The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2,3,5,6-Tetramethyl-terephthalic acid mono-[(S)-3-((S)-2-benzyloxycarbonylamino-3-phenyl-propionylamino)-2-oxo-butyl] ester ID: ALA293581
PubChem CID: 10031289
Max Phase: Preclinical
Molecular Formula: C33H36N2O8
Molecular Weight: 588.66
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: Cc1c(C)c(C(=O)OCC(=O)[C@H](C)NC(=O)[C@H](Cc2ccccc2)NC(=O)OCc2ccccc2)c(C)c(C)c1C(=O)O
Standard InChI: InChI=1S/C33H36N2O8/c1-19-21(3)29(22(4)20(2)28(19)31(38)39)32(40)42-18-27(36)23(5)34-30(37)26(16-24-12-8-6-9-13-24)35-33(41)43-17-25-14-10-7-11-15-25/h6-15,23,26H,16-18H2,1-5H3,(H,34,37)(H,35,41)(H,38,39)/t23-,26-/m0/s1
Standard InChI Key: FRWIHAGJDZJUAP-OZXSUGGESA-N
Molfile:
RDKit 2D
43 45 0 0 1 0 0 0 0 0999 V2000
5.2542 -8.3542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.5292 -9.4000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.7625 -9.6917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1167 -9.1667 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.6625 -8.5792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.0167 -8.0625 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1750 -5.0750 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.6167 -7.8375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8875 -5.4917 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.7292 -4.3042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.1750 -9.9167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1875 -4.2500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4417 -3.8917 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.2375 -5.6875 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.6625 -5.1167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.7417 -7.0167 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.4542 -5.4750 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.1042 -6.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.9500 -3.9042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7292 -5.1292 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.8417 -8.1292 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.0417 -10.7292 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.0167 -3.8917 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.9625 -5.3292 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.9417 -9.6250 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.4292 -8.2792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.6292 -10.5042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.1500 -7.2417 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.3500 -9.4625 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.7000 -4.3042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8792 -3.0792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.4125 -3.8917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.7917 -4.3042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5667 -2.6042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1292 -2.7167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.4083 -3.0667 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.1208 -4.3042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.0625 -1.8917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.1208 -2.6542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.8333 -3.8917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5000 -1.7750 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.7500 -1.4167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.8375 -3.0667 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 5 1 0
3 4 1 0
4 1 2 0
5 6 2 0
6 1 1 0
7 9 1 0
8 1 1 0
9 15 1 0
10 13 1 0
11 2 1 0
12 7 1 0
13 12 1 0
14 18 1 0
15 14 1 0
16 8 1 0
17 7 2 0
18 16 1 0
12 19 1 1
20 10 2 0
21 8 2 0
22 11 2 0
23 10 1 0
24 14 2 0
25 11 1 0
26 5 1 0
27 3 1 0
28 6 1 0
29 4 1 0
30 23 1 0
31 19 1 0
32 30 1 0
15 33 1 1
34 31 2 0
35 31 1 0
36 32 2 0
37 32 1 0
38 35 2 0
39 36 1 0
40 37 2 0
41 34 1 0
42 38 1 0
43 40 1 0
2 3 2 0
41 42 2 0
43 39 2 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 588.66Molecular Weight (Monoisotopic): 588.2472AlogP: 4.39#Rotatable Bonds: 12Polar Surface Area: 148.10Molecular Species: ACIDHBA: 7HBD: 3#RO5 Violations: 1HBA (Lipinski): 10HBD (Lipinski): 3#RO5 Violations (Lipinski): 1CX Acidic pKa: 3.38CX Basic pKa: ┄CX LogP: 6.42CX LogD: 3.01Aromatic Rings: 3Heavy Atoms: 43QED Weighted: 0.26Np Likeness Score: -0.12
References 1. Wagner BM, Smith RA, Coles PJ, Copp LJ, Ernest MJ, Krantz A.. (1994) In vivo inhibition of cathepsin B by peptidyl (acyloxy)methyl ketones., 37 (12): [PMID:8021922 ] [10.1021/jm00038a012 ]