5-((2S,4S,5R,6R)-4,5-Bis-benzyloxy-6-methoxy-tetrahydro-pyran-2-ylmethoxy)-pentylamine

ID: ALA29235

PubChem CID: 9980863

Max Phase: Preclinical

Molecular Formula: C26H37NO5

Molecular Weight: 443.58

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CO[C@@H]1O[C@H](COCCCCCN)C[C@H](OCc2ccccc2)[C@H]1OCc1ccccc1

Standard InChI:  InChI=1S/C26H37NO5/c1-28-26-25(31-19-22-13-7-3-8-14-22)24(30-18-21-11-5-2-6-12-21)17-23(32-26)20-29-16-10-4-9-15-27/h2-3,5-8,11-14,23-26H,4,9-10,15-20,27H2,1H3/t23-,24-,25+,26+/m0/s1

Standard InChI Key:  RCABMNLPWDPLKS-QEGGNFSNSA-N

Molfile:  

     RDKit          2D

 32 34  0  0  1  0  0  0  0  0999 V2000
    2.0000   -1.1000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.0250   -1.9250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.7417   -2.3167    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.7042   -0.6750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2750   -0.7042    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.4292   -1.0667    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6875    0.1500    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.4417   -1.8917    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2542    0.1208    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.3167   -2.3542    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.3917    0.5833    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.4250   -6.7667    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.5292    0.5208    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.3750    1.4083    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.1917   -3.1042    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.1667   -2.2875    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.4042   -5.9417    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.5917   -1.9625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.9167   -3.5042    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.1708    0.0833    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.0792    1.8333    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6542    1.7958    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.5125    1.3375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.6792   -5.5500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.9292   -4.3292    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.6542   -4.7250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.8958    0.4750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.0667    2.6500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6292    2.6208    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.2083    1.7333    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.9125    1.3083    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.3417    3.0500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  3  2  1  0
  4  1  1  0
  1  5  1  6
  6  4  1  0
  4  7  1  1
  8  6  1  0
  9  5  1  0
  2 10  1  1
 11  7  1  0
 12 17  1  0
 13  9  1  0
 14 11  1  0
 15 16  1  0
  8 16  1  1
 17 24  1  0
 18 10  1  0
 19 15  1  0
 20 13  1  0
 21 14  2  0
 22 14  1  0
 23 13  2  0
 24 26  1  0
 25 19  1  0
 26 25  1  0
 27 20  2  0
 28 21  1  0
 29 22  2  0
 30 23  1  0
 31 30  2  0
 32 29  1  0
  3  8  1  0
 31 27  1  0
 28 32  2  0
M  END

Associated Targets(non-human)

Sstr3 Somatostatin receptor (42 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 443.58Molecular Weight (Monoisotopic): 443.2672AlogP: 4.06#Rotatable Bonds: 14
Polar Surface Area: 72.17Molecular Species: BASEHBA: 6HBD: 1
#RO5 Violations: HBA (Lipinski): 6HBD (Lipinski): 2#RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 10.21CX LogP: 4.00CX LogD: 1.40
Aromatic Rings: 2Heavy Atoms: 32QED Weighted: 0.44Np Likeness Score: 0.71

References

1. Hirschmann R, Hynes J, Cichy-Knight MA, van Rijn RD, Sprengeler PA, Spoors PG, Shakespeare WC, Pietranico-Cole S, Barbosa J, Liu J, Yao W, Rohrer S, Smith AB..  (1998)  Modulation of receptor and receptor subtype affinities using diastereomeric and enantiomeric monosaccharide scaffolds as a means to structural and biological diversity. A new route to ether synthesis.,  41  (9): [PMID:9554871] [10.1021/jm9800346]

Source