The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
Diethyl-(2-{4-[3-(4-fluoro-phenyl)-7-methoxy-2H-chromen-4-yl]-phenoxy}-ethyl)-amine ID: ALA284402
PubChem CID: 14521100
Max Phase: Preclinical
Molecular Formula: C28H30FNO3
Molecular Weight: 447.55
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CCN(CC)CCOc1ccc(C2=C(c3ccc(F)cc3)COc3cc(OC)ccc32)cc1
Standard InChI: InChI=1S/C28H30FNO3/c1-4-30(5-2)16-17-32-23-12-8-21(9-13-23)28-25-15-14-24(31-3)18-27(25)33-19-26(28)20-6-10-22(29)11-7-20/h6-15,18H,4-5,16-17,19H2,1-3H3
Standard InChI Key: MDQMJLICKBFTIX-UHFFFAOYSA-N
Molfile:
RDKit 2D
33 36 0 0 0 0 0 0 0 0999 V2000
1.6167 -1.3042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1292 -1.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0917 -1.0042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0917 -0.4042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.6125 -0.0917 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.1292 -0.3917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.6167 -1.9042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.5750 -0.1042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6542 -1.3000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.5750 -1.3042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1292 -2.2000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.1000 -2.2042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6625 -1.9000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.1750 -0.9917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0542 -0.4042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0542 -1.0042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.7000 -1.8917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.5917 -4.9042 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.6250 -3.1000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.1792 -2.1917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.6917 -1.2917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.1042 -2.8042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1417 -2.7917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2167 -2.1917 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
1.6250 -3.7000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.4625 -0.1042 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.1042 -4.0042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.1125 -4.6042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0667 -4.6042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.5917 -5.5042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.4625 0.4958 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.4458 -4.9125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0792 -5.8042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 1 1 0
4 3 2 0
5 4 1 0
6 2 1 0
7 1 1 0
8 4 1 0
9 2 1 0
10 3 1 0
11 7 1 0
12 7 2 0
13 9 2 0
14 9 1 0
15 16 1 0
16 10 2 0
17 21 1 0
18 28 1 0
19 22 2 0
20 13 1 0
21 14 2 0
22 12 1 0
23 11 2 0
24 17 1 0
25 19 1 0
26 15 1 0
27 25 1 0
28 27 1 0
29 18 1 0
30 18 1 0
31 26 1 0
32 29 1 0
33 30 1 0
5 6 1 0
23 19 1 0
15 8 2 0
17 20 2 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 447.55Molecular Weight (Monoisotopic): 447.2210AlogP: 5.91#Rotatable Bonds: 9Polar Surface Area: 30.93Molecular Species: BASEHBA: 4HBD: ┄#RO5 Violations: 1HBA (Lipinski): 4HBD (Lipinski): ┄#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: 9.31CX LogP: 5.69CX LogD: 3.78Aromatic Rings: 3Heavy Atoms: 33QED Weighted: 0.41Np Likeness Score: -0.48
References 1. Teo CC, Kon OL, Sim KY, Ng SC.. (1992) Synthesis of 2-(p-chlorobenzyl)-3-aryl-6-methoxybenzofurans as selective ligands for antiestrogen-binding sites. Effects on cell proliferation and cholesterol synthesis., 35 (8): [PMID:1573630 ] [10.1021/jm00086a002 ]