5-[(2R,3R,4S,5R,6R)-3,4-Bis-benzyloxy-5-(1H-imidazol-4-ylmethoxy)-6-methoxy-tetrahydro-pyran-2-ylmethoxy]-pentylamine

ID: ALA286241

PubChem CID: 10626248

Max Phase: Preclinical

Molecular Formula: C30H41N3O6

Molecular Weight: 539.67

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CO[C@@H]1O[C@H](COCCCCCN)[C@@H](OCc2ccccc2)[C@H](OCc2ccccc2)[C@H]1OCc1c[nH]cn1

Standard InChI:  InChI=1S/C30H41N3O6/c1-34-30-29(38-20-25-17-32-22-33-25)28(37-19-24-13-7-3-8-14-24)27(36-18-23-11-5-2-6-12-23)26(39-30)21-35-16-10-4-9-15-31/h2-3,5-8,11-14,17,22,26-30H,4,9-10,15-16,18-21,31H2,1H3,(H,32,33)/t26-,27-,28+,29-,30-/m1/s1

Standard InChI Key:  WUUCLDZFJSAYRC-CMPUJJQDSA-N

Molfile:  

     RDKit          2D

 39 42  0  0  1  0  0  0  0  0999 V2000
    1.5042   -1.6792    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.1000   -2.3917    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.5292   -3.1000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.7500   -2.3667    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.3292   -1.6625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.3542   -3.0875    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.3875    1.2208    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.0625    0.4583    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0792   -0.9667    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.2750   -2.4125    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.1375   -3.8250    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.0542    1.3333    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.7625    1.7583    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.2375    0.5333    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4792   -0.2500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.1500   -1.7042    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3125   -3.8417    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.7292   -0.9417    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.7875   -3.7917    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.3667   -5.8167    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0875   -4.5667    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.9750   -1.7167    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6125   -3.7750    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.5417   -5.8417    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5542   -0.9250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.0375   -4.4792    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.9125   -4.5792    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3417   -5.2667    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.3958   -1.0125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.3625   -2.4417    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.1125   -5.1375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.8542   -4.4542    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.2875   -5.1542    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.3083   -5.3042    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.2208   -1.0292    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1875   -2.4625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0500   -5.9875    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.8833   -6.0042    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.6208   -1.7542    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  3  2  1  0
  4  5  1  0
  5  1  1  0
  6  4  1  0
  7  8  1  0
  8 15  1  0
  1  9  1  1
  2 10  1  6
  3 11  1  1
 12 14  1  0
 13  7  2  0
 14  8  2  0
 15  9  1  0
 16 10  1  0
 17 11  1  0
  5 18  1  6
  6 19  1  6
 20 24  1  0
 21 17  1  0
 22 16  1  0
 23 19  1  0
 24 31  1  0
 25 18  1  0
 26 23  1  0
 27 21  2  0
 28 21  1  0
 29 22  2  0
 30 22  1  0
 31 33  1  0
 32 26  1  0
 33 32  1  0
 34 27  1  0
 35 29  1  0
 36 30  2  0
 37 28  2  0
 38 37  1  0
 39 36  1  0
  3  6  1  0
 13 12  1  0
 35 39  2  0
 34 38  2  0
M  END

Associated Targets(non-human)

Sstr3 Somatostatin receptor (42 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 539.67Molecular Weight (Monoisotopic): 539.2995AlogP: 3.98#Rotatable Bonds: 17
Polar Surface Area: 110.08Molecular Species: BASEHBA: 8HBD: 2
#RO5 Violations: 1HBA (Lipinski): 9HBD (Lipinski): 3#RO5 Violations (Lipinski): 1
CX Acidic pKa: 12.73CX Basic pKa: 10.20CX LogP: 3.64CX LogD: 1.02
Aromatic Rings: 3Heavy Atoms: 39QED Weighted: 0.25Np Likeness Score: 0.43

References

1. Hirschmann R, Hynes J, Cichy-Knight MA, van Rijn RD, Sprengeler PA, Spoors PG, Shakespeare WC, Pietranico-Cole S, Barbosa J, Liu J, Yao W, Rohrer S, Smith AB..  (1998)  Modulation of receptor and receptor subtype affinities using diastereomeric and enantiomeric monosaccharide scaffolds as a means to structural and biological diversity. A new route to ether synthesis.,  41  (9): [PMID:9554871] [10.1021/jm9800346]

Source