2-Cyclopropyl-3-[2'-(1H-tetrazol-5-yl)-biphenyl-4-ylmethyl]-3,5-dihydro-imidazo[4,5-c]pyridin-4-one

ID: ALA290907

PubChem CID: 10001550

Max Phase: Preclinical

Molecular Formula: C23H19N7O

Molecular Weight: 409.45

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  Oc1nccc2nc(C3CC3)n(Cc3ccc(-c4ccccc4-c4nn[nH]n4)cc3)c12

Standard InChI:  InChI=1S/C23H19N7O/c31-23-20-19(11-12-24-23)25-22(16-9-10-16)30(20)13-14-5-7-15(8-6-14)17-3-1-2-4-18(17)21-26-28-29-27-21/h1-8,11-12,16H,9-10,13H2,(H,24,31)(H,26,27,28,29)

Standard InChI Key:  MXXUSTMMIFYSEU-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 31 36  0  0  0  0  0  0  0  0999 V2000
   -0.7833    1.2458    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -0.2083    1.4250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.1375    1.7333    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7833    2.2208    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -0.2083    2.0333    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.6208   -1.2625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.3625   -0.6292    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -2.7625   -0.6792    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5958   -1.1792    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.3042    1.1250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.1375   -1.5750    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7375    1.7333    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1583   -1.6417    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.5958   -1.4292    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3042    2.3333    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.8250    1.4250    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -2.2625    2.0333    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.2625    1.4333    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.3083    0.9458    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.8250    2.0250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.5000   -0.8292    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3042    0.5250    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.9708   -0.4542    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.9375   -0.6167    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.3083    0.3458    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.8708    0.1375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.8458   -0.0250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.2500   -2.2292    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.1333   -1.8042    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2208   -2.3917    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7833   -2.6125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  3  1  1  0
  4  3  2  0
  5  2  2  0
  6 13  1  0
  7  8  2  0
  8  6  1  0
  9 11  1  0
 10  2  1  0
 11  6  2  0
 12  3  1  0
 13 14  2  0
 14 21  1  0
 15  5  1  0
 16 10  2  0
 17 12  1  0
 18 12  1  0
 19  1  1  0
 20 16  1  0
 21 24  2  0
 22 10  1  0
 23 26  2  0
 24 27  1  0
 25 19  1  0
 26 25  1  0
 27 25  2  0
 28 13  1  0
 29 14  1  0
 30 29  2  0
 31 30  1  0
  5  4  1  0
 18 17  1  0
 23 21  1  0
 20 15  2  0
 28 31  2  0
  7  9  1  0
M  END

Associated Targets(Human)

AGTR1 Tclin Angiotensin II receptor (1039 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Associated Targets(non-human)

Agtr1b Angiotensin II receptor (AT-1) type-1 (1480 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Biocomponents

Calculated Properties

Molecular Weight: 409.45Molecular Weight (Monoisotopic): 409.1651AlogP: 3.91#Rotatable Bonds: 5
Polar Surface Area: 105.40Molecular Species: ACIDHBA: 7HBD: 2
#RO5 Violations: HBA (Lipinski): 8HBD (Lipinski): 2#RO5 Violations (Lipinski):
CX Acidic pKa: 5.85CX Basic pKa: 4.05CX LogP: 4.84CX LogD: 3.67
Aromatic Rings: 5Heavy Atoms: 31QED Weighted: 0.46Np Likeness Score: -0.93

References

1. Mederski WW, Dorsch D, Bokel HH, Beier N, Lues I, Schelling P..  (1994)  Non-peptide angiotensin II receptor antagonists: synthesis and biological activity of a series of novel 4,5-dihydro-4-oxo-3H-imidazo[4,5-c]pyridine derivatives.,  37  (11): [PMID:8201597] [10.1021/jm00037a014]
2. Sharma MC, Kohli DV.  (2013)  A comprehensive structureactivity analysis 2,3,5-trisubstituted 4,5-dihydro-4-oxo-3H-imidazo [4,5-c] pyridine derivatives as angiotensin II receptor antagonists: using 2D- and 3D-QSAR approach,  22  (2): [10.1007/s00044-012-0040-z]

Source