The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
3-(S)-1H-Indol-3-yl-2-{(S)-2-[3-(1H-indol-3-yl)-1-phosphono-propylamino]-4-methyl-pentanoylamino}-propionic acid ID: ALA283758
PubChem CID: 15199910
Max Phase: Preclinical
Molecular Formula: C28H35N4O6P
Molecular Weight: 554.58
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CC(C)C[C@H](NC(CCc1c[nH]c2ccccc12)P(=O)(O)O)C(=O)N[C@@H](Cc1c[nH]c2ccccc12)C(=O)O
Standard InChI: InChI=1S/C28H35N4O6P/c1-17(2)13-24(27(33)32-25(28(34)35)14-19-16-30-23-10-6-4-8-21(19)23)31-26(39(36,37)38)12-11-18-15-29-22-9-5-3-7-20(18)22/h3-10,15-17,24-26,29-31H,11-14H2,1-2H3,(H,32,33)(H,34,35)(H2,36,37,38)/t24-,25-,26?/m0/s1
Standard InChI Key: MIHCJTSHBDWVAV-NPGWBMRXSA-N
Molfile:
RDKit 2D
39 42 0 0 1 0 0 0 0 0999 V2000
2.1750 -3.9167 0.0000 P 0 0 0 0 0 0 0 0 0 0 0 0
7.3125 -4.3625 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.0000 -3.4750 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8167 -3.4000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.6417 -4.4292 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.5792 -0.0667 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.1292 -4.2875 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.0000 -3.9042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5875 -3.6917 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.2042 -1.2500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4625 -0.8792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.9000 -4.5792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2292 -3.1750 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.5167 -5.1500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.0292 -5.4000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.5417 -4.0667 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.7792 -0.6542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.3417 -5.2000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.3917 0.0750 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.6500 -3.2792 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.6417 -2.9542 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.6875 -2.5792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.3292 -2.0667 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.8000 -5.6917 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.1042 -2.3542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6917 -4.5542 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.5292 -4.4292 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.3875 -5.9167 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.0667 -5.8375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.6042 -0.6875 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.7500 -1.8417 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8292 0.7750 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.7167 -5.9292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.5167 -2.1417 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.6167 -1.0292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.4417 -6.5750 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.0417 0.0083 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.2667 -6.6167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.6542 0.7458 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 16 1 0
3 13 1 0
4 1 1 0
5 8 1 0
6 11 1 0
7 3 1 0
8 2 2 0
9 4 1 0
10 23 1 0
11 10 2 0
12 7 1 0
13 9 1 0
14 2 1 0
15 12 1 0
12 16 1 1
17 10 1 0
18 14 2 0
19 17 1 0
20 1 2 0
21 3 2 0
22 4 1 0
23 22 1 0
24 15 2 0
13 25 1 1
26 1 1 0
27 1 1 0
28 15 1 0
29 14 1 0
30 17 2 0
31 25 1 0
32 19 2 0
33 18 1 0
34 31 1 0
35 31 1 0
36 29 2 0
37 30 1 0
38 36 1 0
39 37 2 0
6 19 1 0
39 32 1 0
5 18 1 0
33 38 2 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 554.58Molecular Weight (Monoisotopic): 554.2294AlogP: 3.90#Rotatable Bonds: 13Polar Surface Area: 167.54Molecular Species: ACIDHBA: 4HBD: 7#RO5 Violations: 2HBA (Lipinski): 10HBD (Lipinski): 7#RO5 Violations (Lipinski): 2CX Acidic pKa: -0.61CX Basic pKa: 6.68CX LogP: 2.33CX LogD: -1.63Aromatic Rings: 4Heavy Atoms: 39QED Weighted: 0.12Np Likeness Score: 0.13
References 1. Fukami T, Hayama T, Amano Y, Nakamura Y, Arai Y, Matsuyama K, Yano M, Ishikawa K. (1994) Aminophosphonate endothelin converting enzyme inhibitors: potency-enhancing and selectivity-improving modifications of phosphoramidon, 4 (10): [10.1016/S0960-894X(01)80341-3 ]