2-Butyl-5-ethyl-3-[2'-(1H-tetrazol-5-yl)-biphenyl-4-ylmethyl]-3,5-dihydro-imidazo[4,5-c]pyridin-4-one

ID: ALA298464

PubChem CID: 10456587

Max Phase: Preclinical

Molecular Formula: C26H27N7O

Molecular Weight: 453.55

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CCCCc1nc2ccn(CC)c(=O)c2n1Cc1ccc(-c2ccccc2-c2nn[nH]n2)cc1

Standard InChI:  InChI=1S/C26H27N7O/c1-3-5-10-23-27-22-15-16-32(4-2)26(34)24(22)33(23)17-18-11-13-19(14-12-18)20-8-6-7-9-21(20)25-28-30-31-29-25/h6-9,11-16H,3-5,10,17H2,1-2H3,(H,28,29,30,31)

Standard InChI Key:  YQXLJCKCRTVBBJ-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 34 38  0  0  0  0  0  0  0  0999 V2000
   -0.3833    3.6833    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.9583    3.4958    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3833    4.2792    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.9583    4.4667    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.1292    3.3833    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.3083    3.9833    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.7958    0.9958    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5333    1.6250    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -2.9333    1.5750    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -3.7625    1.0708    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.6542    3.6833    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.1292    4.5875    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.3083    0.6833    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -2.3250    0.6125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.6542    4.2792    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7708    0.8250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4750    3.2083    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.6708    1.4208    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.1292    2.7833    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.1083    1.6375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1375    1.8000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4833    2.6000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.9083    3.9833    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.0458    2.3958    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0208    2.2333    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2542    3.6833    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4208    0.0208    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.3000    0.4500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.2083    4.5042    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.5542    4.2000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8083    4.5042    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.3958   -0.1417    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.9583   -0.3542    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.1083    5.0167    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  3  1  2  0
  4  3  1  0
  5  1  1  0
  6  2  1  0
  7 14  1  0
  8  9  2  0
  9  7  1  0
 10 13  1  0
 11  5  1  0
 12  3  1  0
 13  7  2  0
 14 16  2  0
 15 11  1  0
 16 18  1  0
 17  2  1  0
 18 20  2  0
 19  5  2  0
 20 25  1  0
 21 24  2  0
 22 17  1  0
 23  6  1  0
 24 22  1  0
 25 22  2  0
 26 11  1  0
 27 14  1  0
 28 16  1  0
 29 23  1  0
 30 26  1  0
 31 29  1  0
 32 28  2  0
 33 32  1  0
 34 31  1  0
  4  6  2  0
 15 12  2  0
 21 18  1  0
 27 33  2  0
  8 10  1  0
M  END

Associated Targets(Human)

AGTR1 Tclin Angiotensin II receptor (1039 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Associated Targets(non-human)

Agtr1b Angiotensin II receptor (AT-1) type-1 (1480 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Biocomponents

Calculated Properties

Molecular Weight: 453.55Molecular Weight (Monoisotopic): 453.2277AlogP: 4.46#Rotatable Bonds: 8
Polar Surface Area: 94.28Molecular Species: ACIDHBA: 7HBD: 1
#RO5 Violations: HBA (Lipinski): 8HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: 5.85CX Basic pKa: 1.86CX LogP: 5.37CX LogD: 4.11
Aromatic Rings: 5Heavy Atoms: 34QED Weighted: 0.37Np Likeness Score: -1.20

References

1. Mederski WW, Dorsch D, Bokel HH, Beier N, Lues I, Schelling P..  (1994)  Non-peptide angiotensin II receptor antagonists: synthesis and biological activity of a series of novel 4,5-dihydro-4-oxo-3H-imidazo[4,5-c]pyridine derivatives.,  37  (11): [PMID:8201597] [10.1021/jm00037a014]
2. Sharma MC, Kohli DV.  (2013)  A comprehensive structureactivity analysis 2,3,5-trisubstituted 4,5-dihydro-4-oxo-3H-imidazo [4,5-c] pyridine derivatives as angiotensin II receptor antagonists: using 2D- and 3D-QSAR approach,  22  (2): [10.1007/s00044-012-0040-z]

Source