The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
6-{6,7-di(benzyloxy)-8-[2-(1H-3-indolyl)ethyl]-3,8-diazabicyclo[3.2.1]oct-3-yl}-1-hexanamine ID: ALA3037859
PubChem CID: 67800569
Max Phase: Preclinical
Molecular Formula: C36H46N4O2
Molecular Weight: 566.79
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: NCCCCCCN1CC2[C@@H](OCc3ccccc3)[C@H](OCc3ccccc3)[C@H](C1)N2CCc1c[nH]c2ccccc12
Standard InChI: InChI=1S/C36H46N4O2/c37-20-11-1-2-12-21-39-24-33-35(41-26-28-13-5-3-6-14-28)36(42-27-29-15-7-4-8-16-29)34(25-39)40(33)22-19-30-23-38-32-18-10-9-17-31(30)32/h3-10,13-18,23,33-36,38H,1-2,11-12,19-22,24-27,37H2/t33-,34?,35+,36+/m0/s1
Standard InChI Key: HCLMVTFMVQFQOL-ISBWPTOWSA-N
Molfile:
RDKit 2D
44 49 0 0 1 0 0 0 0 0999 V2000
11.5611 -9.7168 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
10.8574 -9.8290 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.8697 -9.2666 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.5555 -9.1124 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.7005 -8.4012 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.8831 -10.1142 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.5440 -10.0668 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
13.7271 -9.4467 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.0627 -10.2004 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.3681 -9.8883 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.7345 -9.1937 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.7039 -7.5762 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.2093 -9.9795 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.2376 -10.5209 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.3402 -8.8947 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.0547 -9.3072 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.9201 -9.2752 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.2535 -8.5234 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.9912 -7.1608 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.6431 -11.1456 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.7398 -9.8830 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.4326 -8.6047 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.9945 -6.3358 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.3402 -8.0697 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.7691 -8.8947 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.4474 -11.3294 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.9516 -7.9344 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.7107 -5.9262 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.2818 -5.9203 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.0925 -9.3564 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.1785 -10.4876 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.0087 -10.7247 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.3742 -10.3039 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.8129 -10.9085 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.0547 -7.6572 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.7691 -8.0697 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.7141 -5.1012 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.2851 -5.0953 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.2715 -9.4378 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.1306 -8.0158 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.0013 -4.6858 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.7906 -8.7675 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.5219 -8.3234 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
9.9166 -9.6344 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 0
3 1 1 0
5 3 1 0
6 9 1 0
7 13 1 0
8 17 1 0
9 8 2 0
10 1 1 0
4 11 1 0
5 12 1 0
14 2 1 0
15 8 1 0
16 15 2 0
17 10 1 0
18 11 1 0
19 12 1 0
20 26 1 0
21 7 1 0
22 18 1 0
23 19 1 0
24 15 1 0
25 16 1 0
26 32 1 0
27 22 1 0
28 23 2 0
29 23 1 0
30 22 2 0
31 21 1 0
32 34 1 0
33 31 1 0
34 33 1 0
35 24 2 0
36 35 1 0
37 28 1 0
38 29 2 0
39 30 1 0
40 27 2 0
41 38 1 0
42 39 2 0
5 43 1 1
4 44 1 6
5 4 1 0
7 14 1 0
6 16 1 0
25 36 2 0
37 41 2 0
40 42 1 0
13 3 1 0
2 4 1 1
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 566.79Molecular Weight (Monoisotopic): 566.3621AlogP: 5.77#Rotatable Bonds: 15Polar Surface Area: 66.75Molecular Species: BASEHBA: 5HBD: 2#RO5 Violations: 2HBA (Lipinski): 6HBD (Lipinski): 3#RO5 Violations (Lipinski): 2CX Acidic pKa: ┄CX Basic pKa: 10.21CX LogP: 6.24CX LogD: 2.73Aromatic Rings: 4Heavy Atoms: 42QED Weighted: 0.18Np Likeness Score: -0.11
References 1. Damour D, Barreau M, Blanchard J, Burgevin M, Doble A, Herman F, Pantel G, James-Surcouf E, Vuilhorgne M, Mignani S, Poitout L, Merrer YL, Depezay J. (1996) Design, synthesis and binding affinities of novel non-peptide mimics of somatostatin/sandostatin, 6 (14): [10.1016/0960-894X(96)00289-2 ]