The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
3,3,3',3'-tetramethyl-1,1'-spirobi(indan)-6,6'-diol disulphate ID: ALA304673
PubChem CID: 10415022
Max Phase: Preclinical
Molecular Formula: C21H22K2O8S2
Molecular Weight: 468.55
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CC1(C)CC2(CC(C)(C)c3ccc(OS(=O)(=O)[O-])cc32)c2cc(OS(=O)(=O)[O-])ccc21.[K+].[K+]
Standard InChI: InChI=1S/C21H24O8S2.2K/c1-19(2)11-21(17-9-13(5-7-15(17)19)28-30(22,23)24)12-20(3,4)16-8-6-14(10-18(16)21)29-31(25,26)27;;/h5-10H,11-12H2,1-4H3,(H,22,23,24)(H,25,26,27);;/q;2*+1/p-2
Standard InChI Key: VFVYBUBDICVINW-UHFFFAOYSA-L
Molfile:
RDKit 2D
33 34 0 0 0 0 0 0 0 0999 V2000
8.3625 1.2208 0.0000 K 0 0 0 0 0 15 0 0 0 0 0 0
4.8375 -2.4167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.6625 -2.4167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.0125 -2.4167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.9417 -4.5500 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
7.7042 -0.2667 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
6.0667 -3.1375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.6042 -1.6917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.8542 -3.9292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.1875 -1.1042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.8292 -3.2417 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.8292 -1.5917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.3000 -0.9875 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.3625 -3.8375 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.1167 0.4458 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.5292 -5.2625 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.7792 -1.6917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.8917 -3.1375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.6000 -3.1250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.0667 -1.7042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.5042 -0.4792 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.9917 0.1458 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.6542 -4.9625 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.2292 -4.1292 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.8917 -1.7042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.7750 -3.1250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.3625 -2.4042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.3042 -2.4167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.4667 -0.6917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.4000 -0.3042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.5667 -4.3417 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.4375 -4.6417 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2125 -5.9042 0.0000 K 0 0 0 0 0 15 0 0 0 0 0 0
3 2 1 0
4 2 1 0
5 14 1 0
6 13 1 0
7 3 2 0
8 4 2 0
9 11 1 0
10 12 1 0
11 2 1 0
12 2 1 0
13 25 1 0
14 26 1 0
15 6 1 0
16 5 1 0
17 8 1 0
18 7 1 0
19 4 1 0
20 3 1 0
21 6 2 0
22 6 2 0
23 5 2 0
24 5 2 0
25 20 2 0
26 19 2 0
27 26 1 0
28 25 1 0
29 10 1 0
30 10 1 0
31 9 1 0
32 9 1 0
10 8 1 0
9 7 1 0
27 17 2 0
28 18 2 0
M CHG 4 1 1 15 -1 16 -1 33 1
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 468.55Molecular Weight (Monoisotopic): 468.0913AlogP: 3.70#Rotatable Bonds: 4Polar Surface Area: 127.20Molecular Species: ACIDHBA: 6HBD: 2#RO5 Violations: ┄HBA (Lipinski): 8HBD (Lipinski): 2#RO5 Violations (Lipinski): ┄CX Acidic pKa: -2.01CX Basic pKa: ┄CX LogP: 4.37CX LogD: -0.38Aromatic Rings: 2Heavy Atoms: 31QED Weighted: 0.65Np Likeness Score: 0.57
References 1. Molteni V, Rhodes D, Rubins K, Hansen M, Bushman FD, Siegel JS.. (2000) A new class of HIV-1 integrase inhibitors: the 3,3,3', 3'-tetramethyl-1,1'-spirobi(indan)-5,5',6,6'-tetrol family., 43 (10): [PMID:10821715 ] [10.1021/jm990600c ]