11 16 1 0
12 8 2 0
13 9 1 0
14 1 1 0
15 14 1 0
16 15 1 0
17 18 1 0
18 19 2 0
19 10 1 0
20 3 1 0
21 4 2 0
22 7 2 0
23 11 1 0
24 15 2 0
25 17 2 0
26 13 1 0
27 8 1 0
28 26 2 0
29 20 1 0
30 20 2 0
31 34 2 0
32 17 1 0
33 23 1 0
34 30 1 0
35 29 2 0
36 31 1 0
37 32 1 0
38 33 1 0
39 33 2 0
40 38 2 0
41 39 1 0
42 41 2 0
12 6 1 0
35 31 1 0
13 10 2 0
42 40 1 0
18 28 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 569.55Molecular Weight (Monoisotopic): 569.1711AlogP: 3.17#Rotatable Bonds: 9Polar Surface Area: 159.41Molecular Species: NEUTRALHBA: 10HBD: 2#RO5 Violations: 1HBA (Lipinski): 11HBD (Lipinski): 3#RO5 Violations (Lipinski): 2CX Acidic pKa: 11.84CX Basic pKa: 0.86CX LogP: 2.91CX LogD: 2.91Aromatic Rings: 5Heavy Atoms: 42QED Weighted: 0.20Np Likeness Score: -1.01
References 1. Akahoshi F, Ashimori A, Sakashita H, Yoshimura T, Imada T, Nakajima M, Mitsutomi N, Kuwahara S, Ohtsuka T, Fukaya C, Miyazaki M, Nakamura N.. (2001) Synthesis, structure-activity relationships, and pharmacokinetic profiles of nonpeptidic alpha-keto heterocycles as novel inhibitors of human chymase., 44 (8): [PMID:11312927 ] [10.1021/jm000496v ]