The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
{5-[Hydroxycarbamoylmethyl-(4-nitro-benzyl)-sulfamoyl]-2-methoxy-phenyl}-carbamic acid tert-butyl ester ID: ALA301977
PubChem CID: 10839419
Max Phase: Preclinical
Molecular Formula: C21H26N4O9S
Molecular Weight: 510.53
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: COc1ccc(S(=O)(=O)N(CC(=O)NO)Cc2ccc([N+](=O)[O-])cc2)cc1NC(=O)OC(C)(C)C
Standard InChI: InChI=1S/C21H26N4O9S/c1-21(2,3)34-20(27)22-17-11-16(9-10-18(17)33-4)35(31,32)24(13-19(26)23-28)12-14-5-7-15(8-6-14)25(29)30/h5-11,28H,12-13H2,1-4H3,(H,22,27)(H,23,26)
Standard InChI Key: ATNNMKHWMHMLHP-UHFFFAOYSA-N
Molfile:
RDKit 2D
35 36 0 0 0 0 0 0 0 0999 V2000
5.0417 -7.1792 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
4.5167 -6.8792 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.6042 -5.0667 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.5625 -7.4792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.1167 -6.5625 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9917 -7.1792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.6042 -7.4667 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.0750 -7.1750 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.4667 -6.8792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.1292 -7.1667 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.3417 -6.6542 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.7375 -7.6917 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.0875 -5.3667 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.1292 -5.3667 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.5167 -6.2750 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.6042 -4.4625 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.6500 -6.2625 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.6042 -8.0792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.6000 -6.2625 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.5625 -8.0792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.9500 -7.1792 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.4667 -6.2750 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.0792 -8.3792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.1667 -6.5625 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.0875 -5.9667 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.5625 -5.0667 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.0417 -5.9667 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.5625 -6.2750 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.0417 -5.3667 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.1292 -8.3792 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.9500 -5.9667 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.1750 -7.1667 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.6917 -6.2542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.6917 -6.8667 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.6500 -8.0792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 0
3 13 1 0
4 1 1 0
5 10 1 0
6 2 1 0
7 8 2 0
8 4 1 0
9 6 1 0
10 7 1 0
11 1 2 0
12 1 2 0
13 26 1 0
14 3 1 0
15 2 1 0
16 3 2 0
17 5 1 0
18 23 2 0
19 5 2 0
20 4 2 0
21 9 2 0
22 9 1 0
23 20 1 0
24 17 1 0
25 28 1 0
26 29 2 0
27 15 1 0
28 27 2 0
29 27 1 0
30 18 1 0
31 22 1 0
32 24 1 0
33 24 1 0
34 24 1 0
35 30 1 0
7 18 1 0
25 13 2 0
M CHG 2 3 1 14 -1
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 510.53Molecular Weight (Monoisotopic): 510.1420AlogP: 2.65#Rotatable Bonds: 9Polar Surface Area: 177.41Molecular Species: NEUTRALHBA: 9HBD: 3#RO5 Violations: 1HBA (Lipinski): 13HBD (Lipinski): 3#RO5 Violations (Lipinski): 2CX Acidic pKa: 8.74CX Basic pKa: ┄CX LogP: 2.11CX LogD: 2.09Aromatic Rings: 2Heavy Atoms: 35QED Weighted: 0.26Np Likeness Score: -1.66
References 1. Scozzafava A, Supuran CT.. (2000) Protease inhibitors: synthesis of potent bacterial collagenase and matrix metalloproteinase inhibitors incorporating N-4-nitrobenzylsulfonylglycine hydroxamate moieties., 43 (9): [PMID:10794702 ] [10.1021/jm990594k ]