(E)-3-[4-((Z)-1,2-Diphenyl-but-1-enyl)-phenyl]-N-(3-hydroxy-propyl)-acrylamide

ID: ALA289612

PubChem CID: 9931443

Max Phase: Preclinical

Molecular Formula: C28H29NO2

Molecular Weight: 411.55

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CC/C(=C(\c1ccccc1)c1ccc(/C=C/C(=O)NCCCO)cc1)c1ccccc1

Standard InChI:  InChI=1S/C28H29NO2/c1-2-26(23-10-5-3-6-11-23)28(24-12-7-4-8-13-24)25-17-14-22(15-18-25)16-19-27(31)29-20-9-21-30/h3-8,10-19,30H,2,9,20-21H2,1H3,(H,29,31)/b19-16+,28-26-

Standard InChI Key:  JRGBOADWPVFNEG-ZIKUKRDVSA-N

Molfile:  

     RDKit          2D

 31 33  0  0  0  0  0  0  0  0999 V2000
    4.0917   -4.7042    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.8125   -5.1125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.7917   -0.1667    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.7917   -0.9917    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.0917   -3.8792    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.0792   -1.4042    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.3792   -5.1167    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.5250   -4.7000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.0750    0.2458    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.3792   -3.4750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.8042   -3.4667    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.5042    0.2500    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.0875   -2.2292    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.3667   -2.6542    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.8042   -2.6417    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.8125   -5.9375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.2167   -0.9917    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.9375   -2.2292    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.2167   -0.1542    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.9375   -1.4042    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6667   -4.7042    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.2375   -5.1125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.5167   -3.8792    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.3792   -5.9500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.5292   -6.3500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.2250   -3.4625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.9542   -5.1250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6667   -6.3625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.9500   -4.6917    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.9542   -5.9500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.9500   -3.8667    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0
  3  4  1  0
  4  6  2  0
  5  1  1  0
  6 13  1  0
  7  1  1  0
  8  2  1  0
  9  3  2  0
 10  5  1  0
 11  5  2  0
 12  3  1  0
 13 15  2  0
 14 10  2  0
 15 11  1  0
 16  2  1  0
 17 19  1  0
 18 20  1  0
 19 12  1  0
 20 17  1  0
 21  7  2  0
 22  8  2  0
 23  8  1  0
 24  7  1  0
 25 16  1  0
 26 23  2  0
 27 21  1  0
 28 24  2  0
 29 22  1  0
 30 28  1  0
 31 26  1  0
 13 14  1  0
 30 27  2  0
 31 29  2  0
M  END

Associated Targets(Human)

Ishikawa (877 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 411.55Molecular Weight (Monoisotopic): 411.2198AlogP: 5.57#Rotatable Bonds: 9
Polar Surface Area: 49.33Molecular Species: NEUTRALHBA: 2HBD: 2
#RO5 Violations: 1HBA (Lipinski): 3HBD (Lipinski): 2#RO5 Violations (Lipinski): 1
CX Acidic pKa: CX Basic pKa: CX LogP: 5.44CX LogD: 5.44
Aromatic Rings: 3Heavy Atoms: 31QED Weighted: 0.27Np Likeness Score: 0.03

References

1. Willson TM, Henke BR, Momtahen TM, Charifson PS, Batchelor KW, Lubahn DB, Moore LB, Oliver BB, Sauls HR, Triantafillou JA..  (1994)  3-[4-(1,2-Diphenylbut-1-enyl)phenyl]acrylic acid: a non-steroidal estrogen with functional selectivity for bone over uterus in rats.,  37  (11): [PMID:8201587] [10.1021/jm00037a002]

Source