The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
Khayasin ID: ALA3039236
PubChem CID: 6708530
Max Phase: Preclinical
Molecular Formula: C32H42O8
Molecular Weight: 554.68
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CCC(C)C(=O)OC1[C@@H]2CC3=C4CC(=O)O[C@@H](c5ccoc5)[C@]4(C)CCC3[C@@](C)(C2=O)[C@@H](CC(=O)OC)C1(C)C
Standard InChI: InChI=1S/C32H42O8/c1-8-17(2)29(36)40-28-20-13-19-21(32(6,26(20)35)23(30(28,3)4)15-24(33)37-7)9-11-31(5)22(19)14-25(34)39-27(31)18-10-12-38-16-18/h10,12,16-17,20-21,23,27-28H,8-9,11,13-15H2,1-7H3/t17?,20-,21?,23+,27+,28?,31-,32-/m1/s1
Standard InChI Key: OVTKCGJIOHGDAN-HMQLAQMASA-N
Molfile:
RDKit 2D
41 45 0 0 0 0 0 0 0 0999 V2000
-0.8201 -1.7001 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.6400 -0.5600 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.4601 0.3000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.8601 -2.6802 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.2201 -1.6601 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.3202 1.0601 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.6801 -0.7200 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5002 0.3000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.2400 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2801 0.9801 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.1203 1.9601 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.3601 -1.4001 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.7850 1.0673 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-3.1002 2.1001 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-5.5280 2.4802 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.7605 2.5679 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2401 1.3201 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.3403 0.9401 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.5202 0.0400 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.4200 0.4200 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.4293 0.9205 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.7489 2.3869 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.9293 -3.8782 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-6.3507 3.6984 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.4047 1.2720 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-7.7872 3.2668 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.7115 3.1506 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.5482 2.3006 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-7.8206 1.7672 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.8610 3.1941 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.0474 3.3402 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.7227 -2.4908 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.4418 1.4868 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.2098 1.5228 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.3132 1.5905 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.1784 2.8442 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.0230 4.8408 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.0965 2.7575 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.4339 4.0167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.0519 5.4583 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.6825 -0.8169 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
2 7 1 0
3 2 2 0
1 4 1 0
5 4 1 0
6 18 1 0
7 1 1 0
8 10 1 0
9 1 1 0
10 9 1 0
11 6 1 0
12 2 1 0
13 8 1 0
14 11 1 0
11 15 1 6
16 13 1 0
17 20 1 0
18 19 1 0
19 7 1 0
20 3 1 0
9 21 1 1
22 21 1 0
23 4 2 0
24 15 2 0
25 15 1 0
26 24 1 0
27 16 2 0
28 17 2 0
29 25 2 0
30 22 2 0
31 16 1 0
1 32 1 1
6 33 1 6
34 10 1 0
35 10 1 0
36 22 1 0
37 31 1 0
38 31 1 0
39 36 1 0
40 37 1 0
5 8 1 0
5 12 1 0
6 3 1 0
14 17 1 0
26 29 1 0
5 41 1 6
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: YesOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 554.68Molecular Weight (Monoisotopic): 554.2880AlogP: 5.75#Rotatable Bonds: 6Polar Surface Area: 109.11Molecular Species: NEUTRALHBA: 8HBD: ┄#RO5 Violations: 2HBA (Lipinski): 8HBD (Lipinski): ┄#RO5 Violations (Lipinski): 2CX Acidic pKa: ┄CX Basic pKa: ┄CX LogP: 5.17CX LogD: 5.17Aromatic Rings: 1Heavy Atoms: 40QED Weighted: 0.25Np Likeness Score: 2.81
References 1. Li M, Zhang J, Feng G, Satyanandamurty T, Wu J. (2011) Khayasin and 2S-methylbutanoylproceranolide: Promising candidate insecticides for the control of the coconut leaf beetle, Brontispa longissima, 36 (1): [10.1584/jpestics.G10-52 ] 2. De Bruyn T, van Westen GJ, Ijzerman AP, Stieger B, de Witte P, Augustijns PF, Annaert PP.. (2013) Structure-based identification of OATP1B1/3 inhibitors., 83 (6): [PMID:23571415 ] [10.1124/mol.112.084152 ]