The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(4R,5S,6S)-3-(Azetidine-1-carbothioylsulfanyl)-6-((R)-1-hydroxy-ethyl)-4-methyl-7-oxo-1-aza-bicyclo[3.2.0]hept-2-ene-2-carboxylic acid ID: ALA289874
PubChem CID: 15545616
Max Phase: Preclinical
Molecular Formula: C14H18N2O4S2
Molecular Weight: 342.44
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: C[C@@H](O)[C@H]1C(=O)N2C(C(=O)O)=C(SC(=S)N3CCC3)[C@H](C)[C@H]12
Standard InChI: InChI=1S/C14H18N2O4S2/c1-6-9-8(7(2)17)12(18)16(9)10(13(19)20)11(6)22-14(21)15-4-3-5-15/h6-9,17H,3-5H2,1-2H3,(H,19,20)/t6-,7-,8-,9-/m1/s1
Standard InChI Key: VOCZQABNHBFHGI-FNCVBFRFSA-N
Molfile:
RDKit 2D
24 26 0 0 1 0 0 0 0 0999 V2000
1.5125 -8.5917 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.3542 -8.8667 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8667 -8.1500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.6250 -8.6000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.5042 -7.7125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.6250 -7.7125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.3417 -7.4375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.1875 -7.3750 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.7500 -8.1417 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
2.6292 -9.7042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.0667 -7.3667 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 -9.2167 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.7417 -6.6125 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 -7.0917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.4917 -9.8792 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.0417 -10.3625 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.3167 -7.3625 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6125 -6.5917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.6917 -7.9917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.6875 -6.7417 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.2250 -6.2375 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.8583 -7.3167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.6167 -6.8292 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
1.5000 -6.8292 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 0
3 2 2 0
4 1 1 0
5 1 1 0
6 5 1 0
7 5 1 0
8 9 1 0
9 3 1 0
10 2 1 0
11 8 1 0
12 4 2 0
13 8 2 0
14 6 1 0
15 10 2 0
16 10 1 0
17 20 1 0
7 18 1 1
19 11 1 0
20 11 1 0
14 21 1 1
22 14 1 0
6 23 1 1
5 24 1 6
3 7 1 0
6 4 1 0
19 17 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 342.44Molecular Weight (Monoisotopic): 342.0708AlogP: 0.86#Rotatable Bonds: 3Polar Surface Area: 81.08Molecular Species: ACIDHBA: 5HBD: 2#RO5 Violations: ┄HBA (Lipinski): 6HBD (Lipinski): 2#RO5 Violations (Lipinski): ┄CX Acidic pKa: 2.71CX Basic pKa: ┄CX LogP: -0.16CX LogD: -3.66Aromatic Rings: ┄Heavy Atoms: 22QED Weighted: 0.58Np Likeness Score: 0.17
References 1. Ohtake N, Imamura H, Kiyonaga H, Jona H, Ogawa M, Okada S, Shimizu A, Moriya M, Sato H, Tominaga Y, Yamada K, Nakano M, Ushijima R, Nakagawa S. (1997) Novel dithiocarbamate carbapenems1 with anti-MRSA activity, 7 (13): [10.1016/S0960-894X(97)00272-2 ]