Diethyl-(2-{4-[3-(4-fluoro-phenyl)-7-methoxy-2H-chromen-4-yl]-phenoxy}-ethyl)-amine

ID: ALA284402

PubChem CID: 14521100

Max Phase: Preclinical

Molecular Formula: C28H30FNO3

Molecular Weight: 447.55

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CCN(CC)CCOc1ccc(C2=C(c3ccc(F)cc3)COc3cc(OC)ccc32)cc1

Standard InChI:  InChI=1S/C28H30FNO3/c1-4-30(5-2)16-17-32-23-12-8-21(9-13-23)28-25-15-14-24(31-3)18-27(25)33-19-26(28)20-6-10-22(29)11-7-20/h6-15,18H,4-5,16-17,19H2,1-3H3

Standard InChI Key:  MDQMJLICKBFTIX-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 33 36  0  0  0  0  0  0  0  0999 V2000
    1.6167   -1.3042    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1292   -1.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0917   -1.0042    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0917   -0.4042    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.6125   -0.0917    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.1292   -0.3917    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.6167   -1.9042    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.5750   -0.1042    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6542   -1.3000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.5750   -1.3042    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1292   -2.2000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.1000   -2.2042    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6625   -1.9000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.1750   -0.9917    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0542   -0.4042    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0542   -1.0042    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.7000   -1.8917    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.5917   -4.9042    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.6250   -3.1000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.1792   -2.1917    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6917   -1.2917    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.1042   -2.8042    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1417   -2.7917    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2167   -2.1917    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    1.6250   -3.7000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.4625   -0.1042    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.1042   -4.0042    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.1125   -4.6042    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0667   -4.6042    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.5917   -5.5042    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.4625    0.4958    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.4458   -4.9125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0792   -5.8042    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0
  3  1  1  0
  4  3  2  0
  5  4  1  0
  6  2  1  0
  7  1  1  0
  8  4  1  0
  9  2  1  0
 10  3  1  0
 11  7  1  0
 12  7  2  0
 13  9  2  0
 14  9  1  0
 15 16  1  0
 16 10  2  0
 17 21  1  0
 18 28  1  0
 19 22  2  0
 20 13  1  0
 21 14  2  0
 22 12  1  0
 23 11  2  0
 24 17  1  0
 25 19  1  0
 26 15  1  0
 27 25  1  0
 28 27  1  0
 29 18  1  0
 30 18  1  0
 31 26  1  0
 32 29  1  0
 33 30  1  0
  5  6  1  0
 23 19  1  0
 15  8  2  0
 17 20  2  0
M  END

Associated Targets(Human)

EBP Tchem Anti-estrogen binding site (AEBS) (124 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
ESR2 Tclin Estrogen receptor (3070 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 447.55Molecular Weight (Monoisotopic): 447.2210AlogP: 5.91#Rotatable Bonds: 9
Polar Surface Area: 30.93Molecular Species: BASEHBA: 4HBD:
#RO5 Violations: 1HBA (Lipinski): 4HBD (Lipinski): #RO5 Violations (Lipinski): 1
CX Acidic pKa: CX Basic pKa: 9.31CX LogP: 5.69CX LogD: 3.78
Aromatic Rings: 3Heavy Atoms: 33QED Weighted: 0.41Np Likeness Score: -0.48

References

1. Teo CC, Kon OL, Sim KY, Ng SC..  (1992)  Synthesis of 2-(p-chlorobenzyl)-3-aryl-6-methoxybenzofurans as selective ligands for antiestrogen-binding sites. Effects on cell proliferation and cholesterol synthesis.,  35  (8): [PMID:1573630] [10.1021/jm00086a002]

Source