N*1*-{(2R,3R,4S,5R,6R)-3,4,5-Tris-benzyloxy-6-[2-(1H-indol-3-yl)-ethoxy]-tetrahydro-pyran-2-ylmethyl}-pentane-1,5-diamine

ID: ALA282129

PubChem CID: 10580397

Max Phase: Preclinical

Molecular Formula: C42H51N3O5

Molecular Weight: 677.89

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  NCCCCCNC[C@H]1O[C@@H](OCCc2c[nH]c3ccccc23)[C@H](OCc2ccccc2)[C@@H](OCc2ccccc2)[C@@H]1OCc1ccccc1

Standard InChI:  InChI=1S/C42H51N3O5/c43-24-13-4-14-25-44-28-38-39(47-29-32-15-5-1-6-16-32)40(48-30-33-17-7-2-8-18-33)41(49-31-34-19-9-3-10-20-34)42(50-38)46-26-23-35-27-45-37-22-12-11-21-36(35)37/h1-3,5-12,15-22,27,38-42,44-45H,4,13-14,23-26,28-31,43H2/t38-,39-,40+,41-,42-/m1/s1

Standard InChI Key:  BOPFKNIUSGFFMZ-QBLDGPCBSA-N

Molfile:  

     RDKit          2D

 50 55  0  0  1  0  0  0  0  0999 V2000
    3.0167   -1.3167    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6167   -2.0375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.0417   -2.7417    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2667   -2.0042    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.8417   -1.3042    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8667   -2.7292    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.5542    0.6000    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.7625    0.8458    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5917   -0.6125    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.7917   -2.0542    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.2917    0.1708    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6500   -3.4667    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.7875   -0.4917    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.5667   -0.2167    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2417   -0.5792    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.9917    0.1083    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.3667   -1.3417    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.8250   -3.4792    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.3000   -3.4292    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.1250   -3.4167    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    8.8792   -5.4542    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.5750    0.8208    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4292   -4.2042    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.5417   -1.3625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.4667    0.1583    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.0667   -0.5667    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.6292   -1.3000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.1875   -0.7542    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.5500   -4.1167    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.0542   -5.4792    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.8542   -4.9042    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.9792    1.5375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7542    0.8000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.6042   -4.2167    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.1167   -0.6542    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.1500   -2.0792    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.3667   -4.1000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.6292   -4.7792    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.8042   -4.8000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.2542   -1.8417    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.0292   -1.5667    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4625   -5.6292    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.2042   -4.9417    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5542    2.2458    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7083   -0.6667    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.6750   -2.1042    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.3292    1.5083    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.1083   -1.3917    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7292    2.2333    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.6292   -5.6500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  3  2  1  0
  4  5  1  0
  5  1  1  0
  6  4  1  0
  7  8  1  0
  8 11  2  0
  1  9  1  1
  2 10  1  6
 11 25  1  0
  3 12  1  1
 13 11  1  0
 14 13  2  0
  5 15  1  6
 16  9  1  0
 17 10  1  0
 18 12  1  0
  6 19  1  6
 20 19  1  0
 21 30  1  0
 22 16  1  0
 23 18  1  0
 24 17  1  0
 25 26  1  0
 26 15  1  0
 27 13  1  0
 28 14  1  0
 29 20  1  0
 30 38  1  0
 31 23  1  0
 32 22  2  0
 33 22  1  0
 34 23  2  0
 35 24  2  0
 36 24  1  0
 37 29  1  0
 38 39  1  0
 39 37  1  0
 40 27  2  0
 41 40  1  0
 42 31  2  0
 43 34  1  0
 44 32  1  0
 45 35  1  0
 46 36  2  0
 47 33  2  0
 48 46  1  0
 49 47  1  0
 50 43  2  0
  3  6  1  0
 44 49  2  0
 14  7  1  0
 45 48  2  0
 42 50  1  0
 41 28  2  0
M  END

Associated Targets(Human)

SSTR1 Tclin Somatostatin receptor 1 (861 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
SSTR2 Tclin Somatostatin receptor 2 (1526 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
SSTR3 Tclin Somatostatin receptor 3 (1562 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
SSTR4 Tclin Somatostatin receptor 4 (1125 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
SSTR5 Tclin Somatostatin receptor 5 (1477 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Associated Targets(non-human)

Sstr3 Somatostatin receptor (42 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 677.89Molecular Weight (Monoisotopic): 677.3829AlogP: 6.93#Rotatable Bonds: 20
Polar Surface Area: 99.99Molecular Species: BASEHBA: 7HBD: 3
#RO5 Violations: 2HBA (Lipinski): 8HBD (Lipinski): 4#RO5 Violations (Lipinski): 2
CX Acidic pKa: CX Basic pKa: 10.21CX LogP: 7.48CX LogD: 2.43
Aromatic Rings: 5Heavy Atoms: 50QED Weighted: 0.08Np Likeness Score: 0.43

References

1. Hirschmann R, Hynes J, Cichy-Knight MA, van Rijn RD, Sprengeler PA, Spoors PG, Shakespeare WC, Pietranico-Cole S, Barbosa J, Liu J, Yao W, Rohrer S, Smith AB..  (1998)  Modulation of receptor and receptor subtype affinities using diastereomeric and enantiomeric monosaccharide scaffolds as a means to structural and biological diversity. A new route to ether synthesis.,  41  (9): [PMID:9554871] [10.1021/jm9800346]

Source