The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
7-Fluoro-8-[4-(4-fluoro-phenyl)-piperazin-1-yl]-1-methyl-4-oxo-1,4-dihydro-benzo[b][1,8]naphthyridine-3-carboxylate(2-hydroxy-ethyl)-trimethyl-ammonium ID: ALA285128
PubChem CID: 9959323
Max Phase: Preclinical
Molecular Formula: C29H33F2N5O4
Molecular Weight: 450.45
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Synonyms: RP-60556A | CHEMBL285128|SCHEMBL7237451|JHXZFXLEIURCCI-UHFFFAOYSA-M|RP-60556A|choline 7-fluoro-8-[4-(4-fluorophenyl)piperazin-1-yl]-1-methyl-4-oxo-1,4-dihydrobenzo[b][1,8]naphthyridine-3-carboxylate
Canonical SMILES: C[N+](C)(C)CCO.Cn1cc(C(=O)[O-])c(=O)c2cc3cc(F)c(N4CCN(c5ccc(F)cc5)CC4)cc3nc21
Standard InChI: InChI=1S/C24H20F2N4O3.C5H14NO/c1-28-13-18(24(32)33)22(31)17-10-14-11-19(26)21(12-20(14)27-23(17)28)30-8-6-29(7-9-30)16-4-2-15(25)3-5-16;1-6(2,3)4-5-7/h2-5,10-13H,6-9H2,1H3,(H,32,33);7H,4-5H2,1-3H3/q;+1/p-1
Standard InChI Key: JHXZFXLEIURCCI-UHFFFAOYSA-M
Molfile:
RDKit 2D
40 43 0 0 0 0 0 0 0 0999 V2000
6.0792 -3.1792 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.2167 -2.7667 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.7917 -2.7667 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.0792 -4.0042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.3625 -2.7667 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.2792 -3.3917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.5042 -3.1792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.8042 0.6333 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.4417 0.6875 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.4125 -0.0917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1417 1.0583 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.0750 -0.5167 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.7667 -0.1542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.6750 -0.4542 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.5542 0.0083 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.9875 -0.0417 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.7417 1.1083 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.2500 -0.4042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.5375 1.0125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.8375 -0.3500 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-0.6333 -1.0875 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.0167 0.7458 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.5917 0.7958 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.3167 1.1583 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.3708 -1.4500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1750 1.8833 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.8042 -1.1375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.1292 0.0583 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.2292 0.5708 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.6000 -0.3042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0750 -1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.5750 1.8333 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.4250 -2.2625 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.0500 -0.9875 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.9000 1.2125 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
5.0375 -1.3000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.8458 -2.1667 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.1583 -2.6250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.7875 -1.3417 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.5833 -2.5292 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
2 7 1 0
3 1 1 0
4 1 1 0
5 1 1 0
6 1 1 0
7 3 1 0
9 11 1 0
10 12 1 0
11 8 1 0
12 13 1 0
13 8 2 0
14 10 2 0
15 18 2 0
16 14 1 0
17 9 2 0
18 16 1 0
19 8 1 0
20 15 1 0
21 31 1 0
22 17 1 0
23 24 2 0
24 22 1 0
25 21 1 0
26 11 2 0
27 20 1 0
28 20 1 0
29 19 1 0
30 28 1 0
31 27 1 0
32 19 2 0
33 25 1 0
34 25 2 0
35 23 1 0
36 12 1 0
37 38 1 0
38 33 2 0
39 34 1 0
40 37 1 0
10 9 1 0
16 22 2 0
15 23 1 0
30 21 1 0
39 37 2 0
M CHG 2 1 1 29 -1
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 450.45Molecular Weight (Monoisotopic): 450.1503AlogP: 3.39#Rotatable Bonds: 3Polar Surface Area: 78.67Molecular Species: ACIDHBA: 6HBD: 1#RO5 Violations: ┄HBA (Lipinski): 7HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: 5.71CX Basic pKa: 4.44CX LogP: 4.06CX LogD: 2.54Aromatic Rings: 4Heavy Atoms: 33QED Weighted: 0.48Np Likeness Score: -1.16
References 1. Tabart M, Picaut G, Lavergne M, Wentzler S, Malleron JL, Dutka-Malen S, Berthaud N.. (2003) Benzo[f]naphtyridones: a new family of topical antibacterial agents active on multi-resistant Gram-positive pathogens., 13 (7): [PMID:12657275 ] [10.1016/s0960-894x(03)00057-x ] 2. Tabart M, Picaut G, Desconclois JF, Dutka-Malen S, Huet Y, Berthaud N.. (2001) Synthesis and biological evaluation of benzo[b]naphthyridones, a series of new topical antibacterial agents., 11 (7): [PMID:11294391 ] [10.1016/s0960-894x(01)00091-9 ]