The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
5-{(2R,3S,5R,6R)-3-Benzyloxy-5-(1H-imidazol-4-ylmethoxy)-6-[2-(1H-indol-3-yl)-ethoxy]-tetrahydro-pyran-2-ylmethoxy}-pentylamine ID: ALA28824
PubChem CID: 10554930
Max Phase: Preclinical
Molecular Formula: C32H42N4O5
Molecular Weight: 562.71
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: NCCCCCOC[C@H]1O[C@@H](OCCc2c[nH]c3ccccc23)[C@H](OCc2c[nH]cn2)C[C@@H]1OCc1ccccc1
Standard InChI: InChI=1S/C32H42N4O5/c33-14-7-2-8-15-37-22-31-29(39-20-24-9-3-1-4-10-24)17-30(40-21-26-19-34-23-36-26)32(41-31)38-16-13-25-18-35-28-12-6-5-11-27(25)28/h1,3-6,9-12,18-19,23,29-32,35H,2,7-8,13-17,20-22,33H2,(H,34,36)/t29-,30+,31+,32+/m0/s1
Standard InChI Key: WOIHTIAABRGFIJ-SYEZAVJTSA-N
Molfile:
RDKit 2D
41 45 0 0 1 0 0 0 0 0999 V2000
4.2667 -2.0042 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.5542 0.6000 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.8417 -1.3042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7542 0.8875 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.7625 0.8458 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8667 -2.7292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5750 0.8208 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.2917 0.1708 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6167 -2.0375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.0167 -1.3167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.0417 -2.7417 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.7875 -0.4917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.2792 2.1208 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.5667 1.6958 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.5667 -0.2167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.9000 1.5750 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5917 -0.6125 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.6500 -3.4667 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.9917 0.1083 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2417 -0.5792 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.8250 -3.4792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.8792 -5.4542 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.4292 -4.2042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.4667 0.1583 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.3000 -3.4292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.0667 -0.5667 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1250 -3.4167 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.6292 -1.3000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.1875 -0.7542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.0542 -5.4792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.5500 -4.1167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.8542 -4.9042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.6042 -4.2167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.6292 -4.7792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.3667 -4.1000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.8042 -4.8000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.2542 -1.8417 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.0292 -1.5667 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4625 -5.6292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.2042 -4.9417 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.6292 -5.6500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 5 1 0
3 1 1 0
4 7 1 0
5 8 2 0
6 1 1 0
7 19 1 0
8 24 1 0
9 11 1 0
10 3 1 0
11 6 1 0
12 8 1 0
13 16 1 0
14 4 2 0
15 12 2 0
16 7 2 0
10 17 1 1
11 18 1 1
19 17 1 0
3 20 1 6
21 18 1 0
22 30 1 0
23 21 1 0
24 26 1 0
6 25 1 6
26 20 1 0
27 25 1 0
28 12 1 0
29 15 1 0
30 34 1 0
31 27 1 0
32 23 1 0
33 23 2 0
34 36 1 0
35 31 1 0
36 35 1 0
37 28 2 0
38 37 1 0
39 32 2 0
40 33 1 0
41 40 2 0
10 9 1 0
15 2 1 0
13 14 1 0
41 39 1 0
38 29 2 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 562.71Molecular Weight (Monoisotopic): 562.3155AlogP: 4.88#Rotatable Bonds: 17Polar Surface Area: 116.64Molecular Species: BASEHBA: 7HBD: 3#RO5 Violations: 1HBA (Lipinski): 9HBD (Lipinski): 4#RO5 Violations (Lipinski): 1CX Acidic pKa: 12.73CX Basic pKa: 10.20CX LogP: 4.08CX LogD: 1.46Aromatic Rings: 4Heavy Atoms: 41QED Weighted: 0.16Np Likeness Score: 0.48
References 1. Hirschmann R, Hynes J, Cichy-Knight MA, van Rijn RD, Sprengeler PA, Spoors PG, Shakespeare WC, Pietranico-Cole S, Barbosa J, Liu J, Yao W, Rohrer S, Smith AB.. (1998) Modulation of receptor and receptor subtype affinities using diastereomeric and enantiomeric monosaccharide scaffolds as a means to structural and biological diversity. A new route to ether synthesis., 41 (9): [PMID:9554871 ] [10.1021/jm9800346 ]