The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(2S,3R)-5-Methyl-3-(piperidine-1-carbonyl)-2-(3,4,4-trimethyl-2,5-dioxo-imidazolidin-1-ylmethyl)-hexanoic acid hydroxyamide ID: ALA305729
PubChem CID: 44313996
Max Phase: Preclinical
Molecular Formula: C20H34N4O5
Molecular Weight: 410.52
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CC(C)C[C@@H](C(=O)N1CCCCC1)[C@@H](CN1C(=O)N(C)C(C)(C)C1=O)C(=O)NO
Standard InChI: InChI=1S/C20H34N4O5/c1-13(2)11-14(17(26)23-9-7-6-8-10-23)15(16(25)21-29)12-24-18(27)20(3,4)22(5)19(24)28/h13-15,29H,6-12H2,1-5H3,(H,21,25)/t14-,15-/m1/s1
Standard InChI Key: XNKSQYFVFJZMOA-HUUCEWRRSA-N
Molfile:
RDKit 2D
29 30 0 0 1 0 0 0 0 0999 V2000
-1.9708 -0.7625 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.7875 -0.8417 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.6458 -1.5167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.9625 -1.6417 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.2583 -2.0625 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2583 0.4750 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.5458 0.8875 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.1667 0.4750 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2583 -0.3500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.8875 0.8875 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.9708 0.8875 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.3375 -0.2292 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.8375 -1.6917 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.1667 -0.3500 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.5458 1.7125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.9708 1.7125 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.6833 0.4750 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-3.7208 -1.9667 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.1833 -2.8792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.6750 -2.6417 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.4833 0.2625 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.6000 0.4750 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.8792 1.7125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.1667 2.1250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.0458 2.9333 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.8792 2.5458 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.6042 2.1208 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.3125 0.8833 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.3167 1.7083 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 0
3 1 1 0
4 2 1 0
5 3 1 0
6 9 1 1
7 6 1 0
8 7 1 0
9 1 1 0
10 8 1 0
11 6 1 0
12 2 2 0
13 3 2 0
14 8 2 0
7 15 1 1
16 11 2 0
17 11 1 0
18 4 1 0
19 5 1 0
20 5 1 0
21 17 1 0
22 10 1 0
23 10 1 0
24 15 1 0
25 24 1 0
26 24 1 0
27 23 1 0
28 22 1 0
29 27 1 0
4 5 1 0
29 28 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 410.52Molecular Weight (Monoisotopic): 410.2529AlogP: 1.46#Rotatable Bonds: 7Polar Surface Area: 110.26Molecular Species: NEUTRALHBA: 5HBD: 2#RO5 Violations: ┄HBA (Lipinski): 9HBD (Lipinski): 2#RO5 Violations (Lipinski): ┄CX Acidic pKa: 8.85CX Basic pKa: 0.22CX LogP: 0.78CX LogD: 0.77Aromatic Rings: ┄Heavy Atoms: 29QED Weighted: 0.38Np Likeness Score: -0.38
References 1. Broadhurst M, Brown P, Lawton G, Ballantyne N, Borkakoti N, Bottomley K, Cooper M, Eatherton A, Kilford I, Malsher P, Nixon J, Lewis E, Sutton B, Johnson W. (1997) Design and synthesis of the cartilage protective agent (CPA, Ro32-3555), 7 (17): [10.1016/S0960-894X(97)00416-2 ]