The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2-{4-[(2-Amino-4-oxo-3,4-dihydro-pyrido[2,3-d]pyrimidin-6-ylmethyl)-amino]-benzoylamino}-4-(ethoxy-hydroxy-phosphoryl)-butyric acid ID: ALA294973
PubChem CID: 136046154
Max Phase: Preclinical
Molecular Formula: C21H25N6O7P
Molecular Weight: 504.44
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CCOP(=O)(O)CCC(NC(=O)c1ccc(NCc2cnc3nc(N)nc(O)c3c2)cc1)C(=O)O
Standard InChI: InChI=1S/C21H25N6O7P/c1-2-34-35(32,33)8-7-16(20(30)31)25-18(28)13-3-5-14(6-4-13)23-10-12-9-15-17(24-11-12)26-21(22)27-19(15)29/h3-6,9,11,16,23H,2,7-8,10H2,1H3,(H,25,28)(H,30,31)(H,32,33)(H3,22,24,26,27,29)
Standard InChI Key: FBRKPFQSNPGVGM-UHFFFAOYSA-N
Molfile:
RDKit 2D
35 37 0 0 0 0 0 0 0 0999 V2000
0.7000 -2.3375 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.1792 -1.4375 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.2167 -2.0292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7000 -1.1292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2167 -1.4292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.1792 -2.0375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.9667 -0.4792 0.0000 P 0 0 0 0 0 0 0 0 0 0 0 0
5.3667 -0.2042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7417 -2.3292 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.8875 -0.5000 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.4000 0.4083 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4042 -0.1917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7375 -1.1292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.8417 -0.5042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.6917 -0.5292 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.9250 -0.4917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7417 -1.0375 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.3542 0.3958 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.2542 -1.4250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.4417 -0.1875 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.9167 0.7083 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.3375 -2.3375 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.3000 -1.4167 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.2542 -2.0292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.5417 -0.6292 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.3167 -0.2125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.8500 -1.1042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.1917 0.0750 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.8167 -1.1125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.7750 -1.1167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.8750 0.7000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.8042 -0.5167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.3292 -1.4125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.8167 0.5500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.0417 1.1083 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 6 2 0
3 1 2 0
4 2 1 0
5 3 1 0
6 1 1 0
7 20 1 0
8 14 1 0
9 3 1 0
10 8 1 0
11 12 1 0
12 10 1 0
13 5 1 0
14 27 2 0
15 4 1 0
16 12 1 0
17 7 2 0
18 8 2 0
19 24 1 0
20 16 1 0
21 11 2 0
22 6 1 0
23 30 1 0
24 9 2 0
25 7 1 0
26 32 2 0
27 33 1 0
28 7 1 0
29 23 1 0
30 19 1 0
31 11 1 0
32 29 1 0
33 29 2 0
34 28 1 0
35 34 1 0
4 5 2 0
13 19 2 0
26 14 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 504.44Molecular Weight (Monoisotopic): 504.1522AlogP: 1.72#Rotatable Bonds: 11Polar Surface Area: 209.88Molecular Species: ACIDHBA: 10HBD: 6#RO5 Violations: 2HBA (Lipinski): 13HBD (Lipinski): 7#RO5 Violations (Lipinski): 3CX Acidic pKa: 1.86CX Basic pKa: 2.74CX LogP: -0.66CX LogD: -5.27Aromatic Rings: 3Heavy Atoms: 35QED Weighted: 0.21Np Likeness Score: -0.48
References 1. Rosowsky A, Forsch RA, Reich VE, Freisheim JH, Moran RG.. (1992) Side chain modified 5-deazafolate and 5-deazatetrahydrofolate analogues as mammalian folylpolyglutamate synthetase and glycinamide ribonucleotide formyltransferase inhibitors: synthesis and in vitro biological evaluation., 35 (9): [PMID:1578484 ] [10.1021/jm00087a012 ]