2-Hydroxy-N-{3-[hydroxy-(3-phenyl-acryloyl)-amino]-propyl}-2-({3-[hydroxy-(3-phenyl-acryloyl)-amino]-propylcarbamoyl}-methyl)-succinamic acid

ID: ALA303540

PubChem CID: 10952113

Max Phase: Preclinical

Molecular Formula: C30H36N4O9

Molecular Weight: 596.64

Molecule Type: Small molecule

Names and Identifiers

Canonical SMILES:  O=C(CC(O)(CC(=O)NCCCN(O)C(=O)/C=C/c1ccccc1)C(=O)O)NCCCN(O)C(=O)/C=C/c1ccccc1

Standard InChI:  InChI=1S/C30H36N4O9/c35-25(31-17-7-19-33(42)27(37)15-13-23-9-3-1-4-10-23)21-30(41,29(39)40)22-26(36)32-18-8-20-34(43)28(38)16-14-24-11-5-2-6-12-24/h1-6,9-16,41-43H,7-8,17-22H2,(H,31,35)(H,32,36)(H,39,40)/b15-13+,16-14+

Standard InChI Key:  WBCMWVHMHSBDKL-WXUKJITCSA-N

Molfile:  

     RDKit          2D

 43 44  0  0  0  0  0  0  0  0999 V2000
    5.1000   -2.7750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.3792   -3.1875    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.8125   -3.1792    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.6208   -2.7917    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.8125   -2.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.0917   -1.9500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.5292   -3.1625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.3333   -3.2042    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.5250   -2.7667    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6667   -2.7792    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.2417   -2.7417    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.0458   -2.8000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.1000   -3.2042    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   10.1000   -3.1667    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -0.6208   -1.9667    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   10.8125   -1.9250    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.8042   -1.5292    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.5250   -1.9417    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.6667   -1.9542    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.2417   -3.1792    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.9542   -3.1917    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.0917   -3.6000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.5042   -1.3625    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.7583   -3.2167    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.9542   -3.1542    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0917   -4.0292    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   10.1042   -3.9917    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.5292   -3.2000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.6667   -3.1667    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.8125   -2.7875    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.3792   -2.7542    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.2417   -2.7792    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.9542   -2.7625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.6625   -2.7375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.4750   -2.8042    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.7583   -4.0417    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.9542   -3.9792    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.4750   -4.4542    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.1875   -3.2167    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.6667   -4.3792    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.3792   -3.1417    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.3875   -3.9667    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.1875   -4.0417    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  3  1  1  0
  4 13  1  0
  5 14  1  0
  6  1  1  0
  7  5  1  0
  8  4  1  0
  9  3  1  0
 10  2  1  0
 11  7  2  0
 12  8  2  0
 13 30  1  0
 14 31  1  0
 15  4  2  0
 16  5  2  0
 17  6  2  0
 18  9  2  0
 19 10  2  0
 20  9  1  0
 21 10  1  0
 22  1  1  0
 23  6  1  0
 24 12  1  0
 25 11  1  0
 26 13  1  0
 27 14  1  0
 28 32  1  0
 29 33  1  0
 30 28  1  0
 31 29  1  0
 32 21  1  0
 33 20  1  0
 34 25  1  0
 35 24  2  0
 36 24  1  0
 37 25  2  0
 38 36  2  0
 39 35  1  0
 40 37  1  0
 41 34  2  0
 42 40  2  0
 43 38  1  0
 41 42  1  0
 39 43  2  0
M  END

Alternative Forms

1. Parent:

   

   ALA303540

   2-hydroxy-4-[3-[hydroxy-[(E)-3-phenylprop-2-enoyl]amino]propylamino]-2-[2-[3-[hydroxy-[(E)-3-phenylprop-2-enoyl]amino]propylamino]-2-oxoethyl]-4-oxobutanoic acid

Molecule Features

Natural Product: No

Oral: No

Chemical Probe: No

Parenteral: No

Molecule Type: Small molecule

Topical: No

First In Class: No

Black Box: No

Chirality: No

Availability: No

Prodrug: No

Calculated Properties

Molecular Weight: 596.64

Molecular Weight (Monoisotopic): 596.2482

AlogP: 1.46

#Rotatable Bonds: 17

Polar Surface Area: 196.81

Molecular Species: ACID

HBA: 8

HBD: 6

#RO5 Violations: 2

HBA (Lipinski): 13

HBD (Lipinski): 6

#RO5 Violations (Lipinski): 3

CX Acidic pKa: 3.55

CX Basic pKa: ┄

CX LogP: 0.39

CX LogD: -3.01

Aromatic Rings: 2

Heavy Atoms: 43

QED Weighted: 0.07

Np Likeness Score: 0.07

References

1. Guo H, Naser SA, Ghobrial G, Phanstiel O..  (2002)  Synthesis and biological evaluation of new citrate-based siderophores as potential probes for the mechanism of iron uptake in mycobacteria.,  45  (10): [PMID:11985473] [10.1021/jm0104522]

Source

Source(1):

• Scientific Literature