The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
[(4-Nitro-benzyl)-(3-(N-(4-Fluoro-benzene)sulfonyl)-ureido-benzenesulfonyl)-amino]-acetic acid ID: ALA301177
PubChem CID: 10650624
Max Phase: Preclinical
Molecular Formula: C22H19FN4O9S2
Molecular Weight: 566.55
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: O=C(O)CN(Cc1ccc([N+](=O)[O-])cc1)S(=O)(=O)c1cccc(NC(=O)NS(=O)(=O)c2ccc(F)cc2)c1
Standard InChI: InChI=1S/C22H19FN4O9S2/c23-16-6-10-19(11-7-16)37(33,34)25-22(30)24-17-2-1-3-20(12-17)38(35,36)26(14-21(28)29)13-15-4-8-18(9-5-15)27(31)32/h1-12H,13-14H2,(H,28,29)(H2,24,25,30)
Standard InChI Key: YDCLZJDJJGSFJZ-UHFFFAOYSA-N
Molfile:
RDKit 2D
38 40 0 0 0 0 0 0 0 0999 V2000
3.9000 -7.2292 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
7.5667 -7.2167 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
3.3792 -6.9292 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.9917 -7.0167 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.4667 -5.1167 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.5417 -7.4167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.4250 -7.5292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8542 -7.2292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.1375 -7.4250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5917 -7.7500 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.2125 -6.7125 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.3292 -6.9292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.9292 -7.2292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.9542 -5.4167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7667 -6.6500 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.3750 -7.7875 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.9667 -7.2167 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.9917 -5.4167 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.3792 -6.3292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.4667 -4.5167 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.4417 -7.5250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.5542 -8.0292 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.8042 -7.2292 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.5917 -7.0292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.2417 -8.0167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.4250 -5.1167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.9542 -6.0250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9000 -6.0250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.2667 -7.8250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.3292 -6.3292 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.9000 -5.4167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.4292 -6.3292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.8042 -8.2167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.1542 -7.2292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.8417 -8.0292 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
4.4167 -8.1292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.9292 -8.4250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.4417 -8.1292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 4 1 0
3 1 1 0
4 6 1 0
5 14 1 0
6 17 1 0
7 1 1 0
8 3 1 0
9 2 1 0
10 1 2 0
11 1 2 0
12 8 1 0
13 7 1 0
14 27 2 0
15 2 2 0
16 2 2 0
17 21 1 0
18 5 1 0
19 3 1 0
20 5 2 0
21 13 2 0
22 6 2 0
23 12 2 0
24 9 1 0
25 9 2 0
26 31 2 0
27 32 1 0
28 19 1 0
29 33 2 0
30 12 1 0
31 28 1 0
32 28 2 0
33 25 1 0
34 24 2 0
35 29 1 0
36 7 2 0
37 36 1 0
38 37 2 0
21 38 1 0
26 14 1 0
34 29 1 0
M CHG 2 5 1 18 -1
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 566.55Molecular Weight (Monoisotopic): 566.0577AlogP: 2.52#Rotatable Bonds: 10Polar Surface Area: 193.09Molecular Species: ACIDHBA: 8HBD: 3#RO5 Violations: 1HBA (Lipinski): 13HBD (Lipinski): 3#RO5 Violations (Lipinski): 2CX Acidic pKa: 2.36CX Basic pKa: ┄CX LogP: 2.81CX LogD: -1.63Aromatic Rings: 3Heavy Atoms: 38QED Weighted: 0.24Np Likeness Score: -1.91
References 1. Scozzafava A, Supuran CT.. (2000) Protease inhibitors: synthesis of potent bacterial collagenase and matrix metalloproteinase inhibitors incorporating N-4-nitrobenzylsulfonylglycine hydroxamate moieties., 43 (9): [PMID:10794702 ] [10.1021/jm990594k ]