5-(3-cyclopropylmethyl-11-hydroxy-15-methoxy-13-oxa-3-azahexacyclo[13.2.2.12,8.01,6.06,14.07,12]icosa-7,9,11,18-tetraen-16-yl)-3-methylenetetrahydro-2-furanone

ID: ALA3038199

PubChem CID: 73351274

Max Phase: Preclinical

Molecular Formula: C28H31NO5

Molecular Weight: 461.56

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  C=C1C[C@H]([C@H]2C[C@@]34C=C[C@]2(OC)[C@@H]2Oc5c(O)ccc6c5[C@@]23CCN(CC2CC2)[C@@H]4C6)OC1=O

Standard InChI:  InChI=1S/C28H31NO5/c1-15-11-20(33-24(15)31)18-13-26-7-8-28(18,32-2)25-27(26)9-10-29(14-16-3-4-16)21(26)12-17-5-6-19(30)23(34-25)22(17)27/h5-8,16,18,20-21,25,30H,1,3-4,9-14H2,2H3/t18-,20-,21-,25-,26-,27+,28-/m1/s1

Standard InChI Key:  OZWOAKUHWIGMQA-IXUQSROBSA-N

Molfile:  

     RDKit          2D

 38 45  0  0  1  0  0  0  0  0999 V2000
    6.6918   -4.9418    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.4044   -5.3626    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.9669   -6.1626    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.9794   -5.3418    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.7001   -4.1251    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.9794   -3.7168    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.5793   -4.5418    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.6752   -6.5793    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.1169   -4.9543    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.8294   -5.3668    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.6669   -7.4044    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.4127   -3.7168    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.2502   -8.6669    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.6669   -5.3501    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0043   -7.8877    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.6669   -6.0794    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.3919   -6.1793    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.0669   -8.6794    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.1252   -4.1293    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.2793   -4.3543    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.3294   -7.9002    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.5419   -5.7794    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.9794   -2.8918    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.2545   -5.3668    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.6920   -4.3543    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.0795   -5.3668    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.4669   -4.5669    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.4127   -2.8876    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.8293   -9.3795    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.6544   -9.2628    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.2501   -6.5627    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.6918   -2.4751    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.2669   -2.4751    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.5418   -6.1419    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.6608   -8.4027    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    7.5335   -7.0891    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    8.3305   -5.7512    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    5.1750   -5.5253    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  3  4  1  0
  4  1  1  0
  5  1  1  0
  6  5  1  0
  7  4  1  0
  8  3  1  0
  9  2  1  0
 10 25  1  0
  8 11  1  0
 12  5  2  0
 13 15  1  0
  2 14  1  6
 11 15  1  0
  3 16  1  0
 17  2  1  0
 18 21  1  0
 19 12  1  0
  1 20  1  1
 21 11  1  0
 22 10  1  0
 23  6  2  0
 24 22  1  0
 25 20  1  0
 26 24  1  0
 27 24  1  0
 28 12  1  0
 29 13  2  0
 30 18  2  0
  3 31  1  6
 32 28  2  0
 33 23  1  0
 34 31  1  0
 11 35  1  6
  6  7  1  0
 17  8  1  0
 10  9  1  0
 19  9  1  0
 16 14  2  0
 32 23  1  0
 26 27  1  0
 18 13  1  0
  8 36  1  1
  9 37  1  6
  4 38  1  1
M  END

Associated Targets(non-human)

OPRM1 Mu opioid receptor (123 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 461.56Molecular Weight (Monoisotopic): 461.2202AlogP: 3.26#Rotatable Bonds: 4
Polar Surface Area: 68.23Molecular Species: BASEHBA: 6HBD: 1
#RO5 Violations: HBA (Lipinski): 6HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: 10.37CX Basic pKa: 9.56CX LogP: 2.83CX LogD: 0.95
Aromatic Rings: 1Heavy Atoms: 34QED Weighted: 0.42Np Likeness Score: 1.93

References

1. Klein P, Nelson WL, Yao YH, Simon EJ..  (1990)  Electrophilic alpha-methylene-gamma-lactone and isothiocyanate opioid ligands related to etorphine.,  33  (8): [PMID:2165166] [10.1021/jm00170a038]

Source