3-(2-Chloro-ethyl)-4-oxo-3,4-dihydro-imidazo[5,1-d][1,2,3,5]tetrazine-8-carboxylic acid [4-(2-amino-6-oxo-1,6-dihydro-pyrimidin-4-yl)-phenyl]-amide

ID: ALA284302

PubChem CID: 135531287

Max Phase: Preclinical

Molecular Formula: C17H14ClN9O3

Molecular Weight: 427.81

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  Nc1nc(O)cc(-c2ccc(NC(=O)c3ncn4c(=O)n(CCCl)nnc34)cc2)n1

Standard InChI:  InChI=1S/C17H14ClN9O3/c18-5-6-27-17(30)26-8-20-13(14(26)24-25-27)15(29)21-10-3-1-9(2-4-10)11-7-12(28)23-16(19)22-11/h1-4,7-8H,5-6H2,(H,21,29)(H3,19,22,23,28)

Standard InChI Key:  AHKAPELWOPZKCD-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 30 33  0  0  0  0  0  0  0  0999 V2000
    8.3167   -8.9000    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    7.8917   -8.1917    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.0917   -8.3792    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.2917   -7.4667    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    9.1417   -8.8792    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.1167   -7.4625    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    9.5417   -8.1667    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    7.0167   -9.2000    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    7.7792   -9.5167    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5167   -6.0292    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.1167   -4.6542    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.9167   -5.4625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.3042   -5.8000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.4667   -7.8417    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5042   -5.0042    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.9125   -4.4292    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.6875   -8.1042    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.8917   -6.3750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.5625   -9.5917    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.6167   -7.0292    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.1125   -3.6292    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   10.3667   -8.1542    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.1292   -5.6917    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.6917   -7.1875    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.6917   -6.1417    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.0917   -7.5292    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.2917   -6.7250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2917   -7.7625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.6167   -8.8542    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
   10.7917   -8.8667    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  3  2  2  0
  4  2  1  0
  5  1  1  0
  6  7  1  0
  7  5  1  0
  8  9  2  0
  9  1  1  0
 10 13  2  0
 11 16  1  0
 12 10  1  0
 13 18  1  0
 14  3  1  0
 15 13  1  0
 16 15  2  0
 17 14  1  0
 18 24  2  0
 19  5  2  0
 20 14  2  0
 21 16  1  0
 22  7  1  0
 23 12  1  0
 24 28  1  0
 25 27  2  0
 26 17  1  0
 27 26  1  0
 28 26  2  0
 29 30  1  0
 30 22  1  0
  3  8  1  0
  6  4  2  0
 25 18  1  0
 12 11  2  0
M  END

Alternative Forms

  1. Parent:

    ALA284302

    ---

Associated Targets(non-human)

TLX-5 (157 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Biocomponents

Calculated Properties

Molecular Weight: 427.81Molecular Weight (Monoisotopic): 427.0908AlogP: 0.52#Rotatable Bonds: 5
Polar Surface Area: 166.21Molecular Species: NEUTRALHBA: 11HBD: 3
#RO5 Violations: 1HBA (Lipinski): 12HBD (Lipinski): 4#RO5 Violations (Lipinski): 1
CX Acidic pKa: 12.12CX Basic pKa: 2.73CX LogP: 2.87CX LogD: 2.87
Aromatic Rings: 4Heavy Atoms: 30QED Weighted: 0.38Np Likeness Score: -1.73

References

1. Clark AS, Deans B, Stevens MF, Tisdale MJ, Wheelhouse RT, Denny BJ, Hartley JA..  (1995)  Antitumor imidazotetrazines. 32. Synthesis of novel imidazotetrazinones and related bicyclic heterocycles to probe the mode of action of the antitumor drug temozolomide.,  38  (9): [PMID:7739008] [10.1021/jm00009a010]

Source