4-isopropenyl-7,12-dimethyl-2-methylcarbonyloxy-17-oxo-(2S,4R,5R,12R,14R)-11,16,18,19-tetraoxapentacyclo[12.2.2.16,9.01,15.010,12]nonadeca-6,8-dien-5-yl acetate (Bipinnatin-F)

ID: ALA298801

PubChem CID: 44296326

Max Phase: Preclinical

Molecular Formula: C24H28O9

Molecular Weight: 460.48

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Synonyms: Bipinnatin-F | Bipinnatin-F|CHEMBL298801

Canonical SMILES:  C=C(C)[C@H]1C[C@H](OC(C)=O)[C@@]23O[C@@H]2[C@@H](C[C@]2(C)O[C@H]2c2cc(C)c(o2)[C@@H]1OC(C)=O)OC3=O

Standard InChI:  InChI=1S/C24H28O9/c1-10(2)14-8-17(28-12(4)25)24-21(33-24)16(31-22(24)27)9-23(6)20(32-23)15-7-11(3)18(30-15)19(14)29-13(5)26/h7,14,16-17,19-21H,1,8-9H2,2-6H3/t14-,16-,17+,19-,20+,21-,23+,24-/m1/s1

Standard InChI Key:  MFRKHEQNZYVKBU-CHICZLJJSA-N

Molfile:  

     RDKit          2D

 36 40  0  0  1  0  0  0  0  0999 V2000
    6.1375   -7.2292    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.6625   -6.8917    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.9875   -6.3750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.2250   -6.6875    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.6167   -5.7417    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.3750   -6.3750    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.9375   -7.8167    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.1750   -5.4417    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.1375   -5.4917    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.6625   -5.8292    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.1750   -7.2292    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.7042   -5.6417    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.6667   -7.2292    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.3625   -7.8167    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.9500   -4.9042    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.3875   -4.9042    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.9792   -6.1625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.6292   -7.0292    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.6667   -6.6000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.0792   -5.1667    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.6667   -7.8417    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.5875   -6.1625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.0750   -4.5667    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.2625   -8.1792    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.8250   -8.4250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.4000   -8.5792    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.7250   -4.0250    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.8875   -5.6167    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.5125   -6.3750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.2875   -4.4250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.9000   -6.6875    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.5917   -4.2667    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.3917   -8.8417    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.4531   -7.9212    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    5.3677   -6.4020    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    6.1215   -7.7801    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  3 18  1  0
  1  4  1  1
  5  3  1  0
  3  6  1  0
  7  1  1  0
  8  5  1  0
  9 12  1  0
 10  9  1  0
 11  2  1  0
 12 17  1  0
 13  1  1  0
 14  7  1  0
 15  9  2  0
 16 15  1  0
 17 19  1  0
 18 11  1  0
 19 13  1  0
 12 20  1  6
 13 21  1  6
 17 22  1  1
 23 20  1  0
 24  7  2  0
 25 21  1  0
 26 25  2  0
 27 23  2  0
 28 22  2  0
  3 29  1  1
 30 15  1  0
 31 22  1  0
 32 23  1  0
 33 25  1  0
  2  4  1  0
 11 14  1  0
  5  6  1  0
 10  8  1  0
 16  8  2  0
 11 34  1  1
  5 35  1  6
  2 36  1  6
M  END

Alternative Forms

  1. Parent:

    ALA298801

    Bipinnatin-F

Associated Targets(non-human)

CHRNA1 Acetylcholine receptor (120 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Biocomponents

Calculated Properties

Molecular Weight: 460.48Molecular Weight (Monoisotopic): 460.1733AlogP: 3.00#Rotatable Bonds: 3
Polar Surface Area: 117.10Molecular Species: NEUTRALHBA: 9HBD:
#RO5 Violations: HBA (Lipinski): 9HBD (Lipinski): #RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: CX LogP: 1.97CX LogD: 1.97
Aromatic Rings: 1Heavy Atoms: 33QED Weighted: 0.29Np Likeness Score: 2.93

References

1. Abramson SN, Trischman JA, Tapiolas DM, Harold EE, Fenical W, Taylor P..  (1991)  Structure/activity and molecular modeling studies of the lophotoxin family of irreversible nicotinic receptor antagonists.,  34  (6): [PMID:1676426] [10.1021/jm00110a007]

Source