The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2-Hydroxy-N-[3-(hydroxy-oct-2-enoyl-amino)-propyl]-2-{[3-(hydroxy-oct-2-enoyl-amino)-propylcarbamoyl]-methyl}-succinamic acid tert-butyl ester ID: ALA293172
PubChem CID: 10794205
Max Phase: Preclinical
Molecular Formula: C32H56N4O9
Molecular Weight: 640.82
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: CCCCC/C=C/C(=O)N(O)CCCNC(=O)CC(O)(CC(=O)NCCCN(O)C(=O)/C=C/CCCCC)C(=O)OC(C)(C)C
Standard InChI: InChI=1S/C32H56N4O9/c1-6-8-10-12-14-18-28(39)35(43)22-16-20-33-26(37)24-32(42,30(41)45-31(3,4)5)25-27(38)34-21-17-23-36(44)29(40)19-15-13-11-9-7-2/h14-15,18-19,42-44H,6-13,16-17,20-25H2,1-5H3,(H,33,37)(H,34,38)/b18-14+,19-15+
Standard InChI Key: XPQACTZLMOTDSL-JSAVKQRWSA-N
Molfile:
RDKit 2D
45 44 0 0 0 0 0 0 0 0999 V2000
6.1875 -3.7167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.1792 -4.5375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.9042 -3.3042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.4750 -3.3042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.1792 -2.4792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.1875 -2.4750 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.6167 -3.7167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.7542 -3.7167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.8917 -4.9542 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.1875 -3.3042 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
11.1917 -3.3042 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
10.4667 -2.0625 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.8917 -2.0542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.4625 -4.9417 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.4625 -2.0667 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.8917 -2.0542 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.8875 -5.7792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.6167 -4.5417 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.7542 -4.5417 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.8875 -1.2292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.4542 -1.2375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.0417 -3.3042 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.3292 -3.3042 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.1792 -2.8875 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.9042 -3.7167 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.6000 -3.8875 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.6167 -3.3042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.7625 -3.3042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.9042 -3.7167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.4750 -3.7167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.3292 -3.7167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.0417 -3.7167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5917 -0.8167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.7417 -0.8292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.1667 -6.1875 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.6000 -6.1917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.8792 -6.6042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.0292 -1.2417 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.3167 -1.2250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.6042 -1.2542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.7417 -1.2125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.0250 -0.8042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.3167 -0.8375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.4542 -0.7917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.8875 -0.8417 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 0
3 1 1 0
4 1 1 0
5 10 1 0
6 11 1 0
7 3 1 0
8 4 1 0
9 2 1 0
10 29 1 0
11 30 1 0
12 6 1 0
13 5 1 0
14 2 2 0
15 5 2 0
16 6 2 0
17 9 1 0
18 7 2 0
19 8 2 0
20 13 2 0
21 12 2 0
22 8 1 0
23 7 1 0
24 1 1 0
25 11 1 0
26 10 1 0
27 31 1 0
28 32 1 0
29 27 1 0
30 28 1 0
31 22 1 0
32 23 1 0
33 20 1 0
34 21 1 0
35 17 1 0
36 17 1 0
37 17 1 0
38 34 1 0
39 33 1 0
40 43 1 0
41 42 1 0
42 39 1 0
43 38 1 0
44 41 1 0
45 40 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 640.82Molecular Weight (Monoisotopic): 640.4047AlogP: 3.56#Rotatable Bonds: 23Polar Surface Area: 185.81Molecular Species: NEUTRALHBA: 9HBD: 5#RO5 Violations: 1HBA (Lipinski): 13HBD (Lipinski): 5#RO5 Violations (Lipinski): 2CX Acidic pKa: 8.51CX Basic pKa: ┄CX LogP: 2.71CX LogD: 2.68Aromatic Rings: ┄Heavy Atoms: 45QED Weighted: 0.04Np Likeness Score: 0.21
References 1. Guo H, Naser SA, Ghobrial G, Phanstiel O.. (2002) Synthesis and biological evaluation of new citrate-based siderophores as potential probes for the mechanism of iron uptake in mycobacteria., 45 (10): [PMID:11985473 ] [10.1021/jm0104522 ]