The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2-[1-(4-nitro-benzyl)-(sulfonyl-(4-chlorobenzene))-ureido]-N-Hydroxy-acetamide ID: ALA300362
PubChem CID: 10670896
Max Phase: Preclinical
Molecular Formula: C16H15ClN4O7S
Molecular Weight: 442.84
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: O=C(CN(Cc1ccc([N+](=O)[O-])cc1)C(=O)NS(=O)(=O)c1ccc(Cl)cc1)NO
Standard InChI: InChI=1S/C16H15ClN4O7S/c17-12-3-7-14(8-4-12)29(27,28)19-16(23)20(10-15(22)18-24)9-11-1-5-13(6-2-11)21(25)26/h1-8,24H,9-10H2,(H,18,22)(H,19,23)
Standard InChI Key: YRUNEWMUGNJMAR-UHFFFAOYSA-N
Molfile:
RDKit 2D
29 30 0 0 0 0 0 0 0 0999 V2000
6.0500 -7.6417 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
5.5167 -7.3375 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.5167 -6.7292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.0917 -4.6167 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.0042 -6.4292 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.5667 -7.9375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9542 -6.4292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.7417 -8.1542 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.3500 -7.1125 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.5750 -4.9167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.4792 -6.7292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.6167 -4.9167 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.0917 -4.0167 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.0500 -6.4292 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.0042 -5.8292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.4292 -6.7292 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.9542 -5.8292 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.5667 -8.5292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.0792 -7.6375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.5750 -5.5250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.0417 -4.6167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.5167 -5.5250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.6000 -8.5292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.5167 -4.9167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.0500 -5.8292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.6000 -7.9292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.0792 -8.8292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.1292 -8.8292 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
3.4292 -5.5250 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 0
3 2 1 0
4 10 1 0
5 3 1 0
6 1 1 0
7 11 1 0
8 1 2 0
9 1 2 0
10 20 2 0
11 5 1 0
12 4 1 0
13 4 2 0
14 3 2 0
15 5 1 0
16 7 2 0
17 7 1 0
18 6 2 0
19 6 1 0
20 25 1 0
21 24 2 0
22 15 1 0
23 26 1 0
24 22 1 0
25 22 2 0
26 19 2 0
27 18 1 0
28 23 1 0
29 17 1 0
27 23 2 0
21 10 1 0
M CHG 2 4 1 12 -1
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 442.84Molecular Weight (Monoisotopic): 442.0350AlogP: 1.65#Rotatable Bonds: 7Polar Surface Area: 158.95Molecular Species: ACIDHBA: 7HBD: 3#RO5 Violations: ┄HBA (Lipinski): 11HBD (Lipinski): 3#RO5 Violations (Lipinski): 1CX Acidic pKa: 3.24CX Basic pKa: ┄CX LogP: 1.62CX LogD: 0.66Aromatic Rings: 2Heavy Atoms: 29QED Weighted: 0.33Np Likeness Score: -1.57
References 1. Scozzafava A, Supuran CT.. (2000) Protease inhibitors: synthesis of potent bacterial collagenase and matrix metalloproteinase inhibitors incorporating N-4-nitrobenzylsulfonylglycine hydroxamate moieties., 43 (9): [PMID:10794702 ] [10.1021/jm990594k ]