The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(5S,6S)-5,6-Diacetoxy-7-[(1R,2S)-4-chloro-2-hydroxy-2-((Z)-oct-2-enyl)-5-oxo-cyclopent-3-enyl]-heptanoic acid methyl ester ID: ALA304706
PubChem CID: 5283258
Max Phase: Preclinical
Molecular Formula: C25H37ClO8
Molecular Weight: 501.02
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CCCCC/C=C\C[C@@]1(O)C=C(Cl)C(=O)[C@@H]1C[C@H](OC(C)=O)[C@H](CCCC(=O)OC)OC(C)=O
Standard InChI: InChI=1S/C25H37ClO8/c1-5-6-7-8-9-10-14-25(31)16-20(26)24(30)19(25)15-22(34-18(3)28)21(33-17(2)27)12-11-13-23(29)32-4/h9-10,16,19,21-22,31H,5-8,11-15H2,1-4H3/b10-9-/t19-,21-,22-,25+/m0/s1
Standard InChI Key: UQSBPTWIGBVTJJ-WRXYSHGISA-N
Molfile:
RDKit 2D
34 34 0 0 1 0 0 0 0 0999 V2000
3.8417 -0.0417 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.7625 -0.8292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5875 -0.8292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5042 -0.0417 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.1750 0.4458 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.6292 0.2125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.2917 -0.2667 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.2917 -1.0917 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.0750 0.9250 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.0000 -1.5125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.8125 1.2958 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.0292 0.1000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.1667 1.2708 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.8792 -0.0542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.9917 -2.3375 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.8542 2.1208 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.9292 0.7708 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.7250 0.2125 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
3.7292 -2.2500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2167 -2.9167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.1667 -1.5417 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.0667 -1.4917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.5750 -0.5042 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.1500 -0.4292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.4542 0.0208 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.7167 -0.3500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.5042 0.8458 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.7167 -1.1042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.0375 -2.8292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.3125 -0.1375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.5167 -3.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.8250 -4.0792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.3417 -3.4125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.6417 -3.9917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 3 1 0
3 1 1 0
4 5 1 0
5 1 1 0
1 6 1 6
7 6 1 0
7 8 1 1
12 9 1 1
10 8 1 0
11 9 1 0
12 7 1 0
13 5 2 0
14 24 1 0
15 10 2 0
16 11 2 0
17 14 2 0
18 4 1 0
19 22 1 0
20 19 2 0
3 21 1 6
3 22 1 1
23 14 1 0
24 25 1 0
25 26 1 0
26 12 1 0
27 11 1 0
28 10 1 0
29 20 1 0
30 23 1 0
31 29 1 0
32 33 1 0
33 31 1 0
34 32 1 0
2 4 2 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 501.02Molecular Weight (Monoisotopic): 500.2177AlogP: 4.16#Rotatable Bonds: 15Polar Surface Area: 116.20Molecular Species: NEUTRALHBA: 8HBD: 1#RO5 Violations: 1HBA (Lipinski): 8HBD (Lipinski): 1#RO5 Violations (Lipinski): 1CX Acidic pKa: 13.79CX Basic pKa: ┄CX LogP: 3.92CX LogD: 3.92Aromatic Rings: ┄Heavy Atoms: 34QED Weighted: 0.15Np Likeness Score: 1.54
References 1. Verbitski SM, Mullally JE, Fitzpatrick FA, Ireland CM.. (2004) Punaglandins, chlorinated prostaglandins, function as potent Michael receptors to inhibit ubiquitin isopeptidase activity., 47 (8): [PMID:15056003 ] [10.1021/jm030448l ]