8-ethoxy-7-formyl-3-hydroxy-10-isopropenyl-3-methyl-17-oxo-(1R,10S,12S)-14,16,18-trioxatetracyclo[11.2.2.15,8.013,15]octadeca-4,6-dien-12-yl acetate

ID: ALA296630

PubChem CID: 44296113

Max Phase: Preclinical

Molecular Formula: C24H30O9

Molecular Weight: 462.50

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  C=C(C)[C@H]1C[C@H](OC(C)=O)[C@@]23O[C@@H]2[C@@H](C[C@](C)(O)/C=C2/C=C(C=O)C(OCC)(C1)O2)OC3=O

Standard InChI:  InChI=1S/C24H30O9/c1-6-29-23-9-15(13(2)3)7-19(30-14(4)26)24-20(33-24)18(31-21(24)27)11-22(5,28)10-17(32-23)8-16(23)12-25/h8,10,12,15,18-20,28H,2,6-7,9,11H2,1,3-5H3/b17-10-/t15-,18+,19-,20+,22+,23?,24+/m0/s1

Standard InChI Key:  JAYRBXGJZSQPST-QXQIGULQSA-N

Molfile:  

     RDKit          2D

 35 38  0  0  1  0  0  0  0  0999 V2000
    1.2375   -4.8250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.8292   -4.4042    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4042   -4.2500    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.1042   -5.3292    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.3000   -3.0042    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.1167   -2.4167    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3417   -4.7417    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.8292   -4.7417    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.5292   -5.3292    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.3417   -2.9542    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.8292   -3.3417    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.5542   -2.4167    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.2208   -3.2542    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.8667   -3.1542    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1417   -3.6750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.1500   -3.8875    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.2083   -4.5417    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.8292   -4.1125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.2875   -5.1375    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.7500   -3.6750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4250   -5.6917    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.8667   -5.2917    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4542   -1.9375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2875   -4.8625    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.7167   -2.5792    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.0417   -3.1542    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.0542   -1.9917    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.4500   -3.8875    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.6792   -3.8875    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.0667   -4.1917    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.0167   -5.8667    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.3000   -2.7292    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.7167   -2.3000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3794   -5.4346    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    1.2495   -5.3116    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  1  3  1  1
  4  1  1  0
  5 14  1  0
  6  5  1  0
  7  2  1  0
  8  1  1  0
  9  4  1  0
 10 13  2  0
 11  5  1  0
 12  6  2  0
 13 16  1  0
 14 15  1  0
 15 18  1  0
 16 17  1  0
 17  7  1  0
 18  8  1  0
  8 19  1  6
 15 20  1  1
 21  4  2  0
 22 19  1  0
 23  6  1  0
 24 22  2  0
 25  5  1  0
 26 20  2  0
 27 23  2  0
 16 28  1  1
 29 16  1  0
 30 20  1  0
 31 22  1  0
 32 25  1  0
 33 32  1  0
  2  3  1  0
  7  9  1  0
 10 11  1  0
 10 12  1  0
  7 34  1  1
  2 35  1  6
M  END

Associated Targets(non-human)

CHRNA1 Acetylcholine receptor (120 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Biocomponents

Calculated Properties

Molecular Weight: 462.50Molecular Weight (Monoisotopic): 462.1890AlogP: 1.88#Rotatable Bonds: 5
Polar Surface Area: 120.89Molecular Species: NEUTRALHBA: 9HBD: 1
#RO5 Violations: HBA (Lipinski): 9HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: CX LogP: 1.10CX LogD: 1.10
Aromatic Rings: Heavy Atoms: 33QED Weighted: 0.28Np Likeness Score: 2.65

References

1. Abramson SN, Trischman JA, Tapiolas DM, Harold EE, Fenical W, Taylor P..  (1991)  Structure/activity and molecular modeling studies of the lophotoxin family of irreversible nicotinic receptor antagonists.,  34  (6): [PMID:1676426] [10.1021/jm00110a007]

Source